research use only
Cat.No.S1150
| Related Targets | Akt Wnt/beta-catenin PKC HSP ROCK Microtubule Associated Integrin Bcr-Abl Actin FAK |
|---|---|
| Other Antineoplastic and Immunosuppressive Antibiotics Inhibitors | Staurosporine (STS) Cyclosporin A Oligomycin A (MCH 32) Puromycin Dihydrochloride Nigericin sodium salt Geldanamycin (NSC 122750) Honokiol Streptozotocin (STZ) Sodium Monensin (NSC 343257) Cephalomannine |
| Cell Lines | Assay Type | Concentration | Incubation Time | Formulation | Activity Description | PMID |
|---|---|---|---|---|---|---|
| TE-15 | Growth Inhibition Assay | IC50 = 0.0002869 μM | SANGER | |||
| LC-2-ad | Growth Inhibition Assay | IC50 = 0.0003167 μM | SANGER | |||
| RL95-2 | Growth Inhibition Assay | IC50 = 0.0006681 μM | SANGER | |||
| MZ1-PC | Growth Inhibition Assay | IC50 = 0.0007294 μM | SANGER | |||
| TE-8 | Growth Inhibition Assay | IC50 = 0.001174 μM | SANGER | |||
| SW954 | Growth Inhibition Assay | IC50 = 0.001187 μM | SANGER | |||
| TE-11 | Growth Inhibition Assay | IC50 = 0.001231 μM | SANGER | |||
| PSN1 | Growth Inhibition Assay | IC50 = 0.001301 μM | SANGER | |||
| MOLT-4 | Growth Inhibition Assay | IC50 = 0.001493 μM | SANGER | |||
| 697 | Growth Inhibition Assay | IC50 = 0.001495 μM | SANGER | |||
| ETK-1 | Growth Inhibition Assay | IC50 = 0.001521 μM | SANGER | |||
| TE-10 | Growth Inhibition Assay | IC50 = 0.001543 μM | SANGER | |||
| HUTU-80 | Growth Inhibition Assay | IC50 = 0.001682 μM | SANGER | |||
| NTERA-S-cl-D1 | Growth Inhibition Assay | IC50 = 0.002088 μM | SANGER | |||
| MFH-ino | Growth Inhibition Assay | IC50 = 0.00268 μM | SANGER | |||
| IA-LM | Growth Inhibition Assay | IC50 = 0.002802 μM | SANGER | |||
| MC116 | Growth Inhibition Assay | IC50 = 0.002888 μM | SANGER | |||
| RKO | Growth Inhibition Assay | IC50 = 0.002977 μM | SANGER | |||
| MRK-nu-1 | Growth Inhibition Assay | IC50 = 0.00299 μM | SANGER | |||
| VA-ES-BJ | Growth Inhibition Assay | IC50 = 0.002996 μM | SANGER | |||
| KALS-1 | Growth Inhibition Assay | IC50 = 0.00308 μM | SANGER | |||
| BB30-HNC | Growth Inhibition Assay | IC50 = 0.003138 μM | SANGER | |||
| ACN | Growth Inhibition Assay | IC50 = 0.003157 μM | SANGER | |||
| TE-9 | Growth Inhibition Assay | IC50 = 0.003255 μM | SANGER | |||
| SIG-M5 | Growth Inhibition Assay | IC50 = 0.003272 μM | SANGER | |||
| no-10 | Growth Inhibition Assay | IC50 = 0.003618 μM | SANGER | |||
| EW-1 | Growth Inhibition Assay | IC50 = 0.003714 μM | SANGER | |||
| SK-LMS-1 | Growth Inhibition Assay | IC50 = 0.004006 μM | SANGER | |||
| GT3TKB | Growth Inhibition Assay | IC50 = 0.004339 μM | SANGER | |||
| ES4 | Growth Inhibition Assay | IC50 = 0.004494 μM | SANGER | |||
| IMR-5 | Growth Inhibition Assay | IC50 = 0.004496 μM | SANGER | |||
| NCI-H1648 | Growth Inhibition Assay | IC50 = 0.004687 μM | SANGER | |||
| MV-4-11 | Growth Inhibition Assay | IC50 = 0.004747 μM | SANGER | |||
| SK-UT-1 | Growth Inhibition Assay | IC50 = 0.004803 μM | SANGER | |||
| NB13 | Growth Inhibition Assay | IC50 = 0.004912 μM | SANGER | |||
| DJM-1 | Growth Inhibition Assay | IC50 = 0.005301 μM | SANGER | |||
| ES8 | Growth Inhibition Assay | IC50 = 0.00538 μM | SANGER | |||
| TE-6 | Growth Inhibition Assay | IC50 = 0.005703 μM | SANGER | |||
| KS-1 | Growth Inhibition Assay | IC50 = 0.005816 μM | SANGER | |||
| TE-1 | Growth Inhibition Assay | IC50 = 0.006059 μM | SANGER | |||
| ATN-1 | Growth Inhibition Assay | IC50 = 0.00609 μM | SANGER | |||
| A4-Fuk | Growth Inhibition Assay | IC50 = 0.006109 μM | SANGER | |||
| ALL-PO | Growth Inhibition Assay | IC50 = 0.006298 μM | SANGER | |||
| BE-13 | Growth Inhibition Assay | IC50 = 0.006363 μM | SANGER | |||
| KM12 | Growth Inhibition Assay | IC50 = 0.006373 μM | SANGER | |||
| NOS-1 | Growth Inhibition Assay | IC50 = 0.006496 μM | SANGER | |||
| OCUB-M | Growth Inhibition Assay | IC50 = 0.006617 μM | SANGER | |||
| SW962 | Growth Inhibition Assay | IC50 = 0.006623 μM | SANGER | |||
| NCI-H510A | Growth Inhibition Assay | IC50 = 0.006652 μM | SANGER | |||
| EW-16 | Growth Inhibition Assay | IC50 = 0.006937 μM | SANGER | |||
| KGN | Growth Inhibition Assay | IC50 = 0.007124 μM | SANGER | |||
| LS-411N | Growth Inhibition Assay | IC50 = 0.007166 μM | SANGER | |||
| Becker | Growth Inhibition Assay | IC50 = 0.0072 μM | SANGER | |||
| HC-1 | Growth Inhibition Assay | IC50 = 0.007213 μM | SANGER | |||
| CESS | Growth Inhibition Assay | IC50 = 0.007374 μM | SANGER | |||
| KURAMOCHI | Growth Inhibition Assay | IC50 = 0.007478 μM | SANGER | |||
| TGBC24TKB | Growth Inhibition Assay | IC50 = 0.007523 μM | SANGER | |||
| SW982 | Growth Inhibition Assay | IC50 = 0.00766 μM | SANGER | |||
| HCE-4 | Growth Inhibition Assay | IC50 = 0.007671 μM | SANGER | |||
| LOUCY | Growth Inhibition Assay | IC50 = 0.00775 μM | SANGER | |||
| 8-MG-BA | Growth Inhibition Assay | IC50 = 0.007958 μM | SANGER | |||
| HT-144 | Growth Inhibition Assay | IC50 = 0.008003 μM | SANGER | |||
| LXF-289 | Growth Inhibition Assay | IC50 = 0.008184 μM | SANGER | |||
| RS4-11 | Growth Inhibition Assay | IC50 = 0.008357 μM | SANGER | |||
| DEL | Growth Inhibition Assay | IC50 = 0.008449 μM | SANGER | |||
| OCI-AML2 | Growth Inhibition Assay | IC50 = 0.008521 μM | SANGER | |||
| CCRF-CEM | Growth Inhibition Assay | IC50 = 0.008708 μM | SANGER | |||
| A388 | Growth Inhibition Assay | IC50 = 0.008738 μM | SANGER | |||
| KNS-42 | Growth Inhibition Assay | IC50 = 0.008907 μM | SANGER | |||
| OVCAR-4 | Growth Inhibition Assay | IC50 = 0.009041 μM | SANGER | |||
| NCI-H1355 | Growth Inhibition Assay | IC50 = 0.009138 μM | SANGER | |||
| BL-70 | Growth Inhibition Assay | IC50 = 0.009303 μM | SANGER | |||
| BL-41 | Growth Inhibition Assay | IC50 = 0.009345 μM | SANGER | |||
| A101D | Growth Inhibition Assay | IC50 = 0.009598 μM | SANGER | |||
| HL-60 | Growth Inhibition Assay | IC50 = 0.009656 μM | SANGER | |||
| COR-L279 | Growth Inhibition Assay | IC50 = 0.00999 μM | SANGER | |||
| NCI-SNU-16 | Growth Inhibition Assay | IC50 = 0.01008 μM | SANGER | |||
| Calu-6 | Growth Inhibition Assay | IC50 = 0.01012 μM | SANGER | |||
| SR | Growth Inhibition Assay | IC50 = 0.01026 μM | SANGER | |||
| QIMR-WIL | Growth Inhibition Assay | IC50 = 0.01033 μM | SANGER | |||
| LB647-SCLC | Growth Inhibition Assay | IC50 = 0.01051 μM | SANGER | |||
| RPMI-8226 | Growth Inhibition Assay | IC50 = 0.01102 μM | SANGER | |||
| SK-PN-DW | Growth Inhibition Assay | IC50 = 0.01112 μM | SANGER | |||
| SF268 | Growth Inhibition Assay | IC50 = 0.01151 μM | SANGER | |||
| HD-MY-Z | Growth Inhibition Assay | IC50 = 0.01163 μM | SANGER | |||
| DOHH-2 | Growth Inhibition Assay | IC50 = 0.01203 μM | SANGER | |||
| SCC-3 | Growth Inhibition Assay | IC50 = 0.01204 μM | SANGER | |||
| ST486 | Growth Inhibition Assay | IC50 = 0.01204 μM | SANGER | |||
| NALM-6 | Growth Inhibition Assay | IC50 = 0.01214 μM | SANGER | |||
| NCI-H1436 | Growth Inhibition Assay | IC50 = 0.01231 μM | SANGER | |||
| KE-37 | Growth Inhibition Assay | IC50 = 0.01234 μM | SANGER | |||
| RPMI-8402 | Growth Inhibition Assay | IC50 = 0.01256 μM | SANGER | |||
| RXF393 | Growth Inhibition Assay | IC50 = 0.01257 μM | SANGER | |||
| KARPAS-45 | Growth Inhibition Assay | IC50 = 0.0127 μM | SANGER | |||
| HOP-62 | Growth Inhibition Assay | IC50 = 0.01276 μM | SANGER | |||
| ES1 | Growth Inhibition Assay | IC50 = 0.01288 μM | SANGER | |||
| L-363 | Growth Inhibition Assay | IC50 = 0.01351 μM | SANGER | |||
| GI-1 | Growth Inhibition Assay | IC50 = 0.01373 μM | SANGER | |||
| CTV-1 | Growth Inhibition Assay | IC50 = 0.01478 μM | SANGER | |||
| SNU-C2B | Growth Inhibition Assay | IC50 = 0.01496 μM | SANGER | |||
| TE-5 | Growth Inhibition Assay | IC50 = 0.01496 μM | SANGER | |||
| K-562 | Growth Inhibition Assay | IC50 = 0.01516 μM | SANGER | |||
| SNB75 | Growth Inhibition Assay | IC50 = 0.0154 μM | SANGER | |||
| MOLT-13 | Growth Inhibition Assay | IC50 = 0.01637 μM | SANGER | |||
| LS-123 | Growth Inhibition Assay | IC50 = 0.01664 μM | SANGER | |||
| NCI-SNU-5 | Growth Inhibition Assay | IC50 = 0.01701 μM | SANGER | |||
| Daudi | Growth Inhibition Assay | IC50 = 0.01708 μM | SANGER | |||
| A253 | Growth Inhibition Assay | IC50 = 0.01738 μM | SANGER | |||
| TGBC1TKB | Growth Inhibition Assay | IC50 = 0.01752 μM | SANGER | |||
| SJSA-1 | Growth Inhibition Assay | IC50 = 0.01767 μM | SANGER | |||
| NCCIT | Growth Inhibition Assay | IC50 = 0.01769 μM | SANGER | |||
| NCI-H69 | Growth Inhibition Assay | IC50 = 0.01778 μM | SANGER | |||
| SH-4 | Growth Inhibition Assay | IC50 = 0.01895 μM | SANGER | |||
| HCC1187 | Growth Inhibition Assay | IC50 = 0.01924 μM | SANGER | |||
| HCC1599 | Growth Inhibition Assay | IC50 = 0.0202 μM | SANGER | |||
| ONS-76 | Growth Inhibition Assay | IC50 = 0.02036 μM | SANGER | |||
| KU812 | Growth Inhibition Assay | IC50 = 0.02039 μM | SANGER | |||
| ML-2 | Growth Inhibition Assay | IC50 = 0.02047 μM | SANGER | |||
| HCE-T | Growth Inhibition Assay | IC50 = 0.02092 μM | SANGER | |||
| NCI-H446 | Growth Inhibition Assay | IC50 = 0.02112 μM | SANGER | |||
| RPMI-6666 | Growth Inhibition Assay | IC50 = 0.02149 μM | SANGER | |||
| MOLT-16 | Growth Inhibition Assay | IC50 = 0.02153 μM | SANGER | |||
| JiyoyeP-2003 | Growth Inhibition Assay | IC50 = 0.02176 μM | SANGER | |||
| MHH-PREB-1 | Growth Inhibition Assay | IC50 = 0.02191 μM | SANGER | |||
| MC-CAR | Growth Inhibition Assay | IC50 = 0.02326 μM | SANGER | |||
| BC-3 | Growth Inhibition Assay | IC50 = 0.02344 μM | SANGER | |||
| KINGS-1 | Growth Inhibition Assay | IC50 = 0.02355 μM | SANGER | |||
| PF-382 | Growth Inhibition Assay | IC50 = 0.02378 μM | SANGER | |||
| J-RT3-T3-5 | Growth Inhibition Assay | IC50 = 0.02383 μM | SANGER | |||
| SF539 | Growth Inhibition Assay | IC50 = 0.02401 μM | SANGER | |||
| LB831-BLC | Growth Inhibition Assay | IC50 = 0.02485 μM | SANGER | |||
| DMS-114 | Growth Inhibition Assay | IC50 = 0.02502 μM | SANGER | |||
| LB1047-RCC | Growth Inhibition Assay | IC50 = 0.0251 μM | SANGER | |||
| BB65-RCC | Growth Inhibition Assay | IC50 = 0.02534 μM | SANGER | |||
| LB771-HNC | Growth Inhibition Assay | IC50 = 0.02534 μM | SANGER | |||
| BV-173 | Growth Inhibition Assay | IC50 = 0.02554 μM | SANGER | |||
| ARH-77 | Growth Inhibition Assay | IC50 = 0.02601 μM | SANGER | |||
| IST-MEL1 | Growth Inhibition Assay | IC50 = 0.02623 μM | SANGER | |||
| NB1 | Growth Inhibition Assay | IC50 = 0.02687 μM | SANGER | |||
| EoL-1-cell | Growth Inhibition Assay | IC50 = 0.02688 μM | SANGER | |||
| KY821 | Growth Inhibition Assay | IC50 = 0.02697 μM | SANGER | |||
| CMK | Growth Inhibition Assay | IC50 = 0.02734 μM | SANGER | |||
| NCI-H2126 | Growth Inhibition Assay | IC50 = 0.02768 μM | SANGER | |||
| NCI-H526 | Growth Inhibition Assay | IC50 = 0.02891 μM | SANGER | |||
| COLO-684 | Growth Inhibition Assay | IC50 = 0.02908 μM | SANGER | |||
| NCI-H747 | Growth Inhibition Assay | IC50 = 0.02933 μM | SANGER | |||
| JAR | Growth Inhibition Assay | IC50 = 0.02946 μM | SANGER | |||
| MEG-01 | Growth Inhibition Assay | IC50 = 0.02978 μM | SANGER | |||
| MONO-MAC-6 | Growth Inhibition Assay | IC50 = 0.03023 μM | SANGER | |||
| IST-SL1 | Growth Inhibition Assay | IC50 = 0.03042 μM | SANGER | |||
| CPC-N | Growth Inhibition Assay | IC50 = 0.03079 μM | SANGER | |||
| NCI-H1963 | Growth Inhibition Assay | IC50 = 0.03131 μM | SANGER | |||
| K052 | Growth Inhibition Assay | IC50 = 0.03247 μM | SANGER | |||
| KM-H2 | Growth Inhibition Assay | IC50 = 0.03307 μM | SANGER | |||
| TE-12 | Growth Inhibition Assay | IC50 = 0.03309 μM | SANGER | |||
| TK10 | Growth Inhibition Assay | IC50 = 0.03356 μM | SANGER | |||
| NMC-G1 | Growth Inhibition Assay | IC50 = 0.03452 μM | SANGER | |||
| no-11 | Growth Inhibition Assay | IC50 = 0.03478 μM | SANGER | |||
| NCI-H524 | Growth Inhibition Assay | IC50 = 0.03529 μM | SANGER | |||
| MHH-CALL-2 | Growth Inhibition Assay | IC50 = 0.03562 μM | SANGER | |||
| GB-1 | Growth Inhibition Assay | IC50 = 0.036 μM | SANGER | |||
| OPM-2 | Growth Inhibition Assay | IC50 = 0.03673 μM | SANGER | |||
| RH-1 | Growth Inhibition Assay | IC50 = 0.03819 μM | SANGER | |||
| NCI-H64 | Growth Inhibition Assay | IC50 = 0.03857 μM | SANGER | |||
| EVSA-T | Growth Inhibition Assay | IC50 = 0.03923 μM | SANGER | |||
| KARPAS-299 | Growth Inhibition Assay | IC50 = 0.0398 μM | SANGER | |||
| MZ7-mel | Growth Inhibition Assay | IC50 = 0.0404 μM | SANGER | |||
| LB373-MEL-D | Growth Inhibition Assay | IC50 = 0.04105 μM | SANGER | |||
| HEL | Growth Inhibition Assay | IC50 = 0.0414 μM | SANGER | |||
| SW872 | Growth Inhibition Assay | IC50 = 0.0421 μM | SANGER | |||
| DU-4475 | Growth Inhibition Assay | IC50 = 0.04244 μM | SANGER | |||
| IST-SL2 | Growth Inhibition Assay | IC50 = 0.04275 μM | SANGER | |||
| NCI-H82 | Growth Inhibition Assay | IC50 = 0.04307 μM | SANGER | |||
| LC4-1 | Growth Inhibition Assay | IC50 = 0.04351 μM | SANGER | |||
| HDLM-2 | Growth Inhibition Assay | IC50 = 0.04392 μM | SANGER | |||
| MMAC-SF | Growth Inhibition Assay | IC50 = 0.04534 μM | SANGER | |||
| L-540 | Growth Inhibition Assay | IC50 = 0.04639 μM | SANGER | |||
| MZ2-MEL | Growth Inhibition Assay | IC50 = 0.04742 μM | SANGER | |||
| LU-134-A | Growth Inhibition Assay | IC50 = 0.04773 μM | SANGER | |||
| UACC-257 | Growth Inhibition Assay | IC50 = 0.04849 μM | SANGER | |||
| NCI-H1581 | Growth Inhibition Assay | IC50 = 0.04953 μM | SANGER | |||
| NB17 | Growth Inhibition Assay | IC50 = 0.04979 μM | SANGER | |||
| SBC-1 | Growth Inhibition Assay | IC50 = 0.05042 μM | SANGER | |||
| TALL-1 | Growth Inhibition Assay | IC50 = 0.05045 μM | SANGER | |||
| NCI-H1304 | Growth Inhibition Assay | IC50 = 0.05208 μM | SANGER | |||
| NEC8 | Growth Inhibition Assay | IC50 = 0.05286 μM | SANGER | |||
| CAL-148 | Growth Inhibition Assay | IC50 = 0.05439 μM | SANGER | |||
| CGTH-W-1 | Growth Inhibition Assay | IC50 = 0.05449 μM | SANGER | |||
| NCI-H889 | Growth Inhibition Assay | IC50 = 0.05592 μM | SANGER | |||
| GR-ST | Growth Inhibition Assay | IC50 = 0.05621 μM | SANGER | |||
| KARPAS-422 | Growth Inhibition Assay | IC50 = 0.0565 μM | SANGER | |||
| RPMI-8866 | Growth Inhibition Assay | IC50 = 0.05712 μM | SANGER | |||
| SCLC-21H | Growth Inhibition Assay | IC50 = 0.05884 μM | SANGER | |||
| COR-L88 | Growth Inhibition Assay | IC50 = 0.05927 μM | SANGER | |||
| LU-139 | Growth Inhibition Assay | IC50 = 0.05986 μM | SANGER | |||
| SF126 | Growth Inhibition Assay | IC50 = 0.06133 μM | SANGER | |||
| NCI-H1882 | Growth Inhibition Assay | IC50 = 0.06424 μM | SANGER | |||
| EW-24 | Growth Inhibition Assay | IC50 = 0.06483 μM | SANGER | |||
| CP67-MEL | Growth Inhibition Assay | IC50 = 0.0681 μM | SANGER | |||
| DG-75 | Growth Inhibition Assay | IC50 = 0.06899 μM | SANGER | |||
| LOXIMVI | Growth Inhibition Assay | IC50 = 0.07028 μM | SANGER | |||
| HH | Growth Inhibition Assay | IC50 = 0.07157 μM | SANGER | |||
| K5 | Growth Inhibition Assay | IC50 = 0.07226 μM | SANGER | |||
| EC-GI-10 | Growth Inhibition Assay | IC50 = 0.07257 μM | SANGER | |||
| SK-N-DZ | Growth Inhibition Assay | IC50 = 0.07307 μM | SANGER | |||
| A3-KAW | Growth Inhibition Assay | IC50 = 0.07351 μM | SANGER | |||
| MLMA | Growth Inhibition Assay | IC50 = 0.07465 μM | SANGER | |||
| LB996-RCC | Growth Inhibition Assay | IC50 = 0.07707 μM | SANGER | |||
| OS-RC-2 | Growth Inhibition Assay | IC50 = 0.07748 μM | SANGER | |||
| CTB-1 | Growth Inhibition Assay | IC50 = 0.0781 μM | SANGER | |||
| IST-MES1 | Growth Inhibition Assay | IC50 = 0.07912 μM | SANGER | |||
| LS-1034 | Growth Inhibition Assay | IC50 = 0.08035 μM | SANGER | |||
| HT | Growth Inhibition Assay | IC50 = 0.08086 μM | SANGER | |||
| NCI-H2141 | Growth Inhibition Assay | IC50 = 0.081 μM | SANGER | |||
| LB2518-MEL | Growth Inhibition Assay | IC50 = 0.08141 μM | SANGER | |||
| GI-ME-N | Growth Inhibition Assay | IC50 = 0.08452 μM | SANGER | |||
| TGW | Growth Inhibition Assay | IC50 = 0.08607 μM | SANGER | |||
| SK-NEP-1 | Growth Inhibition Assay | IC50 = 0.08641 μM | SANGER | |||
| NOMO-1 | Growth Inhibition Assay | IC50 = 0.09275 μM | SANGER | |||
| ES6 | Growth Inhibition Assay | IC50 = 0.09589 μM | SANGER | |||
| NCI-H209 | Growth Inhibition Assay | IC50 = 0.09786 μM | SANGER | |||
| GAK | Growth Inhibition Assay | IC50 = 0.1016 μM | SANGER | |||
| BC-1 | Growth Inhibition Assay | IC50 = 0.10361 μM | SANGER | |||
| KLE | Growth Inhibition Assay | IC50 = 0.10443 μM | SANGER | |||
| EW-3 | Growth Inhibition Assay | IC50 = 0.1098 μM | SANGER | |||
| NKM-1 | Growth Inhibition Assay | IC50 = 0.111 μM | SANGER | |||
| D-336MG | Growth Inhibition Assay | IC50 = 0.11244 μM | SANGER | |||
| NB69 | Growth Inhibition Assay | IC50 = 0.11301 μM | SANGER | |||
| D-263MG | Growth Inhibition Assay | IC50 = 0.11712 μM | SANGER | |||
| KP-N-YS | Growth Inhibition Assay | IC50 = 0.12291 μM | SANGER | |||
| NCI-H1155 | Growth Inhibition Assay | IC50 = 0.12558 μM | SANGER | |||
| BOKU | Growth Inhibition Assay | IC50 = 0.12579 μM | SANGER | |||
| LAMA-84 | Growth Inhibition Assay | IC50 = 0.1299 μM | SANGER | |||
| Raji | Growth Inhibition Assay | IC50 = 0.13117 μM | SANGER | |||
| LU-65 | Growth Inhibition Assay | IC50 = 0.13307 μM | SANGER | |||
| NCI-H187 | Growth Inhibition Assay | IC50 = 0.13924 μM | SANGER | |||
| GCIY | Growth Inhibition Assay | IC50 = 0.14901 μM | SANGER | |||
| NCI-H2107 | Growth Inhibition Assay | IC50 = 0.1508 μM | SANGER | |||
| NCI-H1522 | Growth Inhibition Assay | IC50 = 0.15266 μM | SANGER | |||
| NB6 | Growth Inhibition Assay | IC50 = 0.15623 μM | SANGER | |||
| EM-2 | Growth Inhibition Assay | IC50 = 0.15706 μM | SANGER | |||
| HCC2218 | Growth Inhibition Assay | IC50 = 0.1598 μM | SANGER | |||
| NCI-H748 | Growth Inhibition Assay | IC50 = 0.16376 μM | SANGER | |||
| MS-1 | Growth Inhibition Assay | IC50 = 0.16537 μM | SANGER | |||
| NB5 | Growth Inhibition Assay | IC50 = 0.16597 μM | SANGER | |||
| OMC-1 | Growth Inhibition Assay | IC50 = 0.16688 μM | SANGER | |||
| NCI-H345 | Growth Inhibition Assay | IC50 = 0.16928 μM | SANGER | |||
| L-428 | Growth Inhibition Assay | IC50 = 0.16945 μM | SANGER | |||
| SCH | Growth Inhibition Assay | IC50 = 0.18685 μM | SANGER | |||
| NCI-H1417 | Growth Inhibition Assay | IC50 = 0.19227 μM | SANGER | |||
| COLO-320-HSR | Growth Inhibition Assay | IC50 = 0.19532 μM | SANGER | |||
| BT-474 | Growth Inhibition Assay | IC50 = 0.20892 μM | SANGER | |||
| GDM-1 | Growth Inhibition Assay | IC50 = 0.21971 μM | SANGER | |||
| NCI-H2196 | Growth Inhibition Assay | IC50 = 0.22235 μM | SANGER | |||
| KP-N-RT-BM-1 | Growth Inhibition Assay | IC50 = 0.22349 μM | SANGER | |||
| KNS-81-FD | Growth Inhibition Assay | IC50 = 0.22958 μM | SANGER | |||
| COLO-668 | Growth Inhibition Assay | IC50 = 0.23675 μM | SANGER | |||
| C2BBe1 | Growth Inhibition Assay | IC50 = 0.26747 μM | SANGER | |||
| Ramos-2G6-4C10 | Growth Inhibition Assay | IC50 = 0.26954 μM | SANGER | |||
| CAS-1 | Growth Inhibition Assay | IC50 = 0.27096 μM | SANGER | |||
| GOTO | Growth Inhibition Assay | IC50 = 0.27894 μM | SANGER | |||
| LP-1 | Growth Inhibition Assay | IC50 = 0.28057 μM | SANGER | |||
| NCI-SNU-1 | Growth Inhibition Assay | IC50 = 0.29422 μM | SANGER | |||
| EB-3 | Growth Inhibition Assay | IC50 = 0.29979 μM | SANGER | |||
| MHH-NB-11 | Growth Inhibition Assay | IC50 = 0.30402 μM | SANGER | |||
| SK-N-FI | Growth Inhibition Assay | IC50 = 0.31692 μM | SANGER | |||
| HCC2157 | Growth Inhibition Assay | IC50 = 0.33913 μM | SANGER | |||
| SIMA | Growth Inhibition Assay | IC50 = 0.34581 μM | SANGER | |||
| MDA-MB-134-VI | Growth Inhibition Assay | IC50 = 0.36928 μM | SANGER | |||
| NCI-H1694 | Growth Inhibition Assay | IC50 = 0.37 μM | SANGER | |||
| EHEB | Growth Inhibition Assay | IC50 = 0.39085 μM | SANGER | |||
| U-266 | Growth Inhibition Assay | IC50 = 0.39846 μM | SANGER | |||
| LC-1F | Growth Inhibition Assay | IC50 = 0.43765 μM | SANGER | |||
| SHP-77 | Growth Inhibition Assay | IC50 = 0.47855 μM | SANGER | |||
| LS-513 | Growth Inhibition Assay | IC50 = 0.49307 μM | SANGER | |||
| TE-441-T | Growth Inhibition Assay | IC50 = 0.52479 μM | SANGER | |||
| D-247MG | Growth Inhibition Assay | IC50 = 0.59924 μM | SANGER | |||
| SNU-C1 | Growth Inhibition Assay | IC50 = 0.61887 μM | SANGER | |||
| SU-DHL-1 | Growth Inhibition Assay | IC50 = 0.6289 μM | SANGER | |||
| DB | Growth Inhibition Assay | IC50 = 0.82872 μM | SANGER | |||
| CP66-MEL | Growth Inhibition Assay | IC50 = 0.95198 μM | SANGER | |||
| NCI-H1650 | Growth Inhibition Assay | IC50 = 1.04651 μM | SANGER | |||
| DMS-153 | Growth Inhibition Assay | IC50 = 1.10124 μM | SANGER | |||
| A498 | Growth Inhibition Assay | IC50 = 1.21534 μM | SANGER | |||
| U-698-M | Growth Inhibition Assay | IC50 = 1.22557 μM | SANGER | |||
| NCI-H1092 | Growth Inhibition Assay | IC50 = 1.30719 μM | SANGER | |||
| NCI-H23 | Growth Inhibition Assay | IC50 = 1.3319 μM | SANGER | |||
| JVM-2 | Growth Inhibition Assay | IC50 = 1.42177 μM | SANGER | |||
| MSTO-211H | Growth Inhibition Assay | IC50 = 1.43905 μM | SANGER | |||
| A704 | Growth Inhibition Assay | IC50 = 1.51191 μM | SANGER | |||
| ECC4 | Growth Inhibition Assay | IC50 = 1.54949 μM | SANGER | |||
| NCI-H226 | Growth Inhibition Assay | IC50 = 1.71489 μM | SANGER | |||
| CA46 | Growth Inhibition Assay | IC50 = 1.73216 μM | SANGER | |||
| NCI-H719 | Growth Inhibition Assay | IC50 = 1.73651 μM | SANGER | |||
| KMS-12-PE | Growth Inhibition Assay | IC50 = 1.90481 μM | SANGER | |||
| MPP-89 | Growth Inhibition Assay | IC50 = 1.94182 μM | SANGER | |||
| NCI-H2171 | Growth Inhibition Assay | IC50 = 2.20593 μM | SANGER | |||
| CHP-126 | Growth Inhibition Assay | IC50 = 2.24737 μM | SANGER | |||
| DMS-79 | Growth Inhibition Assay | IC50 = 2.27644 μM | SANGER | |||
| SCC-15 | Growth Inhibition Assay | IC50 = 2.30678 μM | SANGER | |||
| REH | Growth Inhibition Assay | IC50 = 2.31165 μM | SANGER | |||
| NCI-H2081 | Growth Inhibition Assay | IC50 = 2.32315 μM | SANGER | |||
| NCI-H720 | Growth Inhibition Assay | IC50 = 2.55972 μM | SANGER | |||
| KMOE-2 | Growth Inhibition Assay | IC50 = 2.75712 μM | SANGER | |||
| D-502MG | Growth Inhibition Assay | IC50 = 2.86805 μM | SANGER | |||
| MN-60 | Growth Inhibition Assay | IC50 = 2.95245 μM | SANGER | |||
| LU-165 | Growth Inhibition Assay | IC50 = 3.01956 μM | SANGER | |||
| DSH1 | Growth Inhibition Assay | IC50 = 3.23442 μM | SANGER | |||
| SK-MM-2 | Growth Inhibition Assay | IC50 = 3.54385 μM | SANGER | |||
| LAN-6 | Growth Inhibition Assay | IC50 = 3.54788 μM | SANGER | |||
| NCI-H1838 | Growth Inhibition Assay | IC50 = 4.18573 μM | SANGER | |||
| U-87-MG | Growth Inhibition Assay | IC50 = 4.18673 μM | SANGER | |||
| NB7 | Growth Inhibition Assay | IC50 = 4.40376 μM | SANGER | |||
| BB49-HNC | Growth Inhibition Assay | IC50 = 4.94617 μM | SANGER | |||
| NCI-H1395 | Growth Inhibition Assay | IC50 = 5.00345 μM | SANGER | |||
| RCC10RGB | Growth Inhibition Assay | IC50 = 5.06271 μM | SANGER | |||
| COLO-824 | Growth Inhibition Assay | IC50 = 5.08313 μM | SANGER | |||
| NCI-H322M | Growth Inhibition Assay | IC50 = 5.186 μM | SANGER | |||
| SW684 | Growth Inhibition Assay | IC50 = 5.23288 μM | SANGER | |||
| P30-OHK | Growth Inhibition Assay | IC50 = 5.35052 μM | SANGER | |||
| COLO-829 | Growth Inhibition Assay | IC50 = 5.49884 μM | SANGER | |||
| HAL-01 | Growth Inhibition Assay | IC50 = 5.73185 μM | SANGER | |||
| LNCaP-Clone-FGC | Growth Inhibition Assay | IC50 = 6.34489 μM | SANGER | |||
| SK-MEL-1 | Growth Inhibition Assay | IC50 = 6.70896 μM | SANGER | |||
| THP-1 | Growth Inhibition Assay | IC50 = 6.72583 μM | SANGER | |||
| EW-18 | Growth Inhibition Assay | IC50 = 7.03675 μM | SANGER | |||
| EKVX | Growth Inhibition Assay | IC50 = 7.16865 μM | SANGER | |||
| NB14 | Growth Inhibition Assay | IC50 = 7.8139 μM | SANGER | |||
| ES5 | Growth Inhibition Assay | IC50 = 7.86662 μM | SANGER | |||
| SK-MEL-2 | Growth Inhibition Assay | IC50 = 8.45976 μM | SANGER | |||
| COLO-800 | Growth Inhibition Assay | IC50 = 8.4787 μM | SANGER | |||
| EB2 | Growth Inhibition Assay | IC50 = 9.19835 μM | SANGER | |||
| ES3 | Growth Inhibition Assay | IC50 = 9.30665 μM | SANGER | |||
| SKM-1 | Growth Inhibition Assay | IC50 = 9.39459 μM | SANGER | |||
| MFM-223 | Growth Inhibition Assay | IC50 = 9.50127 μM | SANGER | |||
| LB2241-RCC | Growth Inhibition Assay | IC50 = 10.0386 μM | SANGER | |||
| EW-13 | Growth Inhibition Assay | IC50 = 10.3333 μM | SANGER | |||
| D-283MED | Growth Inhibition Assay | IC50 = 10.4959 μM | SANGER | |||
| EW-11 | Growth Inhibition Assay | IC50 = 11.6694 μM | SANGER | |||
| NCI-H128 | Growth Inhibition Assay | IC50 = 12.1334 μM | SANGER | |||
| ES7 | Growth Inhibition Assay | IC50 = 15.2494 μM | SANGER | |||
| AM-38 | Growth Inhibition Assay | IC50 = 15.4166 μM | SANGER | |||
| NCI-H716 | Growth Inhibition Assay | IC50 = 17.9299 μM | SANGER | |||
| NCI-H1770 | Growth Inhibition Assay | IC50 = 18.3851 μM | SANGER | |||
| JVM-3 | Growth Inhibition Assay | IC50 = 20.8985 μM | SANGER | |||
| CW-2 | Growth Inhibition Assay | IC50 = 21.1349 μM | SANGER | |||
| YT | Growth Inhibition Assay | IC50 = 21.4691 μM | SANGER | |||
| C8166 | Growth Inhibition Assay | IC50 = 22.2746 μM | SANGER | |||
| SUP-T1 | Growth Inhibition Assay | IC50 = 23.2512 μM | SANGER | |||
| KASUMI-1 | Growth Inhibition Assay | IC50 = 23.5119 μM | SANGER | |||
| IM-9 | Growth Inhibition Assay | IC50 = 23.6979 μM | SANGER | |||
| NH-12 | Growth Inhibition Assay | IC50 = 24.1654 μM | SANGER | |||
| WSU-NHL | Growth Inhibition Assay | IC50 = 25.7261 μM | SANGER | |||
| TUR | Growth Inhibition Assay | IC50 = 26.6533 μM | SANGER | |||
| RL | Growth Inhibition Assay | IC50 = 27.2242 μM | SANGER | |||
| EW-12 | Growth Inhibition Assay | IC50 = 28.0702 μM | SANGER | |||
| KG-1 | Growth Inhibition Assay | IC50 = 28.2865 μM | SANGER | |||
| P31-FUJ | Growth Inhibition Assay | IC50 = 29.0489 μM | SANGER | |||
| NB10 | Growth Inhibition Assay | IC50 = 31.509 μM | SANGER | |||
| COLO205 | Cytotoxicity assay | GI50 = 0.00176 μM | 7908950 | |||
| SF539 | Cytotoxicity assay | GI50 = 0.00366 μM | 7908950 | |||
| SNB75 | Cytotoxicity assay | GI50 = 0.00808 μM | 7908950 | |||
| DMS114 | Cytotoxicity assay | GI50 = 0.0123 μM | 7908950 | |||
| OVCAR-3 | Cytotoxicity assay | GI50 = 0.0197 μM | 7908950 | |||
| NCI-H460 | Cytotoxicity assay | GI50 = 0.0219 μM | 7908950 | |||
| HOP62 | Cytotoxicity assay | GI50 = 0.0671 μM | 7908950 | |||
| mammary carcinoma | Cytotoxicity assay | IC50 = 0.299 μM | 8182698 | |||
| NCI60 | Cytotoxicity assay | GI50 = 0.00065 μM | 9461653 | |||
| MCF-7 | Growth inhibition assay | GI50 = 0.0011 μM | 9873597 | |||
| murine leukemic P388 | Growth inhibition assay | GI50 = 0.016 μM | 9873597 | |||
| KB | Cytotoxicity assay | IC50 = 0.006 μM | 10978200 | |||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.002 μM | 11325226 | ||
| MCF-7 | Cytotoxicity assay | ED50 = 0.004 μM | 11334567 | |||
| uterine sarcoma (MES-SA) | Cytotoxicity assay | IC50 = 0.00004 μM | 11728191 | |||
| nonsmall cell lung carcinoma (NCI-H460) | Cytotoxicity assay | IC50 = 0.00014 μM | 11728191 | |||
| colon adenocarcinoma (HT-29) | Cytotoxicity assay | IC50 = 0.00016 μM | 11728191 | |||
| prostate carcinoma (DU-145) | Cytotoxicity assay | IC50 = 0.00489 μM | 11728191 | |||
| SW626 | Cytotoxicity assay | 72 h | IC50 = 0.00001 μM | 12088425 | ||
| Lu1 | Cytotoxicity assay | 72 h | IC50 = 0.01 μM | 12088425 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 12088425 | ||
| P388 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 12088425 | ||
| LNCAP | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 12088425 | ||
| KB | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 12088425 | ||
| Col2 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 12088425 | ||
| BC1 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 12088425 | ||
| SK-MEL-2 | Cytotoxicity assay | 72 h | IC50 = 0.07 μM | 12088425 | ||
| L2987 | Cytotoxicity assay | IC50 = 0.2 μM | 12443783 | |||
| colon adenocarcinoma RKO | Cytotoxicity assay | IC50 = 0.01 μM | 12852768 | |||
| NCI-H460 | Cytotoxicity assay | 48 h | IC50 = 0.0095 μM | 14695798 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.0112 μM | 14695798 | ||
| SF268 | Cytotoxicity assay | 48 h | IC50 = 0.0217 μM | 14695798 | ||
| MDA-MB-231 | Cytotoxicity assay | 48 h | IC50 = 0.0045 μM | 14987051 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.0049 μM | 14987051 | ||
| A2780 | Cytotoxicity assay | 48 h | IC50 = 0.025 μM | 14987051 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 0.077 μM | 14987051 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0014 μM | 14987056 | ||
| multidrug-resistant MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.354 μM | 14987056 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 0.016 μM | 15043402 | ||
| Hep3B | Cytotoxicity assay | 48 h | IC50 = 0.031 μM | 15043402 | ||
| NCI-H460 | Cytotoxicity assay | 48 h | IC50 = 0.0095 μM | 15043404 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.0112 μM | 15043404 | ||
| SF268 | Cytotoxicity assay | 48 h | IC50 = 0.0217 μM | 15043404 | ||
| KB | Cytotoxicity assay | ED50 = 0.0004 μM | 15043407 | |||
| Lu1 | Cytotoxicity assay | ED50 = 0.002 μM | 15043407 | |||
| LNCAP | Cytotoxicity assay | ED50 = 0.005 μM | 15043407 | |||
| RPE1 | Cytotoxicity assay | ED50 = 0.023 μM | 15043407 | |||
| Col2 | Cytotoxicity assay | ED50 = 0.046 μM | 15043407 | |||
| T47D | Apoptosis assay | 24 h | EC50 = 0.03 μM | 15566300 | ||
| DLD1 | Apoptosis assay | 24 h | EC50 = 0.075 μM | 15566300 | ||
| H1299 | Apoptosis assay | 24 h | EC50 = 0.163 μM | 15566300 | ||
| VA13 | Cytotoxicity assay | 48 h | IC50 = 0.005 μM | 15730243 | ||
| WI 38 | Cytotoxicity assay | 48 h | IC50 = 0.04 μM | 15730243 | ||
| Hep G2 | Cytotoxicity assay | 48 h | IC50 = 8.1 μM | 15730243 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 1.25 μM | 15787460 | ||
| SKOV3 | Cytotoxicity assay | 48 h | IC50 = 1.35 μM | 15787460 | ||
| KB | Cytotoxicity assay | 3 days | IC50 = 0.001 μM | 16038545 | ||
| 1A9 | Cytotoxicity assay | 3 days | IC50 = 0.002 μM | 16038545 | ||
| HCT8 | Cytotoxicity assay | 3 days | IC50 = 0.013 μM | 16038545 | ||
| A431 | Cell cycle arrest assay | EC50 = 0.009 μM | 16377187 | |||
| VA13 | Growth inhibition assay | 48 h | IC50 = 0.0043 μM | 16499322 | ||
| WI38 | Growth inhibition assay | 48 h | IC50 = 0.034 μM | 16499322 | ||
| HepG2 | Growth inhibition assay | 48 h | IC50 = 6.9 μM | 16499322 | ||
| Aro | Cytotoxicity assay | IC50 = 0.0002 μM | 16539377 | |||
| PT45 | Cytotoxicity assay | IC50 = 0.005 μM | 16539377 | |||
| A549 | Cytotoxicity assay | IC50 = 0.006 μM | 16539377 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.007 μM | 16539377 | |||
| HeLa | Cytotoxicity assay | IC50 = 0.008 μM | 16539377 | |||
| Ovcar3 | Cytotoxicity assay | IC50 = 0.01 μM | 16539377 | |||
| HT29 | Cytotoxicity assay | IC50 = 0.05 μM | 16539377 | |||
| H295R | Cytotoxicity assay | IC50 = 0.08 μM | 16539377 | |||
| BNL | Cytotoxicity assay | IC50 = 0.2 μM | 16539377 | |||
| 4T1 | Cytotoxicity assay | IC50 = 0.2 μM | 16539377 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.3 μM | 16539377 | |||
| U937 GTB | Cytotoxicity assay | 72 h | IC50 = 0.0059 μM | 16562840 | ||
| RPMI 8226/s | Cytotoxicity assay | 72 h | IC50 = 0.007 μM | 16562840 | ||
| CEM/s | Cytotoxicity assay | 72 h | IC50 = 0.007 μM | 16562840 | ||
| VA13 | Cytotoxicity assay | IC50 = 0.0059 μM | 16724842 | |||
| WI38 | Cytotoxicity assay | IC50 = 0.0468 μM | 16724842 | |||
| HepG2 | Cytotoxicity assay | IC50 = 9.49 μM | 16724842 | |||
| HT29 | Cytotoxicity assay | EC50 = 0.006 μM | 16870428 | |||
| K562 | Cytotoxicity assay | EC50 = 0.014 μM | 16870428 | |||
| MCF7 | Cytotoxicity assay | EC50 = 0.036 μM | 16870428 | |||
| VA-13 | Cytotoxicity assay | IC50 = 0.005 μM | 16933868 | |||
| WI38 | Cytotoxicity assay | IC50 = 0.04 μM | 16933868 | |||
| VA13 | Cytotoxicity assay | IC50 = 0.005 μM | 17067155 | |||
| WI38 | Cytotoxicity assay | IC50 = 0.04 μM | 17067155 | |||
| Hep G2 | Cytotoxicity assay | IC50 = 8.1 μM | 17067155 | |||
| TW01 | Cytotoxicity assay | IC50 = 0.0003 μM | 17113288 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.0005 μM | 17113288 | |||
| MKN45 | Cytotoxicity assay | IC50 = 0.0005 μM | 17113288 | |||
| MES-SA | Cytotoxicity assay | IC50 = 0.0005 μM | 17113288 | |||
| HCT116 | Cytotoxicity assay | IC50 = 0.0006 μM | 17113288 | |||
| RPTEC | Cytotoxicity assay | IC50 = 0.0009 μM | 17113288 | |||
| Hep3B | Cytotoxicity assay | IC50 = 0.0054 μM | 17113288 | |||
| NCI-H226 | Cytotoxicity assay | IC50 = 0.0068 μM | 17113288 | |||
| A498 | Cytotoxicity assay | IC50 = 0.061 μM | 17113288 | |||
| MDA435/LCC6 | Antiproliferative activity assay | IC50 = 0.0029 μM | 17154505 | |||
| multidrug resistant MDA435/LCC6 | Antiproliferative activity assay | IC50 = 0.0048 μM | 17154505 | |||
| P388 | Antiproliferative activity assay | IC50 = 0.022 μM | 17154505 | |||
| adriamycin resistant P388 | Antiproliferative activity assay | IC50 = 0.03 μM | 17154505 | |||
| LT12 | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 17181164 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 17181164 | ||
| NCI-H460 | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 17181164 | ||
| SF268 | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 17181164 | ||
| RKO | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 17181164 | ||
| KB/HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 17181164 | ||
| P388 | Antiproliferative activity assay | 48 h | IC50 = 0.04 μM | 17181164 | ||
| L1210 | Antiproliferative activity assay | 48 h | IC50 = 0.06 μM | 17181164 | ||
| LT12 MDR | Antiproliferative activity assay | 48 h | IC50 = 0.4 μM | 17181164 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.001 μM | 17206139 | |||
| A2780-1A9 | Cytotoxicity assay | IC50 = 0.0011 μM | 17206139 | |||
| A549 | Cytotoxicity assay | IC50 = 0.0036 μM | 17206139 | |||
| 1A9PTX22 | Cytotoxicity assay | IC50 = 0.019 μM | 17206139 | |||
| 1A9PTX10 | Cytotoxicity assay | IC50 = 0.03 μM | 17206139 | |||
| A2780AD | Cytotoxicity assay | IC50 = 0.9 μM | 17206139 | |||
| KB | Antiproliferative activity assay | IC50 = 0.00245 μM | 17228873 | |||
| COLO205 | Cytotoxicity assay | IC50 = 0.0033 μM | 17228873 | |||
| KB8.5 | Antiproliferative activity assay | IC50 = 0.026 μM | 17228873 | |||
| KBV1 | Antiproliferative activity assay | IC50 = 2.013 μM | 17228873 | |||
| A2780 | Cytotoxicity assay | IC50 = 0.0007 μM | 17239597 | |||
| 2780AD | Cytotoxicity assay | IC50 = 0.535 μM | 17239597 | |||
| 1A9 | Cytotoxicity assay | ED50 = 0.001 μM | 17350834 | |||
| MCF7 | Cytotoxicity assay | ED50 = 0.0011 μM | 17350834 | |||
| DU145 | Cytotoxicity assay | ED50 = 0.0013 μM | 17350834 | |||
| KB | Cytotoxicity assay | ED50 = 0.0018 μM | 17350834 | |||
| A549 | Cytotoxicity assay | ED50 = 0.0023 μM | 17350834 | |||
| LNCAP | Cytotoxicity assay | ED50 = 0.0026 μM | 17350834 | |||
| PC3 | Cytotoxicity assay | ED50 = 0.0555 μM | 17350834 | |||
| KBVIN | Cytotoxicity assay | ED50 = 0.311 μM | 17350834 | |||
| A2780 | Cytotoxicity assay | IC50 = 0.0016 μM | 17395465 | |||
| A2780/AD | Cytotoxicity assay | IC50 = 0.92 μM | 17395465 | |||
| KB | Antiproliferative activity assay | IC50 = 0.00245 μM | 17416524 | |||
| COLO205 | Cytotoxicity assay | IC50 = 0.0033 μM | 17416524 | |||
| KB8.5 | Antiproliferative activity assay | IC50 = 0.026 μM | 17416524 | |||
| KBV1 | Antiproliferative activity assay | IC50 = 2.013 μM | 17416524 | |||
| neural precursor | Antiproliferative activity assay | EC50 = 0.01 μM | 17417631 | |||
| OVCAR-3 | Cytotoxicity assay | IC50 = 0.0002 μM | 17419065 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 0.0045 μM | 17419065 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.0049 μM | 17419065 | |||
| NCI-H1299 | Cytotoxicity assay | 96 h | IC50 = 0.015 μM | 17419065 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.025 μM | 17419065 | |||
| PC3 | Cytotoxicity assay | IC50 = 0.077 μM | 17419065 | |||
| LoVo | Cytotoxicity assay | IC50 = 0.09 μM | 17419065 | |||
| L2987 | Cytotoxicity assay | IC50 = 0.2 μM | 17419065 | |||
| cells | Cytotoxicity assay | IC50 = 0.0059 μM | 17442577 | |||
| cells | Cytotoxicity assay | IC50 = 0.01 μM | 17485207 | |||
| A2780 | Growth inhibition assay | IC50 = 0.0028 μM | 17490878 | |||
| VA13 | Growth inhibition assay | IC50 = 0.005 μM | 17490878 | |||
| WI38 | Growth inhibition assay | IC50 = 0.04 μM | 17490878 | |||
| 2780AD | Growth inhibition assay | IC50 = 0.183 μM | 17490878 | |||
| HepG2 | Growth inhibition assay | IC50 = 8.1 μM | 17490878 | |||
| HT29 | Growth inhibition assay | 48 h | GI50 = 0.015 μM | 17498960 | ||
| M21 | Growth inhibition assay | 48 h | GI50 = 0.037 μM | 17498960 | ||
| MCF7 | Growth inhibition assay | 48 h | GI50 = 0.054 μM | 17498960 | ||
| 1A9 | Growth inhibition assay | 72 h | GI50 = 0.00071 μM | 17542572 | ||
| 1A9/Ptx22 | Growth inhibition assay | 72 h | GI50 = 0.051 μM | 17542572 | ||
| 1A9/Ptx10 | Growth inhibition assay | 72 h | GI50 = 0.064 μM | 17542572 | ||
| cells expressing MRP1 | Growth inhibition assay | IC50 = 0.0025 μM | 17567121 | |||
| cells expressing Pgp/MRP1 | Growth inhibition assay | IC50 = 2.7 μM | 17567121 | |||
| VA13 | Growth inhibition assay | IC50 = 5 μM | 17595134 | |||
| MCF7 | Function assay | IC50 = 0.0018 μM | 17601739 | |||
| adriamycin-resistant MCF7 | Function assay | IC50 = 8.2 μM | 17601739 | |||
| RPMI8226 | Cytotoxicity assay | GI50 = 0.002 μM | 17696332 | |||
| HT29 | Cytotoxicity assay | GI50 = 0.002 μM | 17696332 | |||
| COLO205 | Cytotoxicity assay | GI50 = 0.003 μM | 17696332 | |||
| HCC2998 | Cytotoxicity assay | GI50 = 0.003 μM | 17696332 | |||
| HS578T | Cytotoxicity assay | GI50 = 0.003 μM | 17696332 | |||
| PC3 | Cytotoxicity assay | GI50 = 0.004 μM | 17696332 | |||
| SNB75 | Cytotoxicity assay | GI50 = 0.004 μM | 17696332 | |||
| A549 | Cytotoxicity assay | GI50 = 0.004 μM | 17696332 | |||
| KM12 | Cytotoxicity assay | GI50 = 0.004 μM | 17696332 | |||
| DU145 | Cytotoxicity assay | GI50 = 0.005 μM | 17696332 | |||
| SK-OV3 | Cytotoxicity assay | GI50 = 0.008 μM | 17696332 | |||
| NCI-H322M | Cytotoxicity assay | GI50 = 0.013 μM | 17696332 | |||
| UACC257 | Cytotoxicity assay | GI50 = 0.04 μM | 17696332 | |||
| HCT15 | Cytotoxicity assay | GI50 = 0.158 μM | 17696332 | |||
| ACHN | Cytotoxicity assay | GI50 = 0.398 μM | 17696332 | |||
| HeLa | Cytotoxicity assay | IC50 = 0.0056 μM | 17764148 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.0124 μM | 17764148 | |||
| A549 | Cytotoxicity assay | IC50 = 0.0126 μM | 17764148 | |||
| HGC27 | Cytotoxicity assay | IC50 = 0.7778 μM | 17764148 | |||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.93 μM | 17896816 | ||
| P388 | Cytotoxicity assay | 72 h | IC50 = 0.93 μM | 17896816 | ||
| BEL-7402 | Cytotoxicity assay | 24 h | IC50 = 0.93 μM | 17896816 | ||
| A459 | Cytotoxicity assay | 24 h | IC50 = 0.93 μM | 17896816 | ||
| HeLa | Cytotoxicity assay | IC50 = 0.02 μM | 17911017 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.82 μM | 17911017 | |||
| BGC823 | Cytotoxicity assay | IC50 = 1.15 μM | 17911017 | |||
| Aro | Cytotoxicity assay | 72 h | IC50 = 0.0002 μM | 17915851 | ||
| PT45 | Cytotoxicity assay | 72 h | IC50 = 0.005 μM | 17915851 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 17915851 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.007 μM | 17915851 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.008 μM | 17915851 | ||
| Ovcar3 | Cytotoxicity assay | 72 h | IC50 = 0.01 μM | 17915851 | ||
| HT29 | Cytotoxicity assay | 72 h | IC50 = 0.05 μM | 17915851 | ||
| A549T12 | Cytotoxicity assay | 72 h | IC50 = 0.06 μM | 17915851 | ||
| H295R | Cytotoxicity assay | 72 h | IC50 = 0.08 μM | 17915851 | ||
| A549T24 | Cytotoxicity assay | 72 h | IC50 = 0.102 μM | 17915851 | ||
| OE33 | Cytotoxicity assay | 72 h | IC50 = 0.2 μM | 17915851 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.3 μM | 17915851 | ||
| OE19 | Cytotoxicity assay | 72 h | IC50 = 0.4 μM | 17915851 | ||
| L12 | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 17973361 | ||
| NCI-H460 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 17973361 | ||
| SKOV3 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 17973361 | ||
| SF268 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 17973361 | ||
| RKO | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 17973361 | ||
| KB/HeLa | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 17973361 | ||
| P388 | Antiproliferative activity assay | 48 h | IC50 = 0.04 μM | 17973361 | ||
| cells assessed as accumulation at G2/M phase after 24 hrs by flow cytometric analysis | Cell cycle arrest assay | EC50 = 0.049 μM | 17973361 | |||
| L1210 | Antiproliferative activity assay | 48 h | IC50 = 0.06 μM | 17973361 | ||
| cells after 48 hrs by XTT assay | Antiproliferative activity assay | IC50 = 0.4 μM | 17973361 | |||
| A2780 | Cytotoxicity assay | IC50 = 0.0063 μM | 18001087 | |||
| BGC823 | Cytotoxicity assay | IC50 = 0.007 μM | 18001087 | |||
| A549 | Cytotoxicity assay | IC50 = 0.019 μM | 18001087 | |||
| HCT8 | Cytotoxicity assay | IC50 = 0.037 μM | 18001087 | |||
| Bel7402 | Cytotoxicity assay | IC50 = 0.1 μM | 18001087 | |||
| cells by alamar blue assay | Function assay | IC50 = 0.04 μM | 18070965 | |||
| PANC1 | Cytotoxicity assay | 72 h | IC50 = 0.007 μM | 18081257 | ||
| DLD1 | Cytotoxicity assay | 72 h | IC50 = 0.011 μM | 18081257 | ||
| AsPC1 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 18081257 | ||
| NCI/ADR | Cytotoxicity assay | 72 h | IC50 = 1 μM | 18081257 | ||
| SK-BR3 | Antiproliferative activity assay | 96 h | GI50 = 6.1 μM | 18164205 | ||
| A2780 | Antiproliferative activity assay | 96 h | IC50 = 0.0234 μM | 18177014 | ||
| SNU398 | Apoptosis assay | 24 h | EC50 = 0.011 μM | 18197614 | ||
| HCT116 | Apoptosis assay | 24 h | EC50 = 0.024 μM | 18197614 | ||
| T47D | Apoptosis assay | 24 h | EC50 = 0.036 μM | 18197614 | ||
| SJSA1 | Cytotoxicity assay | 6 h | IC50 = 0.0032 μM | 18243696 | ||
| P388 | Cytotoxicity assay | 72 h | IC50 = 0.93 μM | 18281952 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.93 μM | 18281952 | ||
| Bel7402 | Cytotoxicity assay | 24 h | IC50 = 0.93 μM | 18281952 | ||
| A549 | Cytotoxicity assay | 24 h | IC50 = 0.93 μM | 18281952 | ||
| KB | Cytotoxicity assay | 48 h | IC50 = 0.0042 μM | 18295490 | ||
| KBV20C | Cytotoxicity assay | 48 h | IC50 = 1.44 μM | 18295490 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 0.005 μM | 18308566 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.005 μM | 18308566 | ||
| MDA435 | Cytotoxicity assay | 72 h | IC50 = 0.005 μM | 18308566 | ||
| MESSA | Cytotoxicity assay | 72 h | IC50 = 0.005 μM | 18308566 | ||
| P388 | Cytotoxicity assay | 72 h | IC50 = 0.01 μM | 18308566 | ||
| HL60/TX1000 | Cytotoxicity assay | 72 h | IC50 = 5 μM | 18308566 | ||
| MESSA/DX5 | Cytotoxicity assay | 72 h | IC50 = 5 μM | 18308566 | ||
| K562 | Growth inhibition assay | 72 h | IC50 = 0.0006 μM | 18313307 | ||
| KB3-1 | Growth inhibition assay | 72 h | IC50 = 0.002 μM | 18313307 | ||
| HepG2 | Growth inhibition assay | 72 h | IC50 = 0.007 μM | 18313307 | ||
| KB V1 | Growth inhibition assay | 72 h | IC50 = 8 μM | 18313307 | ||
| A549 | Cytotoxicity assay | 3 days | IC50 = 0.007 μM | 18419154 | ||
| MCF7 | Cytotoxicity assay | 3 days | IC50 = 0.0117 μM | 18419154 | ||
| HepG2 | Cytotoxicity assay | 3 days | IC50 = 0.0468 μM | 18419154 | ||
| MDA-MB-231 | Cytotoxicity assay | 3 days | IC50 = 0.0703 μM | 18419154 | ||
| Hep3B | Cytotoxicity assay | 3 days | IC50 = 0.13 μM | 18419154 | ||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.001274 μM | 18450456 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.0013 μM | 18450456 | ||
| MX1 | Cytotoxicity assay | 72 h | IC50 = 0.035 μM | 18450456 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0015 μM | 18461997 | ||
| HT29 | Antiproliferative activity assay | 48 h | IC50 = 0.0019 μM | 18461997 | ||
| U2OS | Antiproliferative activity assay | 48 h | IC50 = 0.024 μM | 18461997 | ||
| A2780 | Cytotoxicity assay | 72 h | IC50 = 0.00138 μM | 18465846 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0017 μM | 18465846 | ||
| LCC6 | Cytotoxicity assay | 72 h | IC50 = 0.0031 μM | 18465846 | ||
| 1A9PTX22 | Cytotoxicity assay | 72 h | IC50 = 0.1607 μM | 18465846 | ||
| NCI/ADR | Cytotoxicity assay | 72 h | IC50 = 0.3 μM | 18465846 | ||
| 1A9PTX10 | Cytotoxicity assay | 72 h | IC50 = 0.53295 μM | 18465846 | ||
| HT29 | Antiproliferative activity assay | GI50 = 0.015 μM | 18502639 | |||
| M21 | Antiproliferative activity assay | GI50 = 0.037 μM | 18502639 | |||
| MCF7 | Antiproliferative activity assay | GI50 = 0.054 μM | 18502639 | |||
| HepG2 | Growth inhibition assay | 72 h | IC50 = 0.0059 μM | 18512984 | ||
| HepG2/Dox | Growth inhibition assay | 72 h | IC50 = 1.4 μM | 18512984 | ||
| HT29 | Growth inhibition assay | 48 h | GI50 = 0.015 μM | 18579387 | ||
| M21 | Growth inhibition assay | 48 h | GI50 = 0.037 μM | 18579387 | ||
| MCF7 | Growth inhibition assay | 48 h | GI50 = 0.054 μM | 18579387 | ||
| KB403 | Cytotoxicity assay | 24 h | IC50 = 0.001 μM | 18586491 | ||
| WRL68 | Cytotoxicity assay | 24 h | IC50 = 0.004 μM | 18586491 | ||
| MCF7 | Cytotoxicity assay | 24 h | IC50 = 0.006 μM | 18586491 | ||
| CaCO2 | Cytotoxicity assay | 24 h | IC50 = 0.008 μM | 18586491 | ||
| HEPG2 | Cytotoxicity assay | 24 h | IC50 = 0.009 μM | 18586491 | ||
| HCT116 | Cytotoxicity assay | IC50 = 0.0136 μM | 18606540 | |||
| SF268 | Cytotoxicity assay | IC50 = 0.0153 μM | 18606540 | |||
| A549 | Cytotoxicity assay | IC50 = 0.0231 μM | 18606540 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 0.0405 μM | 18606540 | |||
| SF295 | Cytotoxicity assay | IC50 = 0.29 μM | 18606540 | |||
| MDA-MB-435 | Antiproliferative activity assay | 72 h | GI50 = 0.004 μM | 18610995 | ||
| HT29 | Antiproliferative activity assay | 48 h | GI50 = 0.015 μM | 18617414 | ||
| M21 | Antiproliferative activity assay | 48 h | GI50 = 0.037 μM | 18617414 | ||
| MCF7 | Antiproliferative activity assay | 48 h | GI50 = 0.054 μM | 18617414 | ||
| SKOV3 | Cytotoxicity assay | IC50 = 2.43 μM | 18701281 | |||
| KB | Cytotoxicity assay | IC50 = 2.54 μM | 18701281 | |||
| Eca109 | Cytotoxicity assay | IC50 = 2.73 μM | 18701281 | |||
| PC3 | Cytotoxicity assay | IC50 = 2.85 μM | 18701281 | |||
| SMMC7721 | Cytotoxicity assay | IC50 = 2.86 μM | 18701281 | |||
| MCF7 | Cytotoxicity assay | IC50 = 2.98 μM | 18701281 | |||
| HeLa | Cytotoxicity assay | IC50 = 3.11 μM | 18701281 | |||
| HCT8 | Cytotoxicity assay | IC50 = 3.29 μM | 18701281 | |||
| K562 | Cytotoxicity assay | IC50 = 3.65 μM | 18701281 | |||
| HepG2 | Antiproliferative activity assay | 48 h | IC50 = 0.62 μM | 18701301 | ||
| PC3 | Antiproliferative activity assay | 48 h | IC50 = 2.73 μM | 18701301 | ||
| HCT116 | Antiproliferative activity assay | 48 h | IC50 = 6.18 μM | 18701301 | ||
| A549 | Cytotoxicity assay | IC50 = 0.002 μM | 18715782 | |||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.0011 μM | 18752869 | ||
| SKOV3 | Anticancer assay | 72 h | IC50 = 0.00134 μM | 18762358 | ||
| MCF7 | Cytotoxicity assay | ED50 = 0.0032 μM | 18926701 | |||
| NCI/ADR-RES | Cytotoxicity assay | ED50 = 1.5 μM | 18926701 | |||
| PANC1 | Cytotoxicity assay | 72 h | IC50 = 0.0099 μM | 18951787 | ||
| DLD1 | Cytotoxicity assay | 72 h | IC50 = 0.022 μM | 18951787 | ||
| AsPC1 | Cytotoxicity assay | 72 h | IC50 = 0.089 μM | 18951787 | ||
| NCI/ADR-RES | Cytotoxicity assay | 72 h | IC50 = 1.3 μM | 18951787 | ||
| MCF7 | Cytotoxicity assay | ED50 = 0.0021 μM | 18977659 | |||
| NCI/ADR-RES | Cytotoxicity assay | ED50 = 2 μM | 18977659 | |||
| A431 | Cytotoxicity assay | 72 h | IC50 = 0.0251 μM | 18990574 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.039 μM | 18990574 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0471 μM | 18990574 | ||
| SKOV3 | Cytotoxicity assay | 72 h | IC50 = 0.0658 μM | 18990574 | ||
| PANC1 | Growth inhibition assay | 72 h | IC50 = 0.0099 μM | 19022679 | ||
| DLD1 | Growth inhibition assay | 72 h | IC50 = 0.022 μM | 19022679 | ||
| AsPC1 | Growth inhibition assay | 72 h | IC50 = 0.089 μM | 19022679 | ||
| NCI/ADR | Growth inhibition assay | 72 h | IC50 = 1.3 μM | 19022679 | ||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.0234 μM | 19028102 | ||
| KB | Antiproliferative activity assay | 3 days | IC50 = 0.0025 μM | 19041247 | ||
| COLO205 | Antiproliferative activity assay | 24 h | IC50 = 0.0033 μM | 19041247 | ||
| KB 8.5 | Antiproliferative activity assay | 3 days | IC50 = 0.026 μM | 19041247 | ||
| KBV1 | Antiproliferative activity assay | 3 days | IC50 = 2.013 μM | 19041247 | ||
| KB | Growth inhibition assay | 72 h | IC50 = 0.0033 μM | 19053773 | ||
| KB-7D | Growth inhibition assay | 72 h | IC50 = 0.0079 μM | 19053773 | ||
| Pgp170 overexpressing multidrug resistant-KB-TAX50 | Growth inhibition assay | 72 h | IC50 = 0.273 μM | 19053773 | ||
| NPC-TW01 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 19053781 | ||
| MES-SA | Cytotoxicity assay | 72 h | IC50 = 0.008 μM | 19053781 | ||
| NCI-H838 | Cytotoxicity assay | 72 h | IC50 = 0.026 μM | 19053781 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.061 μM | 19053781 | ||
| cells after 72 hrs by MTT assay | Cytotoxicity assay | IC50 = 5.14 μM | 19053781 | |||
| Hep3B | Cytotoxicity assay | 72 h | IC50 = 7.26 μM | 19053781 | ||
| A498 | Cytotoxicity assay | 72 h | IC50 = 8.81 μM | 19053781 | ||
| NB4 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 19072209 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 19072209 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 19072209 | ||
| SH-SY5Y | Cytotoxicity assay | 48 h | IC50 = 0.2 μM | 19072209 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 0.2 μM | 19072209 | ||
| DLD1 | Cytotoxicity assay | 72 h | GI50 = 0.01 μM | 19081249 | ||
| B16 | Cytotoxicity assay | 72 h | GI50 = 0.01 μM | 19081249 | ||
| A172 | Cytotoxicity assay | 72 h | GI50 = 0.01 μM | 19081249 | ||
| HeLa | Cytotoxicity assay | 72 h | GI50 = 0.02 μM | 19081249 | ||
| U87 | Cytotoxicity assay | 72 h | GI50 = 0.02 μM | 19081249 | ||
| SiHa | Cytotoxicity assay | 72 h | GI50 = 0.03 μM | 19081249 | ||
| HeLa | Antiproliferative activity assay | 96 h | IC50 = 0.001 μM | 19091579 | ||
| SKOV3 | Antiproliferative activity assay | 96 h | IC50 = 0.016 μM | 19091579 | ||
| BGC823 | Antiproliferative activity assay | 96 h | IC50 = 0.0189 μM | 19091579 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.0011 μM | 19124250 | ||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.0031 μM | 19124250 | ||
| MX1 | Cytotoxicity assay | 72 h | IC50 = 0.046 μM | 19124250 | ||
| HCT116 | Cytotoxicity assay | 4 days | IC50 = 0.0011 μM | 19128156 | ||
| HT-29 | Cytotoxicity assay | 4 days | IC50 = 0.0036 μM | 19128156 | ||
| A2780 | Cytotoxicity assay | 48 h | IC50 = 0.0013 μM | 19128972 | ||
| KB | Growth inhibition assay | ED50 = 0.023 μM | 19161316 | |||
| HepG2 | Cytotoxicity assay | GI50 = 0.001 μM | 19195901 | |||
| WI38 | Cytotoxicity assay | GI50 = 0.0137 μM | 19195901 | |||
| RKO | Antiproliferative activity assay | IC50 = 0.02 μM | 19220018 | |||
| KB/HeLa | Antiproliferative activity assay | IC50 = 0.03 μM | 19220018 | |||
| SKOV3 | Antiproliferative activity assay | IC50 = 0.05 μM | 19220018 | |||
| SF268 | Antiproliferative activity assay | IC50 = 0.05 μM | 19220018 | |||
| P388 | Antiproliferative activity assay | 48 h | IC50 = 0.05 μM | 19220018 | ||
| cells ectopic expression of human | Antiproliferative activity assay | 48 h | IC50 = 0.05 μM | 19220018 | ||
| L1210 | Antiproliferative activity assay | 48 h | IC50 = 0.06 μM | 19220018 | ||
| NCI-H460 | Antiproliferative activity assay | IC50 = 0.07 μM | 19220018 | |||
| Antiproliferative activity assay | 48 h | IC50 = 0.3 μM | 19220018 | |||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0012 μM | 19239240 | ||
| A2780 | Cytotoxicity assay | 72 h | IC50 = 0.00138 μM | 19239240 | ||
| wild type A2780 | Cytotoxicity assay | 72 h | IC50 = 0.0017 μM | 19239240 | ||
| cisplatin-resistant A2780 | Cytotoxicity assay | 72 h | IC50 = 0.0022 μM | 19239240 | ||
| LCC-6 | Cytotoxicity assay | 72 h | IC50 = 0.00245 μM | 19239240 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.0036 μM | 19239240 | ||
| H460 | Cytotoxicity assay | 72 h | IC50 = 0.0049 μM | 19239240 | ||
| topotecan-resistant A2780 | Cytotoxicity assay | 72 h | IC50 = 0.0072 μM | 19239240 | ||
| PANC1 | Cytotoxicity assay | 72 h | IC50 = 0.0257 μM | 19239240 | ||
| 1A9PTX22 | Cytotoxicity assay | 72 h | IC50 = 0.1607 μM | 19239240 | ||
| NCI/ADR | Cytotoxicity assay | 72 h | IC50 = 0.3 μM | 19239240 | ||
| A2780 | Function assay | IC50 = 0.386 μM | 19239240 | |||
| 1A9PTX10 | Cytotoxicity assay | 72 h | IC50 = 0.53295 μM | 19239240 | ||
| A2780/ADR | Cytotoxicity assay | 72 h | IC50 = 1.239 μM | 19239240 | ||
| A549 | Cytotoxicity assay | 24 h | IC50 = 0.0052 μM | 19245261 | ||
| PC3M | Cytotoxicity assay | 24 h | IC50 = 0.027 μM | 19245261 | ||
| HCT8 | Cytotoxicity assay | 24 h | IC50 = 0.037 μM | 19245261 | ||
| Bel7402 | Cytotoxicity assay | 24 h | IC50 = 0.095 μM | 19245261 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.014 μM | 19282186 | |||
| SNU398 | Apoptosis assay | 48 h | GI50 = 0.01 μM | 19282188 | ||
| HCT116 | Apoptosis assay | 48 h | EC50 = 0.023 μM | 19282188 | ||
| T47D | Apoptosis assay | 48 h | EC50 = 0.035 μM | 19282188 | ||
| PC3 | Cytotoxicity assay | 4 days | IC50 = 0.0014 μM | 19359169 | ||
| A2780 | Cytotoxicity assay | 4 days | IC50 = 0.0149 μM | 19359169 | ||
| K562 | Cytotoxicity assay | 48 h | IC50 = 1.16 μM | 19359185 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 2.11 μM | 19359185 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 2.46 μM | 19359185 | ||
| SGC | Cytotoxicity assay | 48 h | IC50 = 3.34 μM | 19359185 | ||
| HCT116 | Cytotoxicity assay | 48 h | IC50 = 4.37 μM | 19359185 | ||
| A431 | Antiproliferative activity assay | GI50 = 0.00001 μM | 19394218 | |||
| MESSA | Antiproliferative activity assay | GI50 = 0.00001 μM | 19394218 | |||
| HCT15 | Antiproliferative activity assay | GI50 = 0.011 μM | 19394218 | |||
| MES-SA/Dx5 | Antiproliferative activity assay | GI50 = 0.16 μM | 19394218 | |||
| HCT15/CLO2 | Antiproliferative activity assay | GI50 = 0.83 μM | 19394218 | |||
| wild type A2780 | Growth inhibition assay | 72 h | IC50 = 0.0017 μM | 19423340 | ||
| cisplatin-resistant A2780 | Growth inhibition assay | 72 h | IC50 = 0.0022 μM | 19423340 | ||
| topotecan-resistant A2780 | Growth inhibition assay | 72 h | IC50 = 0.0072 μM | 19423340 | ||
| adriamycin and doxorubicin-resistant A2780 | Growth inhibition assay | 72 h | IC50 = 1.239 μM | 19423340 | ||
| paclitaxel-resistant A2780TC1 | Function assay | IC50 = 5.898 μM | 19423340 | |||
| NB4 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 19425589 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 19425589 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 19425589 | ||
| SH-SY5Y | Cytotoxicity assay | 48 h | IC50 = 0.2 μM | 19425589 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 0.2 μM | 19425589 | ||
| SNU398 | Apoptosis assay | 48 h | EC50 = 0.009 μM | 19467598 | ||
| HCT116 | Apoptosis assay | 48 h | EC50 = 0.018 μM | 19467598 | ||
| T47D | Growth inhibition assay | 48 h | GI50 = 0.026 μM | 19467598 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.08 μM | 19467877 | ||
| HepG2 | Cytotoxicity assay | GI50 = 0.059 μM | 19476336 | |||
| H1299 | Growth inhibition assay | 48 h | GI50 = 0.023 μM | 19500976 | ||
| T47D | Growth inhibition assay | 48 h | GI50 = 0.026 μM | 19500976 | ||
| DLD1 | Apoptosis assay | 48 h | EC50 = 0.054 μM | 19500976 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.0011 μM | 19576785 | ||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.0012 μM | 19576785 | ||
| MX1 | Cytotoxicity assay | 72 h | IC50 = 0.046 μM | 19576785 | ||
| vinblastine-resistant CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.4 μM | 19576785 | ||
| taxol-resistant CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 1.2 μM | 19576785 | ||
| MCF7 | Growth inhibition assay | 48 h | IC50 = 0.003 μM | 19601594 | ||
| PtK2 | Growth inhibition assay | IC50 = 0.021 μM | 19601594 | |||
| rat A10 | Growth inhibition assay | IC50 = 0.038 μM | 19601594 | |||
| HCT116 | Antiproliferative activity assay | 72 h | IC50 = 0.0008 μM | 19665384 | ||
| PC3 | Antiproliferative activity assay | 72 h | IC50 = 0.0008 μM | 19665384 | ||
| NCI/ADR | Antiproliferative activity assay | 72 h | IC50 = 0.004 μM | 19665384 | ||
| HuH7 | Antiproliferative activity assay | 72 h | IC50 = 0.008 μM | 19665384 | ||
| Caco-2 | Antiproliferative activity assay | 72 h | IC50 = 0.02 μM | 19665384 | ||
| MES-SA/Dx5 | Cytotoxicity assay | IC50 = 7.538 μM | 19679475 | |||
| A549 | Cytotoxicity assay | IC50 = 0.0023 μM | 19708679 | |||
| BGC823 | Cytotoxicity assay | IC50 = 0.0033 μM | 19708679 | |||
| HCT8 | Cytotoxicity assay | IC50 = 0.0036 μM | 19708679 | |||
| A2780 | Cytotoxicity assay | IC50 = 0.0079 μM | 19708679 | |||
| Bel7404 | Cytotoxicity assay | IC50 = 0.0123 μM | 19708679 | |||
| DG75 | Antiproliferative activity assay | 24 to 72 h | IC50 = 0.01 μM | 19717215 | ||
| MUTU-I | Antiproliferative activity assay | 24 h | IC50 = 0.01 μM | 19717215 | ||
| HCT116 | Antiproliferative activity assay | 72 h | IC50 = 0.001 μM | 19743863 | ||
| SW48 | Antiproliferative activity assay | 72 h | IC50 = 0.001 μM | 19743863 | ||
| MES-SA | Antiproliferative activity assay | 72 h | IC50 = 0.001 μM | 19743863 | ||
| CEM | Antiproliferative activity assay | 72 h | IC50 = 0.002 μM | 19743863 | ||
| SW480 | Antiproliferative activity assay | 72 h | IC50 = 0.002 μM | 19743863 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 19743863 | ||
| RL | Antiproliferative activity assay | 72 h | IC50 = 0.003 μM | 19743863 | ||
| T47D | Antiproliferative activity assay | 72 h | IC50 = 0.004 μM | 19743863 | ||
| UACC-812 | Antiproliferative activity assay | 72 h | IC50 = 0.7 μM | 19743863 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 4.84 μM | 19754130 | ||
| LNCAP | Cytotoxicity assay | 72 h | IC50 = 6.32 μM | 19754130 | ||
| HT-29 | Cytotoxicity assay | 1 h | IC50 = 0.0034 μM | 19778067 | ||
| HCT116 | Cytotoxicity assay | 1 h | IC50 = 0.0035 μM | 19778067 | ||
| K562 | Antiproliferative activity assay | 48 h | IC50 = 1.16 μM | 19815316 | ||
| A549 | Antiproliferative activity assay | 48 h | IC50 = 2.28 μM | 19815316 | ||
| SGC7901 | Antiproliferative activity assay | 48 h | IC50 = 3.34 μM | 19815316 | ||
| HCT116 | Antiproliferative activity assay | 48 h | IC50 = 4.37 μM | 19815316 | ||
| IGROV1 | Antiproliferative activity assay | 72 h | IC50 = 0.06 μM | 19833515 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.002 μM | 19860383 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.0028 μM | 19877653 | |||
| A2780AD | Cytotoxicity assay | IC50 = 0.415 μM | 19877653 | |||
| KB | Cytotoxicity assay | 48 h | IC50 = 0.02 μM | 19879765 | ||
| BT549 | Cytotoxicity assay | 48 h | IC50 = 0.02 μM | 19879765 | ||
| SKOV3 | Cytotoxicity assay | 48 h | IC50 = 0.53 μM | 19879765 | ||
| african green monkey Vero | Toxicity assay | 48 h | TC50 = 0.53 μM | 19879765 | ||
| SK-MEL | Cytotoxicity assay | 48 h | IC50 = 4.1 μM | 19879765 | ||
| pig LLC-PK11 | Toxicity assay | 48 h | TC50 = 4.39 μM | 19879765 | ||
| OVCAR-3 | Growth inhibition assay | 48 h | IC50 = 2.7 μM | 19939522 | ||
| A549 | Growth inhibition assay | 48 h | IC50 = 2.7 μM | 19939522 | ||
| SNU398 | Apoptosis assay | 48 h | EC50 = 0.009 μM | 20034792 | ||
| HCT116 | Apoptosis assay | 48 h | EC50 = 0.018 μM | 20034792 | ||
| T47D | Growth inhibition assay | 48 h | GI50 = 0.026 μM | 20034792 | ||
| KBVIN | Cytotoxicity assay | IC50 = 0.00109 μM | 20036537 | |||
| KB | Cytotoxicity assay | IC50 = 0.00155 μM | 20036537 | |||
| A549 | Cytotoxicity assay | IC50 = 0.00193 μM | 20036537 | |||
| DU145 | Cytotoxicity assay | IC50 = 0.00235 μM | 20036537 | |||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.002399 μM | 20116905 | ||
| KB | Cytotoxicity assay | IC50 = 0.08 μM | 20122764 | |||
| 786-0 | Cytotoxicity assay | IC50 = 0.08 μM | 20122764 | |||
| A375 | Cytotoxicity assay | IC50 = 0.81 μM | 20122764 | |||
| BGC | Cytotoxicity assay | IC50 = 1.5 μM | 20122764 | |||
| 769-P | Cytotoxicity assay | IC50 = 7.1 μM | 20122764 | |||
| MCF7 | Antiproliferative activity assay | 20 h | IC50 = 0.021 μM | 20149494 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.03 μM | 20180542 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.0013 μM | 20181487 | ||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.0031 μM | 20181487 | ||
| MX1 | Cytotoxicity assay | 72 h | IC50 = 0.035 μM | 20181487 | ||
| KB3-1 | Cytotoxicity assay | 72 h | IC50 = 0.0012 μM | 20302303 | ||
| HT-29 | Cytotoxicity assay | 3 days | ED50 = 0.0001 μM | 20384315 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 20521771 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 20521771 | ||
| PANC1 | Growth inhibition assay | 48 h | IC50 = 0.008 μM | 20521771 | ||
| SK-BR-3 | Cytotoxicity assay | 48 h | IC50 = 0.11 μM | 20521771 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 1.4 μM | 20521771 | ||
| LT12 | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 20537765 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 20537765 | ||
| SF268 | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 20537765 | ||
| NCI-H460 | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 20537765 | ||
| RKO | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 20537765 | ||
| KB/HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.01 μM | 20537765 | ||
| P388 | Antiproliferative activity assay | 48 h | IC50 = 0.04 μM | 20537765 | ||
| L1210 | Antiproliferative activity assay | 48 h | IC50 = 0.06 μM | 20537765 | ||
| DLD1 | Cytotoxicity assay | 72 h | GI50 = 0.01 μM | 20538462 | ||
| B16 | Cytotoxicity assay | 72 h | GI50 = 0.01 μM | 20538462 | ||
| A172 | Cytotoxicity assay | 72 h | GI50 = 0.01 μM | 20538462 | ||
| HeLa | Cytotoxicity assay | 72 h | GI50 = 0.02 μM | 20538462 | ||
| U87 | Cytotoxicity assay | 72 h | GI50 = 0.02 μM | 20538462 | ||
| SiHa | Cytotoxicity assay | 72 h | GI50 = 0.03 μM | 20538462 | ||
| HT-29 | Cytotoxicity assay | IC50 = 0.0014 μM | 20553003 | |||
| HCT116 | Cytotoxicity assay | IC50 = 0.00321 μM | 20553003 | |||
| A549 | Cytotoxicity assay | 96 h | IC50 = 0.001 μM | 20560647 | ||
| BGC823 | Cytotoxicity assay | 96 h | IC50 = 0.04 μM | 20560647 | ||
| A2780 | Cytotoxicity assay | 96 h | IC50 = 0.9 μM | 20560647 | ||
| HCT8 | Cytotoxicity assay | 96 h | IC50 = 3.6 μM | 20560647 | ||
| Bel7402 | Cytotoxicity assay | 96 h | IC50 = 6.3 μM | 20560647 | ||
| A2780 | Cytotoxicity assay | 3 days | IC50 = 0.65 μM | 20593839 | ||
| HCT8 | Cytotoxicity assay | 3 days | IC50 = 0.67 μM | 20593839 | ||
| Bel7402 | Cytotoxicity assay | 3 days | IC50 = 1.8 μM | 20593839 | ||
| KB | Cytotoxicity assay | IC50 = 0.08 μM | 20627721 | |||
| 786-0 | Cytotoxicity assay | IC50 = 0.08 μM | 20627721 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.08 μM | 20627721 | |||
| OS-RC2 | Cytotoxicity assay | IC50 = 0.08 μM | 20627721 | |||
| 22Rv1 | Cytotoxicity assay | IC50 = 0.08 μM | 20627721 | |||
| HT-29 | Cytotoxicity assay | IC50 = 0.38 μM | 20627721 | |||
| A375 | Cytotoxicity assay | IC50 = 0.81 μM | 20627721 | |||
| MCF7 | Cytotoxicity assay | IC50 = 1.3 μM | 20627721 | |||
| BCG823 | Cytotoxicity assay | IC50 = 1.5 μM | 20627721 | |||
| 769-P | Cytotoxicity assay | IC50 = 7.1 μM | 20627721 | |||
| KB | Cytotoxicity assay | IC50 = 0.08 μM | 20716468 | |||
| 786-0 | Cytotoxicity assay | IC50 = 0.08 μM | 20716468 | |||
| OS-RC2 | Cytotoxicity assay | IC50 = 0.08 μM | 20716468 | |||
| 22Rv1 | Cytotoxicity assay | IC50 = 0.08 μM | 20716468 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.08 μM | 20716468 | |||
| HT-29 | Cytotoxicity assay | IC50 = 0.38 μM | 20716468 | |||
| A375 | Cytotoxicity assay | IC50 = 0.81 μM | 20716468 | |||
| MCF7 | Cytotoxicity assay | IC50 = 1.3 μM | 20716468 | |||
| BGC823 | Cytotoxicity assay | IC50 = 1.5 μM | 20716468 | |||
| 769-P | Cytotoxicity assay | IC50 = 7.1 μM | 20716468 | |||
| BGC823 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 20719510 | ||
| A2780 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 20719510 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.016 μM | 20719510 | ||
| HCT8 | Cytotoxicity assay | 72 h | IC50 = 0.051 μM | 20719510 | ||
| Bel7402 | Cytotoxicity assay | 72 h | IC50 = 0.06 μM | 20719510 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.0038 μM | 20732809 | ||
| HEK | Cytotoxicity assay | 72 h | IC50 = 0.0039 μM | 20732809 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0044 μM | 20732809 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.0089 μM | 20732809 | ||
| Hep3B | Anticancer assay | 3 days | GI50 = 0.0004 μM | 20735140 | ||
| DU145 | Cytotoxicity assay | ED50 = 0.003 μM | 20738103 | |||
| KB | Cytotoxicity assay | ED50 = 0.007 μM | 20738103 | |||
| A549 | Cytotoxicity assay | ED50 = 0.008 μM | 20738103 | |||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.002 μM | 20800500 | ||
| wild type LCC-6 | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 20800500 | ||
| A2780 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 20800500 | ||
| CFPAC-1 | Cytotoxicity assay | 72 h | IC50 = 0.047 μM | 20800500 | ||
| multidrug-resistant LCC-6 | Cytotoxicity assay | 72 h | IC50 = 0.379 μM | 20800500 | ||
| NCI/ADR | Cytotoxicity assay | 72 h | IC50 = 0.41 μM | 20800500 | ||
| multidrug-resistant MDA-MB-435/LCCMDR1 | Cytotoxicity assay | 48 h | IC50 = 0.004 μM | 20919720 | ||
| multidrug-resistant MDA-MB-435/LCCMDR1 | Function assay | IC50 = 0.0693 μM | 20919720 | |||
| MDA-MB-435 | Cytotoxicity assay | 48 h | IC50 = 0.277 μM | 20919720 | ||
| LNCAP | Cytotoxicity assay | IC50 = 0.0223 μM | 20936874 | |||
| HT-29 | Cytotoxicity assay | 3 days | ED50 = 0.0006 μM | 20939540 | ||
| HCT116 | Growth inhibition assay | 96 h | IC50 = 0.002 μM | 20943401 | ||
| HCT15 | Growth inhibition assay | 96 h | IC50 = 0.14 μM | 20943401 | ||
| HeLa | Antiproliferative activity assay | IC50 = 0.0016 μM | 20973488 | |||
| SKOV3 | Antiproliferative activity assay | IC50 = 0.003 μM | 20973488 | |||
| A549 | Antiproliferative activity assay | 96 h | IC50 = 0.0049 μM | 20974505 | ||
| MCF7 | Antiproliferative activity assay | 96 h | IC50 = 0.021 μM | 20974505 | ||
| HT-29 | Anticancer assay | ED50 = 0.0001 μM | 21067206 | |||
| K562 | Cytotoxicity assay | 48 h | IC50 = 1.16 μM | 21067933 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 2.11 μM | 21067933 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 2.46 μM | 21067933 | ||
| SGC | Cytotoxicity assay | 48 h | IC50 = 3.34 μM | 21067933 | ||
| HCT116 | Cytotoxicity assay | 48 h | IC50 = 4.37 μM | 21067933 | ||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 21106377 | ||
| MCF7 | Cytotoxicity assay | 72 h | GI50 = 0.003 μM | 21115210 | ||
| HT-29 | Cytotoxicity assay | 72 h | GI50 = 0.003 μM | 21115210 | ||
| K562 | Cytotoxicity assay | 72 h | GI50 = 0.004 μM | 21115210 | ||
| PC3 | Cytotoxicity assay | 72 h | GI50 = 0.004 μM | 21115210 | ||
| MCF7 | Cytotoxicity assay | 24 h | IC50 = 0.63 μM | 21115212 | ||
| SMMC7721 | Cytotoxicity assay | 24 h | IC50 = 1.42 μM | 21115212 | ||
| A2780 | Cytotoxicity assay | 48 to 72 h | IC50 = 0.01 μM | 21126027 | ||
| Jurkat | Cell cycle arrest assay | 24 h | IC50 = 0.01 μM | 21126027 | ||
| HeLa | Cytotoxicity assay | 48 to 72 h | IC50 = 0.02 μM | 21126027 | ||
| SW620 | Cytotoxicity assay | 48 to 72 h | IC50 = 0.03 μM | 21126027 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.0013 μM | 21144756 | ||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 21144756 | ||
| MX1 | Cytotoxicity assay | 72 h | IC50 = 0.035 μM | 21144756 | ||
| chemoresistant DG75 | Cytotoxicity assay | 72 h | IC50 = 0.01 μM | 21227702 | ||
| chemosensitive MUTU-I | Cytotoxicity assay | 24 h | IC50 = 0.01 μM | 21227702 | ||
| HT1080 | Antiproliferative activity assay | 96 h | IC50 = 0.0012 μM | 21296467 | ||
| A549 | Antiproliferative activity assay | 96 h | IC50 = 0.0044 μM | 21296467 | ||
| A375 | Antiproliferative activity assay | 96 h | IC50 = 0.0046 μM | 21296467 | ||
| NCI-N87 | Antiproliferative activity assay | 96 h | IC50 = 0.0059 μM | 21296467 | ||
| MCF7 | Antiproliferative activity assay | 96 h | IC50 = 0.0205 μM | 21296467 | ||
| HeLa | Antiproliferative activity assay | 96 h | IC50 = 0.1 μM | 21296467 | ||
| PANC1 | Antiproliferative activity assay | 96 h | IC50 = 0.3841 μM | 21296467 | ||
| Bel7402 | Antiproliferative activity assay | 96 h | IC50 = 0.5782 μM | 21296467 | ||
| 1A9 | Antiproliferative activity assay | 3 days | ED50 = 0.00209 μM | 21296579 | ||
| A549 | Antiproliferative activity assay | 3 days | ED50 = 0.00256 μM | 21296579 | ||
| KB | Antiproliferative activity assay | 3 days | ED50 = 0.00287 μM | 21296579 | ||
| PC3 | Antiproliferative activity assay | 3 days | ED50 = 0.00887 μM | 21296579 | ||
| KB | Cytotoxicity assay | 72 h | GI50 = 0.00487 μM | 21316977 | ||
| DU145 | Cytotoxicity assay | 72 h | GI50 = 0.00555 μM | 21316977 | ||
| A549 | Cytotoxicity assay | 72 h | GI50 = 0.00558 μM | 21316977 | ||
| MES-SA | Antiproliferative activity assay | IC50 = 0.00296 μM | 21324686 | |||
| MES-SA | Antiproliferative activity assay | IC50 = 0.00296 μM | 21324687 | |||
| SF295 | Antiproliferative activity assay | IC50 = 0.02455 μM | 21324687 | |||
| MES-SA | Cytotoxicity assay | IC50 = 0.00296 μM | 21324692 | |||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.006 μM | 21341718 | ||
| HT-29 | Cytotoxicity assay | 48 h | IC50 = 0.007 μM | 21341718 | ||
| K562 | Cytotoxicity assay | 48 h | IC50 = 1.16 μM | 21342735 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 2.11 μM | 21342735 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 2.46 μM | 21342735 | ||
| SGC | Cytotoxicity assay | 48 h | IC50 = 3.34 μM | 21342735 | ||
| HCT116 | Cytotoxicity assay | 48 h | IC50 = 4.37 μM | 21342735 | ||
| multidrug-resistant K562 | Cytotoxicity assay | 48 h | IC50 = 5.63 μM | 21342735 | ||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 21356592 | ||
| taxol-resistant CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.43 μM | 21356592 | ||
| vinblastine-resistant CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 1.27 μM | 21356592 | ||
| KB | Cytotoxicity assay | 3 days | GI50 = 0.00516 μM | 21377368 | ||
| DU145 | Cytotoxicity assay | 3 days | GI50 = 0.00523 μM | 21377368 | ||
| A549 | Cytotoxicity assay | 3 days | GI50 = 0.0076 μM | 21377368 | ||
| A2780 | Cytotoxicity assay | 24 h | IC50 = 0.00082 μM | 21396747 | ||
| A2780AD | Cytotoxicity assay | 24 h | IC50 = 0.949 μM | 21396747 | ||
| HT-29 | Cytotoxicity assay | 3 days | ED50 = 0.0001 μM | 21428375 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.002 μM | 21440449 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.0026 μM | 21446699 | ||
| HT-29 | Cytotoxicity assay | 48 h | IC50 = 0.003 μM | 21446699 | ||
| KB | Cell cycle arrest assay | EC50 = 0.002 μM | 21480626 | |||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0023 μM | 21480626 | ||
| HT-29 | Antiproliferative activity assay | 72 h | IC50 = 0.0061 μM | 21480626 | ||
| A431 | Antiproliferative activity assay | 72 h | IC50 = 0.0092 μM | 21480626 | ||
| SKOV3 | Antiproliferative activity assay | 72 h | IC50 = 0.0145 μM | 21480626 | ||
| NCI-H460 | Antiproliferative activity assay | 72 h | IC50 = 0.0146 μM | 21480626 | ||
| MCF7 | Cytotoxicity assay | 48 h | GI50 = 0.012 μM | 21513294 | ||
| HT-29 | Cytotoxicity assay | 48 h | GI50 = 0.012 μM | 21513294 | ||
| SF268 | Cytotoxicity assay | 48 h | GI50 = 0.012 μM | 21513294 | ||
| H460 | Cytotoxicity assay | 48 h | GI50 = 0.024 μM | 21513294 | ||
| CHOK1 | Cytotoxicity assay | 48 h | GI50 = 5.9 μM | 21513294 | ||
| HeLa | Cytotoxicity assay | 24 h | IC50 = 6.62 μM | 21514015 | ||
| HELF | Cytotoxicity assay | 24 h | IC50 = 7.17 μM | 21514015 | ||
| SH-SY5Y | Cytotoxicity assay | 24 h | IC50 = 8.56 μM | 21514015 | ||
| BGC823 | Cytotoxicity assay | 24 h | IC50 = 9.24 μM | 21514015 | ||
| A2780 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 21530251 | ||
| BGC823 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 21530251 | ||
| Bel7402 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 21530251 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.016 μM | 21530251 | ||
| HCT8 | Cytotoxicity assay | 72 h | IC50 = 0.051 μM | 21530251 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 21534539 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 21534539 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 21534539 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 21534539 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 21534539 | ||
| OVCAR8 | Anticancer assay | 96 h | IC50 = 0.0047 μM | 21557538 | ||
| NCI/ADR-RES | Anticancer assay | 96 h | IC50 = 6.263 μM | 21557538 | ||
| NCI-H460 | Antiproliferative activity assay | 48 h | IC50 = 0.004 μM | 21563750 | ||
| COLO205 | Antiproliferative activity assay | 48 h | IC50 = 0.005 μM | 21563750 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 21563750 | ||
| BT549 | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 21563750 | ||
| 451LU | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 21563750 | ||
| SW480 | Antiproliferative activity assay | 48 h | IC50 = 0.011 μM | 21563750 | ||
| DLD1 | Antiproliferative activity assay | 48 h | IC50 = 0.05 μM | 21563750 | ||
| HT1080 | Antiproliferative activity assay | 48 h | IC50 = 0.00015 μM | 21604746 | ||
| CEM | Antiproliferative activity assay | 48 h | IC50 = 0.00027 μM | 21604746 | ||
| L1210 | Antiproliferative activity assay | 48 h | IC50 = 0.0004 μM | 21604746 | ||
| K562 | Antiproliferative activity assay | 48 h | IC50 = 0.00071 μM | 21604746 | ||
| DU145 | Antiproliferative activity assay | 48 h | IC50 = 0.0013 μM | 21604746 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.0026 μM | 21604746 | ||
| MDA-MB-231 | Antiproliferative activity assay | 48 h | IC50 = 0.0091 μM | 21604746 | ||
| B16F0 | Antiproliferative activity assay | 48 h | IC50 = 0.028 μM | 21604746 | ||
| P388D1 | Antiproliferative activity assay | 48 h | IC50 = 0.035 μM | 21604746 | ||
| CHO-VV 3-2 | Antiproliferative activity assay | 48 h | IC50 = 0.14 μM | 21604746 | ||
| CHO | Antiproliferative activity assay | 48 h | IC50 = 0.17 μM | 21604746 | ||
| CHO-TAX 5-6 | Antiproliferative activity assay | 48 h | IC50 = 0.52 μM | 21604746 | ||
| CEM/VLB | Antiproliferative activity assay | 48 h | IC50 = 3.34 μM | 21604746 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0072 μM | 21663319 | ||
| taxol-resistant A549-T12 | Antiproliferative activity assay | 72 h | IC50 = 0.0752 μM | 21663319 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.0025 μM | 21680190 | ||
| MCF7/VP | Cytotoxicity assay | 48 h | IC50 = 0.0028 μM | 21680190 | ||
| NCI/ADR | Cytotoxicity assay | 48 h | IC50 = 2.7 μM | 21680190 | ||
| LT12 | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 21705223 | ||
| NCI-H460 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 21705223 | ||
| SF268 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 21705223 | ||
| KB/HeLa | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 21705223 | ||
| SKOV3 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 21705223 | ||
| RKOp27 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 21705223 | ||
| P388 | Antiproliferative activity assay | 48 h | IC50 = 0.04 μM | 21705223 | ||
| L1210 | Antiproliferative activity assay | 48 h | IC50 = 0.06 μM | 21705223 | ||
| NCI-H460 | Anticancer assay | 72 h | IC30 = 3.6 μM | 21707046 | ||
| A2780 | Cytotoxicity assay | 48 h | IC50 = 0.00062 μM | 21764308 | ||
| A2780AD | Cytotoxicity assay | 48 h | IC50 = 1.9 μM | 21764308 | ||
| 786-0 | Antiproliferative activity assay | IC50 = 0.004 μM | 21774499 | |||
| PC3 | Antiproliferative activity assay | IC50 = 0.00043 μM | 21775150 | |||
| DU145 | Antiproliferative activity assay | IC50 = 0.0023 μM | 21775150 | |||
| MDA-MB-435 | Antiproliferative activity assay | IC50 = 0.016 μM | 21775150 | |||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.00162 μM | 21779519 | ||
| COLO205 | Cytotoxicity assay | 48 h | IC50 = 0.00331 μM | 21779519 | ||
| KB | Cytotoxicity assay | IC50 = 6.684 μM | 21784631 | |||
| DU145 | Cytotoxicity assay | IC50 = 8.626 μM | 21784631 | |||
| A549 | Cytotoxicity assay | IC50 = 9.265 μM | 21784631 | |||
| HeLa | Antiproliferative activity assay | IC50 = 0.00138 μM | 21786793 | |||
| SKOV3 | Antiproliferative activity assay | IC50 = 0.00295 μM | 21786793 | |||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0012 μM | 21800839 | ||
| A2780 | Cytotoxicity assay | 2 days | IC50 = 0.014 μM | 21802957 | ||
| Hep3B2 | Cytotoxicity assay | 72 h | IC50 = 0.000016 μM | 21812410 | ||
| PANC1 | Cytotoxicity assay | 72 h | IC50 = 0.0011 μM | 21812410 | ||
| CNE1-LMP1 | Cytotoxicity assay | 72 h | IC50 = 0.0042 μM | 21812410 | ||
| MGC | Cytotoxicity assay | 72 h | IC50 = 0.0064 μM | 21812410 | ||
| A375 | Cytotoxicity assay | 72 h | IC50 = 0.0089 μM | 21812410 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.014 μM | 21812410 | ||
| HaCaT | Cytotoxicity assay | 72 h | IC50 = 0.024 μM | 21812410 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.03 μM | 21812410 | ||
| EC109 | Cytotoxicity assay | 72 h | IC50 = 0.14 μM | 21812410 | ||
| MES-SA | Cytotoxicity assay | 96 h | IC50 = 0.004 μM | 21812421 | ||
| MES-SA/Dx5 | Cytotoxicity assay | 96 h | IC50 = 0.75 μM | 21812421 | ||
| HT-29 | Cytotoxicity assay | GI50 = 0.002 μM | 21839640 | |||
| RPMI8226 | Cytotoxicity assay | GI50 = 0.002 μM | 21839640 | |||
| HCC2998 | Cytotoxicity assay | GI50 = 0.003 μM | 21839640 | |||
| Hs578T | Cytotoxicity assay | GI50 = 0.003 μM | 21839640 | |||
| COLO205 | Cytotoxicity assay | GI50 = 0.003 μM | 21839640 | |||
| PC3 | Cytotoxicity assay | GI50 = 0.004 μM | 21839640 | |||
| A549 | Cytotoxicity assay | GI50 = 0.004 μM | 21839640 | |||
| SNB75 | Cytotoxicity assay | GI50 = 0.004 μM | 21839640 | |||
| KM12 | Cytotoxicity assay | GI50 = 0.004 μM | 21839640 | |||
| DU145 | Cytotoxicity assay | GI50 = 0.005 μM | 21839640 | |||
| SKOV3 | Cytotoxicity assay | GI50 = 0.008 μM | 21839640 | |||
| NCI-H322M | Cytotoxicity assay | GI50 = 0.013 μM | 21839640 | |||
| UACC257 | Cytotoxicity assay | GI50 = 0.04 μM | 21839640 | |||
| HCT15 | Cytotoxicity assay | GI50 = 0.158 μM | 21839640 | |||
| ACHN | Cytotoxicity assay | GI50 = 0.398 μM | 21839640 | |||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.0034 μM | 21848268 | ||
| MCF7 | Antiproliferative activity assay | 96 h | IC50 = 0.00091 μM | 21870795 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.00314 μM | 21870795 | ||
| A549 | Cytotoxicity assay | 24 h | EC50 = 0.0046 μM | 21873068 | ||
| KB | Cytotoxicity assay | IC50 = 0.08 μM | 21875764 | |||
| 786-0 | Cytotoxicity assay | IC50 = 0.08 μM | 21875764 | |||
| OS-RC2 | Cytotoxicity assay | IC50 = 0.08 μM | 21875764 | |||
| 22Rv1 | Cytotoxicity assay | IC50 = 0.08 μM | 21875764 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.08 μM | 21875764 | |||
| HT-29 | Cytotoxicity assay | IC50 = 0.38 μM | 21875764 | |||
| A375 | Cytotoxicity assay | IC50 = 0.81 μM | 21875764 | |||
| MCF7 | Cytotoxicity assay | IC50 = 1.3 μM | 21875764 | |||
| BGC823 | Cytotoxicity assay | IC50 = 1.5 μM | 21875764 | |||
| 769-P | Cytotoxicity assay | IC50 = 7.1 μM | 21875764 | |||
| MCF7 | Cytotoxicity assay | 3 days | GI50 = 1.07 μM | 21889341 | ||
| PC3 | Cytotoxicity assay | 3 days | GI50 = 1.46 μM | 21889341 | ||
| SK-N-SH | Cytotoxicity assay | 3 days | GI50 = 2.19 μM | 21889341 | ||
| HeLa | Cytotoxicity assay | 3 days | GI50 = 2.82 μM | 21889341 | ||
| CHO-VV 3-2 | Antiproliferative activity assay | 48 h | IC50 = 0.14 μM | 21920638 | ||
| CHO-TAX 5-6 | Antiproliferative activity assay | 48 h | IC50 = 0.52 μM | 21920638 | ||
| multidrug-resistant CEM/VLB | Antiproliferative activity assay | 48 h | IC50 = 3.34 μM | 21920638 | ||
| BGC823 | Cytotoxicity assay | IC50 = 0.00329 μM | 21928797 | |||
| HT-29 | Cytotoxicity assay | IC50 = 0.00394 μM | 21928797 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.0044 μM | 21928797 | |||
| A375 | Cytotoxicity assay | IC50 = 0.0049 μM | 21928797 | |||
| A549 | Cytotoxicity assay | IC50 = 0.0449 μM | 21928797 | |||
| NCI-H460 | Cytotoxicity assay | IC50 = 8 μM | 21942765 | |||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 21973054 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.6 μM | 21973054 | ||
| HT-29 | Cytotoxicity assay | 3 days | ED50 = 0.006 μM | 21973101 | ||
| HBL100 | Growth inhibition assay | GI50 = 0.000017 μM | 21986585 | |||
| HeLa | Growth inhibition assay | GI50 = 0.000033 μM | 21986585 | |||
| T47D | Growth inhibition assay | GI50 = 0.00015 μM | 21986585 | |||
| WiDr | Growth inhibition assay | GI50 = 0.00022 μM | 21986585 | |||
| A2780 | Growth inhibition assay | GI50 = 0.00027 μM | 21986585 | |||
| SW1573 | Growth inhibition assay | GI50 = 0.005 μM | 21986585 | |||
| A2780 | Antiproliferative activity assay | IC50 = 0.017 μM | 21995542 | |||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0072 μM | 22027100 | ||
| taxol-resistant A549-T12 | Antiproliferative activity assay | 72 h | IC50 = 0.075 μM | 22027100 | ||
| OVCAR8 | Growth inhibition assay | 96 h | IC50 = 0.002 μM | 22044164 | ||
| NCI-ADR-RES | Growth inhibition assay | 96 h | IC50 = 1.5 μM | 22044164 | ||
| KB | Growth inhibition assay | 72 h | IC50 = 0.0033 μM | 22060033 | ||
| KB-7d | Growth inhibition assay | 72 h | IC50 = 0.0079 μM | 22060033 | ||
| KB-S15 | Growth inhibition assay | 72 h | IC50 = 0.273 μM | 22060033 | ||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.015 μM | 22071526 | ||
| KB | Cytotoxicity assay | 48 h | IC50 = 0.0045 μM | 22074257 | ||
| L1210 | Cytotoxicity assay | 48 h | IC50 = 0.12 μM | 22074257 | ||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.02 μM | 22136523 | ||
| DU145 | Cytotoxicity assay | EC50 = 0.0059 μM | 22142543 | |||
| KB | Cytotoxicity assay | EC50 = 0.006 μM | 22142543 | |||
| A549 | Cytotoxicity assay | EC50 = 0.0064 μM | 22142543 | |||
| QGY7701 | Cytotoxicity assay | 72 h | IC50 = 0.04 μM | 22153338 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.05 μM | 22153338 | ||
| Bel7404 | Cytotoxicity assay | 72 h | IC50 = 0.82 μM | 22153338 | ||
| SMMC7721 | Cytotoxicity assay | 72 h | IC50 = 0.88 μM | 22153338 | ||
| Bel7402 | Cytotoxicity assay | 72 h | IC50 = 1.25 μM | 22153338 | ||
| MCF7 | Cytotoxicity assay | 24 to 48 h | IC50 = 0.003 μM | 22222040 | ||
| SH-SY5Y | Cytotoxicity assay | 24 to 48 h | IC50 = 0.004 μM | 22222040 | ||
| HepG2 | Cytotoxicity assay | 24 to 48 h | IC50 = 0.007 μM | 22222040 | ||
| H460 | Cytotoxicity assay | 24 to 48 h | IC50 = 0.008 μM | 22222040 | ||
| HT-29 | Cytotoxicity assay | 3 days | IC50 = 0.006 μM | 22239601 | ||
| DU145 | Antiproliferative activity assay | 72 h | GI50 = 0.00386 μM | 22265685 | ||
| KB | Antiproliferative activity assay | 72 h | GI50 = 0.00412 μM | 22265685 | ||
| A549 | Antiproliferative activity assay | 72 h | GI50 = 0.00546 μM | 22265685 | ||
| MCF7 | Cytotoxicity assay | 96 h | IC50 = 0.1 μM | 22360613 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.19 μM | 22472043 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.006 μM | 22472045 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 0.41 μM | 22483090 | ||
| CaEs17 | Cytotoxicity assay | 72 h | IC50 = 0.43 μM | 22483090 | ||
| MGC803 | Cytotoxicity assay | 72 h | IC50 = 0.85 μM | 22483090 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.89 μM | 22483090 | ||
| Bel7402 | Cytotoxicity assay | 72 h | IC50 = 1.89 μM | 22483090 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 3.46 μM | 22483090 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 4.77 μM | 22483090 | ||
| SKOV3 | Cytotoxicity assay | IC50 = 0.0001 μM | 22506620 | |||
| BGC823 | Cytotoxicity assay | IC50 = 0.0033 μM | 22506620 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.0044 μM | 22506620 | |||
| A549 | Cytotoxicity assay | IC50 = 0.016 μM | 22506620 | |||
| HCT8 | Cytotoxicity assay | IC50 = 0.051 μM | 22506620 | |||
| CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.0012 μM | 22507893 | ||
| taxol-resistant CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 0.43 μM | 22507893 | ||
| vinblastine-resistant CCRF-CEM | Cytotoxicity assay | 72 h | IC50 = 1.27 μM | 22507893 | ||
| BGC823 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 22583079 | ||
| A2780 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 22583079 | ||
| Bel7402 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 22583079 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.016 μM | 22583079 | ||
| HCT8 | Cytotoxicity assay | 72 h | IC50 = 0.051 μM | 22583079 | ||
| MES-SA | Cytotoxicity assay | 96 h | IC50 = 0.004 μM | 22587519 | ||
| MESSA/DX5 | Cytotoxicity assay | 96 h | IC50 = 0.75 μM | 22587519 | ||
| HCT116 | Cytotoxicity assay | IC50 = 0.05 μM | 22691179 | |||
| SKBR3 | Cytotoxicity assay | IC50 = 0.11 μM | 22691179 | |||
| SK-MEL-5 | Cytotoxicity assay | IC50 = 0.15 μM | 22691179 | |||
| SKOV3 | Cytotoxicity assay | IC50 = 0.4 μM | 22691179 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.9 μM | 22691179 | |||
| PC3 | Antiproliferative activity assay | 48 h | IC50 = 0.0004 μM | 22783954 | ||
| paclitaxel-resistant PC3-TxR | Antiproliferative activity assay | 48 h | IC50 = 0.188 μM | 22783954 | ||
| MCF7 | Cytotoxicity assay | 24 h | IC50 = 0.015 μM | 22818081 | ||
| SKBR3 | Growth inhibition assay | 48 h | IC50 = 0.0019 μM | 22850214 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.00044 μM | 22871217 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 22871217 | ||
| A375 | Cytotoxicity assay | 72 h | IC50 = 0.0092 μM | 22871217 | ||
| BxPC3 | Cytotoxicity assay | 72 h | IC50 = 0.09 μM | 22871217 | ||
| SMMC7721 | Cytotoxicity assay | 72 h | IC50 = 0.15 μM | 22871217 | ||
| PANC1 | Cytotoxicity assay | 72 h | IC50 = 0.26 μM | 22871217 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.72 μM | 22871217 | ||
| AGS | Cytotoxicity assay | 72 h | IC50 = 1.6 μM | 22871217 | ||
| NCI-H2126 | Cytotoxicity assay | 72 h | IC50 = 2.5 μM | 22871217 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 5 μM | 22871217 | ||
| U87 | Cytotoxicity assay | 72 h | IC50 = 8.1 μM | 22871217 | ||
| HELF | Cytotoxicity assay | 24 h | IC50 = 7.14 μM | 22901410 | ||
| BGC | Cytotoxicity assay | 24 h | IC50 = 9.26 μM | 22901410 | ||
| HELF | Cytotoxicity assay | 24 h | IC50 = 7.14 μM | 22921966 | ||
| BGC | Cytotoxicity assay | 24 h | IC50 = 9.26 μM | 22921966 | ||
| DU145 | Cytotoxicity assay | 72 h | GI50 = 0.00255 μM | 22932313 | ||
| KB | Cytotoxicity assay | 72 h | GI50 = 0.00265 μM | 22932313 | ||
| A549 | Cytotoxicity assay | 72 h | GI50 = 0.00489 μM | 22932313 | ||
| KBVIN | Cytotoxicity assay | 72 h | GI50 = 0.948 μM | 22932313 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.00282 μM | 22959518 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.00293 μM | 22959518 | ||
| U937 | Cytotoxicity assay | 72 h | IC50 = 0.00337 μM | 22959518 | ||
| HeLa | Cytotoxicity assay | IC50 = 1 μM | 23103097 | |||
| A2780 | Cytotoxicity assay | IC50 = 1.1 μM | 23103097 | |||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0072 μM | 23117171 | ||
| taxol-resistant A549-T12 | Antiproliferative activity assay | 72 h | IC50 = 0.0752 μM | 23117171 | ||
| IGROV1/Pt1 | Cytotoxicity assay | 72 h | IC50 = 0.0022 μM | 23140358 | ||
| SKOV3 | Cytotoxicity assay | 72 h | IC50 = 0.0027 μM | 23140358 | ||
| U2OS | Cytotoxicity assay | 72 h | IC50 = 0.0034 μM | 23140358 | ||
| PANC1 | Cytotoxicity assay | 72 h | IC50 = 0.0052 μM | 23140358 | ||
| MIAPaCa2 | Cytotoxicity assay | 72 h | IC50 = 0.0072 μM | 23140358 | ||
| IGROV1 | Cytotoxicity assay | 72 h | IC50 = 0.023 μM | 23140358 | ||
| MES-SA | Cytotoxicity assay | IC50 = 0.003 μM | 23141916 | |||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.028 μM | 23149304 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.052 μM | 23153397 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.054 μM | 23153397 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.056 μM | 23153397 | ||
| NUGC3 | Growth inhibition assay | GI50 = 0.02 μM | 23167614 | |||
| HONE1 | Growth inhibition assay | GI50 = 0.02 μM | 23167614 | |||
| NCI-H460 | Growth inhibition assay | GI50 = 0.03 μM | 23167614 | |||
| MCF7 | Growth inhibition assay | GI50 = 0.03 μM | 23167614 | |||
| A549 | Growth inhibition assay | GI50 = 0.06 μM | 23167614 | |||
| HepG2 | Growth inhibition assay | GI50 = 0.18 μM | 23167614 | |||
| HeLa | Cytotoxicity assay | 96 h | IC50 = 0.001 μM | 23176628 | ||
| SW780 | Cytotoxicity assay | 96 h | IC50 = 0.0011 μM | 23176628 | ||
| MESSA | Cytotoxicity assay | 72 h | IC50 = 0.004 μM | 23214452 | ||
| OVCAR8 | Cytotoxicity assay | IC50 = 0.005 μM | 23214452 | |||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.005 μM | 23214452 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.007 μM | 23214452 | ||
| HT-29 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23214452 | ||
| HCT15 | Cytotoxicity assay | 72 h | IC50 = 0.09 μM | 23214452 | ||
| MESSA/DX5 | Cytotoxicity assay | 72 h | IC50 = 1.764 μM | 23214452 | ||
| NCI/ADR-RES | Cytotoxicity assay | IC50 = 3.3 μM | 23214452 | |||
| DU145 | Growth inhibition assay | GI50 = 0.0065 μM | 23274123 | |||
| KB | Growth inhibition assay | GI50 = 0.00777 μM | 23274123 | |||
| A549 | Growth inhibition assay | GI50 = 0.00818 μM | 23274123 | |||
| KBVIN | Growth inhibition assay | GI50 = 1.803 μM | 23274123 | |||
| K562 | Antiproliferative activity assay | IC50 = 0.41 μM | 23274570 | |||
| CaEs17 | Antiproliferative activity assay | IC50 = 0.43 μM | 23274570 | |||
| MGC803 | Antiproliferative activity assay | IC50 = 0.85 μM | 23274570 | |||
| Bel7402 | Antiproliferative activity assay | IC50 = 1.89 μM | 23274570 | |||
| U937 | Cytotoxicity assay | 72 h | IC50 = 0.0023 μM | 23301703 | ||
| MOLT4 | Cytotoxicity assay | 72 h | IC50 = 0.0027 μM | 23301703 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 0.0051 μM | 23301703 | ||
| KU812 | Cytotoxicity assay | 72 h | IC50 = 0.0053 μM | 23301703 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.0058 μM | 23301703 | ||
| SUP-B15 | Cytotoxicity assay | 72 h | IC50 = 0.008 μM | 23301703 | ||
| HT-29 | Cytotoxicity assay | ED50 = 0.001 μM | 23301897 | |||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23327668 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23327668 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23327668 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23327668 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.15 μM | 23327668 | ||
| HT-29 | Cytotoxicity assay | 3 days | IC50 = 0.001 μM | 23327794 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.0016 μM | 23332369 | ||
| SKOV3 | Cytotoxicity assay | 48 h | IC50 = 0.0044 μM | 23332369 | ||
| JC | Cytotoxicity assay | 48 h | IC50 = 0.15 μM | 23352482 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.0063 μM | 23356786 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.0082 μM | 23356786 | ||
| QGY | Cytotoxicity assay | 48 h | IC50 = 0.0113 μM | 23356786 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.0121 μM | 23356786 | ||
| K562 | Cytotoxicity assay | 48 h | IC50 = 0.0157 μM | 23356786 | ||
| NCI-H358 | Cytotoxicity assay | IC50 = 0.01 μM | 23425970 | |||
| A2780S | Cytotoxicity assay | IC50 = 0.02 μM | 23425970 | |||
| DU145 | Cytotoxicity assay | IC50 = 0.03 μM | 23425970 | |||
| SKOV3 | Cytotoxicity assay | IC50 = 0.1 μM | 23425970 | |||
| ES2 | Cytotoxicity assay | IC50 = 0.1 μM | 23425970 | |||
| HCT15 | Cytotoxicity assay | IC50 = 0.12 μM | 23425970 | |||
| PC3 | Cytotoxicity assay | IC50 = 0.14 μM | 23425970 | |||
| SKHEP1 | Cytotoxicity assay | IC50 = 0.24 μM | 23425970 | |||
| HT-29 | Cytotoxicity assay | IC50 = 0.45 μM | 23425970 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.66 μM | 23425970 | |||
| C26 | Cytotoxicity assay | IC50 = 1.05 μM | 23425970 | |||
| SPC-A1 | Cytotoxicity assay | IC50 = 5.3 μM | 23425970 | |||
| A2780 | Cytotoxicity assay | IC50 = 8.25 μM | 23425970 | |||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.0035 μM | 23445496 | ||
| A549-T12 | Cytotoxicity assay | 72 h | IC50 = 0.0923 μM | 23445496 | ||
| MDA-MB-435 | Cytotoxicity assay | 48 h | IC50 = 0.004 μM | 23547728 | ||
| MDA-MB-435/LCC6MDR1 | Cytotoxicity assay | 48 h | IC50 = 0.277 μM | 23547728 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.001 μM | 23547884 | |||
| BGC823 | Cytotoxicity assay | IC50 = 0.001 μM | 23547884 | |||
| Bel7402 | Cytotoxicity assay | IC50 = 0.006 μM | 23547884 | |||
| A549 | Cytotoxicity assay | IC50 = 0.016 μM | 23547884 | |||
| HCT8 | Cytotoxicity assay | IC50 = 0.051 μM | 23547884 | |||
| KB403 | Cytotoxicity assay | 6 h | IC50 = 0.001 μM | 23584542 | ||
| WRL68 | Cytotoxicity assay | 6 h | IC50 = 0.004 μM | 23584542 | ||
| MCF7 | Cytotoxicity assay | 6 h | IC50 = 0.005 μM | 23584542 | ||
| Caco2 | Cytotoxicity assay | 6 h | IC50 = 0.008 μM | 23584542 | ||
| PA1 | Cytotoxicity assay | 6 h | IC50 = 0.008 μM | 23584542 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23586920 | ||
| A2058 | Cytotoxicity assay | 96 h | IC50 = 0.0047 μM | 23623678 | ||
| H522-T1 | Cytotoxicity assay | 96 h | IC50 = 0.0081 μM | 23623678 | ||
| A2780 | Cytotoxicity assay | 2 days | IC50 = 0.012 μM | 23623678 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 0.41 μM | 23644204 | ||
| CaEs17 | Cytotoxicity assay | 72 h | IC50 = 0.43 μM | 23644204 | ||
| MGC803 | Cytotoxicity assay | 72 h | IC50 = 0.85 μM | 23644204 | ||
| Bel7402 | Cytotoxicity assay | 72 h | IC50 = 1.89 μM | 23644204 | ||
| HT1080 | Cytotoxicity assay | 24 h | IC50 = 6 μM | 23647462 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.028 μM | 23659371 | |||
| SNU387 | Cytotoxicity assay | 48 h | IC50 = 0.27 μM | 23701597 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 23708235 | ||
| SKOV3 | Cytotoxicity assay | 72 h | IC50 = 0.012 μM | 23708235 | ||
| HCT116 | Cytotoxicity assay | GI50 = 0.01 μM | 23725535 | |||
| T47D | Cytotoxicity assay | GI50 = 0.01 μM | 23725535 | |||
| LOXIMVI | Cytotoxicity assay | GI50 = 0.016 μM | 23725535 | |||
| OVCAR3 | Cytotoxicity assay | GI50 = 0.02 μM | 23725535 | |||
| DU145 | Cytotoxicity assay | GI50 = 0.032 μM | 23725535 | |||
| MOLT4 | Cytotoxicity assay | GI50 = 0.032 μM | 23725535 | |||
| SNB19 | Cytotoxicity assay | GI50 = 0.04 μM | 23725535 | |||
| NCI-H322M | Cytotoxicity assay | GI50 = 0.05 μM | 23725535 | |||
| RXF393 | Cytotoxicity assay | GI50 = 0.05 μM | 23725535 | |||
| A549 | Cytotoxicity assay | 3 days | IC50 = 0.02 μM | 23738539 | ||
| NB4 | Cytotoxicity assay | 3 days | IC50 = 0.03 μM | 23738539 | ||
| MCF7 | Cytotoxicity assay | 3 days | IC50 = 0.1 μM | 23738539 | ||
| PC3 | Cytotoxicity assay | 3 days | IC50 = 0.2 μM | 23738539 | ||
| SH-SY5Y | Cytotoxicity assay | 3 days | IC50 = 0.2 μM | 23738539 | ||
| HT-29 | Cytotoxicity assay | 96 h | IC50 = 0.00198 μM | 23746477 | ||
| HCT116 | Cytotoxicity assay | 96 h | IC50 = 0.00613 μM | 23746477 | ||
| 2008 | Growth inhibition assay | GI50 = 0.003 μM | 23750455 | |||
| MES-SA | Growth inhibition assay | GI50 = 0.004 μM | 23750455 | |||
| MES-SA/Dx5 | Growth inhibition assay | GI50 = 0.75 μM | 23750455 | |||
| 2008/17/4 | Growth inhibition assay | GI50 = 2 μM | 23750455 | |||
| MOLT4 | Cytotoxicity assay | IC50 = 0.0018 μM | 23806112 | |||
| U937 | Cytotoxicity assay | IC50 = 0.0019 μM | 23806112 | |||
| BGC823 | Cytotoxicity assay | IC50 = 0.0035 μM | 23806112 | |||
| A549 | Cytotoxicity assay | IC50 = 0.0036 μM | 23806112 | |||
| K562 | Cytotoxicity assay | IC50 = 0.0049 μM | 23806112 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.005 μM | 23806112 | |||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23819871 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23819871 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 23819871 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.04 μM | 23819871 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 1.4 μM | 23819871 | ||
| MCF7 | Cytotoxicity assay | 72 h | GI50 = 0.003 μM | 23831811 | ||
| HT-29 | Cytotoxicity assay | 72 h | GI50 = 0.003 μM | 23831811 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 1 μM | 23848163 | ||
| PANC1 | Cytotoxicity assay | 72 h | IC50 = 1 μM | 23848163 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0017 μM | 23855338 | ||
| rat lymphatic endothelial | Antiproliferative activity assay | 48 h | IC50 = 0.018 μM | 23855338 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0012 μM | 23855953 | ||
| DU145 | Cytotoxicity assay | GI50 = 0.006 μM | 23867604 | |||
| KB | Cytotoxicity assay | GI50 = 0.0064 μM | 23867604 | |||
| A549 | Cytotoxicity assay | GI50 = 0.0076 μM | 23867604 | |||
| KBVIN | Cytotoxicity assay | GI50 = 1.21 μM | 23867604 | |||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.014 μM | 23886686 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.0006 μM | 23895019 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0016 μM | 23895532 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.003 μM | 23895532 | ||
| SKOV3/M6-6 isogenic | Function assay | 48 h | IC50 = 2.6 μM | 23895532 | ||
| MES-SA | Growth inhibition assay | 48 h | GI50 = 0.007 μM | 23927793 | ||
| MES-SA/Dx5 | Growth inhibition assay | 48 h | GI50 = 9.8 μM | 23927793 | ||
| HL60 | Cytotoxicity assay | IC50 = 0.002 μM | 23937981 | |||
| DU145 | Cytotoxicity assay | IC50 = 0.005 μM | 23937981 | |||
| MES-SA | Cytotoxicity assay | IC50 = 0.005 μM | 23937981 | |||
| MDA435 | Cytotoxicity assay | IC50 = 0.005 μM | 23937981 | |||
| Bowes | Cytotoxicity assay | IC50 = 0.005 μM | 23937981 | |||
| A549 | Cytotoxicity assay | IC50 = 0.01 μM | 23937981 | |||
| Clone A | Cytotoxicity assay | IC50 = 0.5 μM | 23937981 | |||
| MIP101 | Cytotoxicity assay | IC50 = 1.1 μM | 23937981 | |||
| PBMC | Cytotoxicity assay | IC50 = 5 μM | 23937981 | |||
| 39SK | Cytotoxicity assay | IC50 = 5 μM | 23937981 | |||
| HL60 | Antimicrobial assay | 48 h | IC50 = 0.008 μM | 23957453 | ||
| SMMC7721 | Antimicrobial assay | 48 h | IC50 = 0.008 μM | 23957453 | ||
| MCF7 | Antimicrobial assay | 48 h | IC50 = 0.008 μM | 23957453 | ||
| SW480 | Antimicrobial assay | 48 h | IC50 = 0.04 μM | 23957453 | ||
| A549 | Antimicrobial assay | 48 h | IC50 = 0.1 μM | 23957453 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.003 μM | 24012378 | ||
| PC3 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 24033131 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 0.04 μM | 24033131 | ||
| WI38 | Cytotoxicity assay | 72 h | IC50 = 0.05 μM | 24033131 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.5 μM | 24056146 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 1.5 μM | 24056146 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 24063567 | ||
| NB4 | Cytotoxicity assay | 72 h | IC50 = 0.03 μM | 24063567 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.1 μM | 24063567 | ||
| SH-SY5Y | Cytotoxicity assay | 72 h | IC50 = 0.2 μM | 24063567 | ||
| PC3 | Cytotoxicity assay | 72 h | IC50 = 0.2 μM | 24063567 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.02 μM | 24063582 | ||
| NB4 | Cytotoxicity assay | 48 h | IC50 = 0.03 μM | 24063582 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 24063582 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 0.2 μM | 24063582 | ||
| SH-SY5Y | Cytotoxicity assay | 48 h | IC50 = 0.2 μM | 24063582 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.0014 μM | 24087857 | ||
| SKOV3 | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 24087857 | ||
| KB | Cytotoxicity assay | 72 h | IC50 = 0.0041 μM | 24106982 | ||
| KB-7d | Cytotoxicity assay | 72 h | IC50 = 0.0079 μM | 24106982 | ||
| KB-S15 | Cytotoxicity assay | 72 h | IC50 = 0.273 μM | 24106982 | ||
| MCF7 | Cytotoxicity assay | IC50 = 3.1 μM | 24195466 | |||
| A549 | Antiproliferative activity assay | 96 h | IC50 = 0.0044 μM | 24211639 | ||
| MCF7 | Antiproliferative activity assay | 96 h | IC50 = 0.0205 μM | 24211639 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24219809 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24219809 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24219809 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24219809 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24219809 | ||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.024 μM | 24239390 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24256484 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24256484 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24256484 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24256484 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24256484 | ||
| BEAS2B | Cytotoxicity assay | 48 h | IC50 = 0.58 μM | 24256484 | ||
| SKOV3 | Cytotoxicity assay | 48 h | IC50 = 0.035 μM | 24269481 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.93 μM | 24269481 | ||
| DU145 | Cytotoxicity assay | GI50 = 0.006 μM | 24315191 | |||
| A549 | Cytotoxicity assay | GI50 = 0.0076 μM | 24315191 | |||
| KB | Cytotoxicity assay | GI50 = 0.008 μM | 24315191 | |||
| KBVIN | Cytotoxicity assay | GI50 = 1.8 μM | 24315191 | |||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.00705 μM | 24332858 | ||
| MCF7 | Growth inhibition assay | GI50 = 0.00129 μM | 24405702 | |||
| Bel7402 | Growth inhibition assay | GI50 = 0.001792 μM | 24405702 | |||
| MOLT4 | Growth inhibition assay | GI50 = 0.002232 μM | 24405702 | |||
| A431 | Growth inhibition assay | GI50 = 0.002355 μM | 24405702 | |||
| U937 | Growth inhibition assay | GI50 = 0.002392 μM | 24405702 | |||
| PANC1 | Growth inhibition assay | GI50 = 0.002409 μM | 24405702 | |||
| SGC7901 | Growth inhibition assay | GI50 = 0.003088 μM | 24405702 | |||
| HeLa | Growth inhibition assay | GI50 = 0.003206 μM | 24405702 | |||
| BGC823 | Growth inhibition assay | GI50 = 0.003605 μM | 24405702 | |||
| HT1080 | Growth inhibition assay | GI50 = 0.003889 μM | 24405702 | |||
| DU145 | Growth inhibition assay | GI50 = 0.005568 μM | 24405702 | |||
| K562 | Growth inhibition assay | GI50 = 0.007014 μM | 24405702 | |||
| A549 | Growth inhibition assay | GI50 = 0.01873 μM | 24405702 | |||
| HuH7 | Growth inhibition assay | GI50 = 0.2067 μM | 24405702 | |||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24417634 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24417634 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24417634 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24417634 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24417634 | ||
| HeLa | Cytotoxicity assay | IC50 = 0.0025 μM | 24422592 | |||
| Bel7402 | Cytotoxicity assay | 96 h | IC50 = 0.011 μM | 24467317 | ||
| HCT8 | Cytotoxicity assay | 96 h | IC50 = 0.02 μM | 24467317 | ||
| BGC823 | Cytotoxicity assay | 96 h | IC50 = 0.026 μM | 24467317 | ||
| A549 | Cytotoxicity assay | 96 h | IC50 = 0.032 μM | 24467317 | ||
| A2780 | Cytotoxicity assay | 96 h | IC50 = 0.59 μM | 24467317 | ||
| ViBo | Antiproliferative activity assay | 24 h | IC50 = 1.6 μM | 24487193 | ||
| CaSki | Antiproliferative activity assay | 24 h | IC50 = 2.9 μM | 24487193 | ||
| DU145 | Cytotoxicity assay | GI50 = 0.006 μM | 24502232 | |||
| KB | Cytotoxicity assay | GI50 = 0.0064 μM | 24502232 | |||
| A549 | Cytotoxicity assay | GI50 = 0.0076 μM | 24502232 | |||
| KBVIN | Cytotoxicity assay | GI50 = 1.21 μM | 24502232 | |||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0056 μM | 24564494 | ||
| KB | Cytotoxicity assay | 72 h | IC50 = 0.0051 μM | 24657567 | ||
| KB-7d | Cytotoxicity assay | 72 h | IC50 = 0.0084 μM | 24657567 | ||
| KB-S15 | Cytotoxicity assay | 72 h | IC50 = 0.135 μM | 24657567 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.00138 μM | 24680057 | |||
| 1A9PTX22 | Cytotoxicity assay | IC50 = 0.1607 μM | 24680057 | |||
| 1A9PTX10 | Cytotoxicity assay | IC50 = 0.53295 μM | 24680057 | |||
| BCG823 | Cytotoxicity assay | IC50 = 0.0028 μM | 24684840 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.0064 μM | 24684840 | |||
| HL-7702 | Cytotoxicity assay | IC50 = 0.0518 μM | 24684840 | |||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24697496 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24697496 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24697496 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24697496 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 24697496 | ||
| HT-29 | Growth inhibition assay | 48 h | GI50 = 0.001 μM | 24727464 | ||
| U251 | Growth inhibition assay | 48 h | GI50 = 0.003 μM | 24727464 | ||
| MCF7 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 24727464 | ||
| UACC62 | Growth inhibition assay | 48 h | GI50 = 0.01 μM | 24727464 | ||
| 786-0 | Growth inhibition assay | 48 h | GI50 = 0.02 μM | 24727464 | ||
| African green monkey Vero | Growth inhibition assay | 48 h | GI50 = 0.03 μM | 24727464 | ||
| NCI-ADR-RES | Growth inhibition assay | 48 h | GI50 = 0.04 μM | 24727464 | ||
| NCI-H460 | Growth inhibition assay | 48 h | GI50 = 0.1 μM | 24727464 | ||
| PC3 | Growth inhibition assay | 48 h | GI50 = 0.1 μM | 24727464 | ||
| K562 | Growth inhibition assay | 48 h | GI50 = 0.1 μM | 24727464 | ||
| OVCAR3 | Growth inhibition assay | 48 h | GI50 = 0.2 μM | 24727464 | ||
| HepG2 | Cytotoxicity assay | 3 days | IC50 = 0.00019 μM | 24745968 | ||
| KB | Cytotoxicity assay | 3 days | IC50 = 0.0039 μM | 24745968 | ||
| NCI-ADR-RES | Cytotoxicity assay | EC50 = 0.013 μM | 24801610 | |||
| OVCAR8 | Cytotoxicity assay | EC50 = 0.018 μM | 24801610 | |||
| NALM6 | Antiproliferative activity assay | 48 to 72 h | IC50 = 0.0041 μM | 24852281 | ||
| Jurkat | Antiproliferative activity assay | 48 to 72 h | IC50 = 0.0045 μM | 24852281 | ||
| K562 | Antiproliferative activity assay | 48 to 72 h | IC50 = 0.0055 μM | 24852281 | ||
| HeLa | Antiproliferative activity assay | IC50 = 0.00121 μM | 24890652 | |||
| MDA-MB-435 | Antiproliferative activity assay | IC50 = 0.00193 μM | 24890652 | |||
| SKOV3 | Antiproliferative activity assay | IC50 = 0.003 μM | 24890652 | |||
| SKOV3 | Cytotoxicity assay | GI50 = 0.0047 μM | 24893224 | |||
| P-gp expressing SKOV3-M6/6 | Cytotoxicity assay | GI50 = 0.6 μM | 24893224 | |||
| PC3 | Cytotoxicity assay | 96 h | IC50 = 0.0025 μM | 24900437 | ||
| HeLa | Growth inhibition assay | 96 h | IC50 = 0.0053 μM | 24900865 | ||
| OVCAR8 | Growth inhibition assay | 96 h | IC50 = 0.01 μM | 24900865 | ||
| NCI/ADR-RES | Growth inhibition assay | 96 h | IC50 = 5 μM | 24900865 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.045 μM | 24929344 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.069 μM | 24929344 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.084 μM | 24929344 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.096 μM | 24929344 | ||
| U251 | Cytotoxicity assay | 72 h | IC50 = 0.128 μM | 24929344 | ||
| HT-29 | Cytotoxicity assay | IC50 = 0.001 μM | 24937209 | |||
| HT-29 | Antiproliferative activity assay | 24 and 72 h | IC50 = 0.29 μM | 24941130 | ||
| HeLa | Antiproliferative activity assay | 24 and 72 h | IC50 = 0.29 μM | 24941130 | ||
| Caco2 | Antiproliferative activity assay | 24 and 72 h | IC50 = 0.31 μM | 24941130 | ||
| HL60 | Antiproliferative activity assay | 24 and 72 h | IC50 = 0.32 μM | 24941130 | ||
| MCF7 | Antiproliferative activity assay | 24 and 72 h | IC50 = 0.33 μM | 24941130 | ||
| Saos2 | Antiproliferative activity assay | 24 and 72 h | IC50 = 0.35 μM | 24941130 | ||
| SKOV3-MDR1-M6/6 | Anticancer assay | 48 h | IC50 = 0.97 μM | 24946145 | ||
| SKOV3 | Anticancer assay | 48 h | IC50 = 1 μM | 24946145 | ||
| MDA435/LCC6 | Cytotoxicity assay | 5 days | IC50 = 0.0026 μM | 24952376 | ||
| MDA435/LCC6MDR | Cytotoxicity assay | 5 days | IC50 = 0.1493 μM | 24952376 | ||
| MCF7 | Cytotoxicity assay | IC50 = 0.0015 μM | 24960143 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.0046 μM | 24960143 | |||
| MDA-MB-231 | Cytotoxicity assay | IC50 = 0.0082 μM | 24960143 | |||
| HL7702 | Cytotoxicity assay | IC50 = 1.1 μM | 24960143 | |||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 0.02581 μM | 24996136 | ||
| HepG2 | Antiproliferative activity assay | 48 h | IC50 = 0.06727 μM | 24996136 | ||
| A549 | Antiproliferative activity assay | 48 h | IC50 = 1.525 μM | 24996136 | ||
| KB | Cytotoxicity assay | 72 h | IC50 = 0.0039 μM | 25008456 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.0057 μM | 25008456 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0066 μM | 25008456 | ||
| KBVIN | Cytotoxicity assay | 72 h | IC50 = 1.44 μM | 25008456 | ||
| MESSA | Cytotoxicity assay | 72 h | IC50 = 0.004 μM | 25025991 | ||
| OVCAR8 | Cytotoxicity assay | 96 h | IC50 = 0.005 μM | 25025991 | ||
| MESSA/DX5 | Cytotoxicity assay | 72 h | IC50 = 1.764 μM | 25025991 | ||
| HepG2 | Cytotoxicity assay | 48 h | IC50 = 2.037 μM | 25025991 | ||
| NCI/ADR-RES | Cytotoxicity assay | 96 h | IC50 = 3.3 μM | 25025991 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 3.99 μM | 25025991 | ||
| TCT1 | Cytotoxicity assay | 48 h | IC50 = 2.5 μM | 25046128 | ||
| A2780 | Cytotoxicity assay | IC50 = 0.0004 μM | 25047938 | |||
| HeLa | Cytotoxicity assay | IC50 = 0.0007 μM | 25047938 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.0017 μM | 25047938 | |||
| 1A9 | Cytotoxicity assay | IC50 = 0.0039 μM | 25047938 | |||
| 1A9/A8 | Cytotoxicity assay | IC50 = 0.0042 μM | 25047938 | |||
| 1A9PTX22 | Cytotoxicity assay | IC50 = 0.0328 μM | 25047938 | |||
| 1A9PTX10 | Cytotoxicity assay | IC50 = 0.0814 μM | 25047938 | |||
| MCF7/R | Cytotoxicity assay | IC50 = 0.299 μM | 25047938 | |||
| A2780AD | Cytotoxicity assay | IC50 = 1.244 μM | 25047938 | |||
| KB | Antiproliferative activity assay | IC50 = 0.0033 μM | 25059503 | |||
| KB-7d | Antiproliferative activity assay | IC50 = 0.0079 μM | 25059503 | |||
| KB-S15 | Antiproliferative activity assay | IC50 = 0.273 μM | 25059503 | |||
| CNE2 | Antiproliferative activity assay | 48 h | IC50 = 0.003 μM | 25061803 | ||
| A549 | Antiproliferative activity assay | 48 h | IC50 = 0.005 μM | 25061803 | ||
| SW480 | Antiproliferative activity assay | 48 h | IC50 = 0.007 μM | 25061803 | ||
| A2780 | Antiproliferative activity assay | 48 h | IC50 = 0.015 μM | 25061803 | ||
| HCT8 | Antiproliferative activity assay | 48 h | IC50 = 0.021 μM | 25061803 | ||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 0.023 μM | 25061803 | ||
| HepG2 | Antiproliferative activity assay | 48 h | IC50 = 0.028 μM | 25061803 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.004 μM | 25084144 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.082 μM | 25084144 | ||
| COLO205 | Cytotoxicity assay | IC50 = 0.003 μM | 25091926 | |||
| K562 | Cytotoxicity assay | 72 h | IC50 = 0.004 μM | 25091926 | ||
| A431 | Cytotoxicity assay | 72 h | IC50 = 0.007 μM | 25091926 | ||
| MDA-MB-435S | Cytotoxicity assay | 72 h | IC50 = 0.009 μM | 25091926 | ||
| NCI-H460 | Cytotoxicity assay | IC50 = 0.01 μM | 25091926 | |||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.41 μM | 25091926 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.99 μM | 25091926 | ||
| MDA-MB-DYT2 | Cytotoxicity assay | 4 days | IC50 = 0.00608 μM | 25098528 | ||
| MDA-MB-468 | Cytotoxicity assay | 4 days | IC50 = 0.00717 μM | 25098528 | ||
| NCI-N87 | Cytotoxicity assay | 4 days | IC50 = 0.00753 μM | 25098528 | ||
| NCI-H1975 | Cytotoxicity assay | 4 days | IC50 = 0.00794 μM | 25098528 | ||
| BT474 | Cytotoxicity assay | 4 days | IC50 = 0.00836 μM | 25098528 | ||
| DU145 | Cytotoxicity assay | IC50 = 1.5 μM | 25105722 | |||
| MCF7 | Cytotoxicity assay | IC50 = 1.8 μM | 25105722 | |||
| HeLa | Cytotoxicity assay | IC50 = 5 μM | 25105722 | |||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.2 μM | 25176329 | ||
| NCI-H358 | Antiproliferative activity assay | 48 h | IC50 = 0.002 μM | 25208345 | ||
| A2780S | Antiproliferative activity assay | 48 h | IC50 = 0.004 μM | 25208345 | ||
| HCT8 | Antiproliferative activity assay | 48 h | IC50 = 0.005 μM | 25208345 | ||
| AGS | Antiproliferative activity assay | 48 h | IC50 = 0.008 μM | 25208345 | ||
| DLD1 | Antiproliferative activity assay | 48 h | IC50 = 0.016 μM | 25208345 | ||
| HCT116 | Antiproliferative activity assay | 48 h | IC50 = 0.018 μM | 25208345 | ||
| ES2 | Antiproliferative activity assay | 48 h | IC50 = 0.02 μM | 25208345 | ||
| U251 | Antiproliferative activity assay | 48 h | IC50 = 0.023 μM | 25208345 | ||
| HCT15 | Antiproliferative activity assay | 48 h | IC50 = 0.024 μM | 25208345 | ||
| HepG2 | Antiproliferative activity assay | 48 h | IC50 = 0.038 μM | 25208345 | ||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 0.132 μM | 25208345 | ||
| C26 | Antiproliferative activity assay | 48 h | IC50 = 0.21 μM | 25208345 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 1.5 μM | 25211032 | ||
| K562 | Cytotoxicity assay | 48 h | IC50 = 2.4 μM | 25211032 | ||
| HepG2 | Cytotoxicity assay | 48 h | IC50 = 2.7 μM | 25211032 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 3.2 μM | 25211032 | ||
| HT-29 | Cytotoxicity assay | 48 h | IC50 = 3.5 μM | 25211032 | ||
| KB | Cytotoxicity assay | 48 h | IC50 = 3.8 μM | 25211032 | ||
| NCI-H1688 | Cytotoxicity assay | 24 h | IC50 = 0.85 μM | 25226363 | ||
| PC3 | Cytotoxicity assay | 24 h | IC50 = 0.94 μM | 25226363 | ||
| A549 | Cytotoxicity assay | 24 h | IC50 = 1.04 μM | 25226363 | ||
| DU145 | Cytotoxicity assay | 24 h | IC50 = 1.79 μM | 25226363 | ||
| A549 | Antiproliferative activity assay | 3 days | IC50 = 0.0024 μM | 25241925 | ||
| KB | Antiproliferative activity assay | 3 days | IC50 = 0.0037 μM | 25241925 | ||
| DU145 | Antiproliferative activity assay | 3 days | IC50 = 0.00488 μM | 25241925 | ||
| KBVIN | Antiproliferative activity assay | 3 days | IC50 = 1.58 μM | 25241925 | ||
| HeLa | Growth inhibition assay | 48 h | GI50 = 0.025 μM | 25264072 | ||
| MiaPaCa | Growth inhibition assay | 48 h | GI50 = 0.056 μM | 25264072 | ||
| IMR32 | Growth inhibition assay | 48 h | GI50 = 0.075 μM | 25264072 | ||
| MDA-MB-231 | Growth inhibition assay | 48 h | GI50 = 0.091 μM | 25264072 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25375202 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25375202 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25375202 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25375202 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.15 μM | 25375202 | ||
| HepG2 | Cytotoxicity assay | 3 days | IC50 = 0.00019 μM | 25442315 | ||
| KB | Cytotoxicity assay | 3 days | IC50 = 0.0039 μM | 25442315 | ||
| MDA-MB-231 | Antiproliferative activity assay | 4 h | IC50 = 6.2 μM | 25453798 | ||
| MDA435 | Cytotoxicity assay | 24 h | IC50 = 0.005 μM | 25462222 | ||
| HL60 | Cytotoxicity assay | 24 h | IC50 = 0.007 μM | 25462222 | ||
| MES-SA | Cytotoxicity assay | 24 h | IC50 = 0.008 μM | 25462222 | ||
| MDA-MB-231 | Cytotoxicity assay | 24 h | IC50 = 0.457 μM | 25462222 | ||
| MES-SA/Dx5 | Cytotoxicity assay | 24 h | IC50 = 5.1 μM | 25462222 | ||
| HeLa | Antiproliferative activity assay | 48 h | GI50 = 0.025 μM | 25462234 | ||
| MiaPaCa | Antiproliferative activity assay | 48 h | GI50 = 0.056 μM | 25462234 | ||
| IMR32 | Antiproliferative activity assay | 48 h | GI50 = 0.075 μM | 25462234 | ||
| MDA-MB-231 | Antiproliferative activity assay | 48 h | GI50 = 0.091 μM | 25462234 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.004 μM | 25462279 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 25462279 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.008 μM | 25462279 | ||
| SKOV3 | Cytotoxicity assay | 48 h | IC50 = 0.001 μM | 25462285 | ||
| PANC1 | Cytotoxicity assay | IC50 = 1.18 μM | 25466201 | |||
| HeLa | Cytotoxicity assay | IC50 = 1.3 μM | 25466201 | |||
| Calu1 | Cytotoxicity assay | IC50 = 1.33 μM | 25466201 | |||
| H460 | Cytotoxicity assay | IC50 = 1.43 μM | 25466201 | |||
| HCT116 | Cytotoxicity assay | IC50 = 1.55 μM | 25466201 | |||
| ACHN | Cytotoxicity assay | IC50 = 2.33 μM | 25466201 | |||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 0.0027 μM | 25499433 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 2.58 μM | 25563891 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 4.9 μM | 25563891 | ||
| A375 | Cytotoxicity assay | 48 h | IC50 = 8 μM | 25563891 | ||
| LC2/ad | Antiproliferative activity assay | 72 h | IC50 = 0.0025 μM | 25625617 | ||
| GSS | Antiproliferative activity assay | 72 h | IC50 = 0.0034 μM | 25625617 | ||
| MKN45 | Antiproliferative activity assay | 72 h | IC50 = 0.004 μM | 25625617 | ||
| PC14 | Antiproliferative activity assay | 72 h | IC50 = 0.0044 μM | 25625617 | ||
| Lu116 | Antiproliferative activity assay | 72 h | IC50 = 0.0051 μM | 25625617 | ||
| LU99A | Antiproliferative activity assay | 72 h | IC50 = 0.0052 μM | 25625617 | ||
| MIAPaCa2 | Antiproliferative activity assay | 72 h | IC50 = 0.0061 μM | 25625617 | ||
| HCT116 | Antiproliferative activity assay | 72 h | IC50 = 0.0061 μM | 25625617 | ||
| HT-29 | Antiproliferative activity assay | 72 h | IC50 = 0.007 μM | 25625617 | ||
| NCI-H358 | Antiproliferative activity assay | 72 h | IC50 = 0.0079 μM | 25625617 | ||
| HL60 | Antiproliferative activity assay | 72 h | IC50 = 0.0079 μM | 25625617 | ||
| NCI-H460 | Antiproliferative activity assay | 72 h | IC50 = 0.01 μM | 25625617 | ||
| MRC5 | Antiproliferative activity assay | 72 h | IC50 = 0.08 μM | 25625617 | ||
| HCT15 | Antiproliferative activity assay | 72 h | IC50 = 0.24 μM | 25625617 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.01 μM | 25647428 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 0.012 μM | 25647428 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.025 μM | 25647428 | ||
| MES-SA | Antiproliferative activity assay | 48 h | GI50 = 0.007 μM | 25671501 | ||
| MES-SA/Dx5 | Antiproliferative activity assay | 48 h | GI50 = 9.8 μM | 25671501 | ||
| A549 | Antiproliferative activity assay | 48 h | IC50 = 0.003 μM | 25682561 | ||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 0.003 μM | 25682561 | ||
| A549/CDDP | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 25682561 | ||
| A2780 | Antiproliferative activity assay | 48 h | IC50 = 0.006 μM | 25682561 | ||
| HepG2 | Antiproliferative activity assay | 48 h | IC50 = 0.009 μM | 25682561 | ||
| SW480 | Antiproliferative activity assay | 48 h | IC50 = 0.021 μM | 25682561 | ||
| HCT8 | Antiproliferative activity assay | 48 h | IC50 = 0.066 μM | 25682561 | ||
| NIH/3T3 | Antiproliferative activity assay | 48 h | IC50 = 0.58 μM | 25682561 | ||
| A2780/TAX | Antiproliferative activity assay | 48 h | IC50 = 4.4 μM | 25682561 | ||
| MCF7/DX | Antiproliferative activity assay | 48 h | IC50 = 6.2 μM | 25682561 | ||
| HeLa | Growth inhibition assay | IC50 = 0.0035 μM | 25685941 | |||
| DU145 | Growth inhibition assay | IC50 = 0.004 μM | 25685941 | |||
| PC3 | Growth inhibition assay | IC50 = 0.04 μM | 25685941 | |||
| SKOV3 | Growth inhibition assay | IC50 = 6.2 μM | 25685941 | |||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.032 μM | 25728023 | ||
| HepG2 | Cytotoxicity assay | 48 h | IC50 = 0.045 μM | 25728023 | ||
| Hep3B2 | Cytotoxicity assay | IC50 = 0.000016 μM | 25760674 | |||
| PANC1 | Cytotoxicity assay | IC50 = 0.0011 μM | 25760674 | |||
| CNE1-LMP1 | Cytotoxicity assay | IC50 = 0.0042 μM | 25760674 | |||
| MGC | Cytotoxicity assay | IC50 = 0.0064 μM | 25760674 | |||
| A375 | Cytotoxicity assay | IC50 = 0.0089 μM | 25760674 | |||
| MCF7 | Cytotoxicity assay | IC50 = 0.014 μM | 25760674 | |||
| HaCaT | Cytotoxicity assay | IC50 = 0.024 μM | 25760674 | |||
| A549 | Cytotoxicity assay | IC50 = 0.03 μM | 25760674 | |||
| EC109 | Cytotoxicity assay | IC50 = 0.14 μM | 25760674 | |||
| NIH/3T3 | Cytotoxicity assay | IC50 = 4.2 μM | 25760674 | |||
| DU145 | Antiproliferative activity assay | GI50 = 0.0057 μM | 25770782 | |||
| KB | Antiproliferative activity assay | GI50 = 0.0064 μM | 25770782 | |||
| A549 | Antiproliferative activity assay | GI50 = 0.0071 μM | 25770782 | |||
| KBVIN | Antiproliferative activity assay | GI50 = 0.95 μM | 25770782 | |||
| HL60 | Antiproliferative activity assay | 72 h | IC50 = 0.0017 μM | 25771484 | ||
| HCT116 | Antiproliferative activity assay | 72 h | IC50 = 0.0049 μM | 25771484 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 0.015 μM | 25771484 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.058 μM | 25771484 | ||
| SMMC7721 | Antiproliferative activity assay | 72 h | IC50 = 0.12 μM | 25771484 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25798528 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25798528 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25798528 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25798528 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25798528 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.0018 μM | 25819096 | ||
| MOLT4 | Cytotoxicity assay | 72 h | IC50 = 0.0022 μM | 25819096 | ||
| U937 | Cytotoxicity assay | 72 h | IC50 = 0.0025 μM | 25819096 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.0032 μM | 25819096 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 0.0034 μM | 25819096 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.0044 μM | 25819096 | ||
| SGC7901 | Cytotoxicity assay | 72 h | IC50 = 0.0051 μM | 25819096 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 0.0052 μM | 25819096 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0062 μM | 25819096 | ||
| NCI-H1975 | Cytotoxicity assay | 72 h | IC50 = 0.0077 μM | 25819096 | ||
| MX1 | Cytotoxicity assay | 72 h | IC50 = 0.00559 μM | 25819334 | ||
| ID8 | Cytotoxicity assay | 72 h | IC50 = 0.0138 μM | 25819334 | ||
| L1210 | Cytotoxicity assay | 72 h | IC50 = 0.0276 μM | 25819334 | ||
| WI38 | Cytotoxicity assay | 72 h | IC50 = 0.0557 μM | 25819334 | ||
| MDA-MB-231 | Antiproliferative activity assay | 48 h | GI50 = 0.01 μM | 25827522 | ||
| A549 | Antiproliferative activity assay | 48 h | GI50 = 0.01 μM | 25827522 | ||
| PANC1 | Antiproliferative activity assay | 48 h | GI50 = 0.012 μM | 25827522 | ||
| HeLa | Antiproliferative activity assay | 48 h | GI50 = 0.02 μM | 25827522 | ||
| HEK293 | Cytotoxicity assay | 72 h | IC50 = 0.04 μM | 25842364 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25871261 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25871261 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25871261 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25871261 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 25871261 | ||
| SCC114 | Antiproliferative activity assay | 72 h | IC50 = 0.0003 μM | 25872984 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0019 μM | 25882519 | ||
| MDA-MB-435 | Antiproliferative activity assay | 48 h | IC50 = 0.0033 μM | 25882519 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.0063 μM | 25882519 | ||
| SKOV3-MDR1-M6/6 | Antiproliferative activity assay | 48 h | IC50 = 1.1872 μM | 25882519 | ||
| A549 | Antiproliferative activity assay | 48 h | IC50 = 0.0023 μM | 25937236 | ||
| taxol-resistant A549 | Antiproliferative activity assay | 48 h | IC50 = 0.52 μM | 25937236 | ||
| EL4 | Cytotoxicity assay | 48 h | IC50 = 1.7 μM | 25951057 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.38 μM | 25959813 | ||
| A549 | Antiproliferative activity assay | 48 h | IC50 = 2.82 μM | 25959813 | ||
| LCC-6 | Cytotoxicity assay | 3 days | IC50 = 0.0016 μM | 25985195 | ||
| MDA435/LCC6MDR | Cytotoxicity assay | 3 days | IC50 = 0.1446 μM | 25985195 | ||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.028 μM | 26042470 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 26068802 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 26068802 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 26068802 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 26068802 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 26068802 | ||
| BEAS2B | Cytotoxicity assay | 48 h | IC50 = 0.58 μM | 26068802 | ||
| NB4 | Cytotoxicity assay | 48 h | IC50 = 0.0023 μM | 26132075 | ||
| NCI-H1975 | Cytotoxicity assay | 72 h | IC50 = 0.0025 μM | 26132075 | ||
| OVCAR8 | Cytotoxicity assay | 48 h | IC50 = 0.0037 μM | 26132075 | ||
| MESSA | Cytotoxicity assay | 72 h | IC50 = 0.004 μM | 26132075 | ||
| MDA-MB-468 | Cytotoxicity assay | 72 h | IC50 = 0.005 μM | 26132075 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.007 μM | 26132075 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.007 μM | 26132075 | ||
| MDA-MB-436 | Cytotoxicity assay | 72 h | IC50 = 0.008 μM | 26132075 | ||
| MESSA/DX5 | Cytotoxicity assay | 72 h | IC50 = 1.764 μM | 26132075 | ||
| HepG2 | Cytotoxicity assay | 48 h | IC50 = 2.6 μM | 26132075 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 4.9 μM | 26132075 | ||
| NCI-ADR-RES | Cytotoxicity assay | 48 h | IC50 = 6 μM | 26132075 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 0.0051 μM | 26160020 | ||
| KB-7d | Antiproliferative activity assay | 72 h | IC50 = 0.0084 μM | 26160020 | ||
| KB-S15 | Antiproliferative activity assay | 72 h | IC50 = 0.135 μM | 26160020 | ||
| DU145 | Antiproliferative activity assay | GI50 = 0.006 μM | 26242242 | |||
| KB | Antiproliferative activity assay | GI50 = 0.0064 μM | 26242242 | |||
| A549 | Antiproliferative activity assay | GI50 = 0.0076 μM | 26242242 | |||
| vincristine-resistant KBVIN | Antiproliferative activity assay | GI50 = 1.21 μM | 26242242 | |||
| K562 | Cytotoxicity assay | IC50 = 0.9 μM | 26287401 | |||
| U937 | Cytotoxicity assay | 72 h | IC50 = 2.1 μM | 26316467 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 2.1 μM | 26316467 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 2.3 μM | 26316467 | ||
| MOLT4 | Cytotoxicity assay | 72 h | IC50 = 2.7 μM | 26316467 | ||
| NCI-H1975 | Cytotoxicity assay | 72 h | IC50 = 2.8 μM | 26316467 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 2.9 μM | 26316467 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 3.1 μM | 26316467 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 3.8 μM | 26316467 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 3.8 μM | 26316467 | ||
| SGC7901 | Cytotoxicity assay | 72 h | IC50 = 9.8 μM | 26316467 | ||
| MES-SA | Cytotoxicity assay | 48 h | GI50 = 0.007 μM | 26360047 | ||
| Rhabdomyosarcoma | Antiproliferative activity assay | 96 h | IC50 = 0.0084 μM | 26386818 | ||
| HT-29 | Cytotoxicity assay | 3 days | IC50 = 0.0008 μM | 26422131 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 26448037 | ||
| PC3 | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 26448037 | ||
| HCT116 | Cytotoxicity assay | 48 h | IC50 = 0.0028 μM | 26448037 | ||
| A549 | Cytotoxicity assay | IC50 = 0.0063 μM | 26448037 | |||
| HepG2 | Cytotoxicity assay | 48 h | IC50 = 1.217 μM | 26448037 | ||
| H460 | Cytotoxicity assay | 48 h | IC50 = 4.287 μM | 26448037 | ||
| cells after 48 hrs by SRB assay | Cytotoxicity assay | GI50 = 0.00148 μM | 26462052 | |||
| HeLa | Antiproliferative activity assay | 72 h | IC50 = 2.29 μM | 26602827 | ||
| 184B5 | Antiproliferative activity assay | 72 h | IC50 = 2.32 μM | 26602827 | ||
| MDA-MB-231 | Antiproliferative activity assay | 72 h | IC50 = 2.56 μM | 26602827 | ||
| MDA-MB-468 | Antiproliferative activity assay | 72 h | IC50 = 3.87 μM | 26602827 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 3.99 μM | 26602827 | ||
| Jurkat | Cytotoxicity assay | 48 h | IC50 = 0.0005 μM | 26638041 | ||
| U937 | Cytotoxicity assay | 48 h | IC50 = 0.006 μM | 26638041 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.099 μM | 26638041 | ||
| cells assessed as cell growth inhibition after 48 hrs by MTT assay | Cytotoxicity assay | IC50 = 0.65 μM | 26638041 | |||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0039 μM | 26690274 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0074 μM | 26690274 | ||
| U937 | Cytotoxicity assay | 72 h | IC50 = 0.00166 μM | 26697718 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.00199 μM | 26697718 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.00212 μM | 26697718 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 0.0023 μM | 26697718 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.00301 μM | 26697718 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.00304 μM | 26697718 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 0.00717 μM | 26697718 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.00732 μM | 26697718 | ||
| NCI-H292 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 26712098 | ||
| KB | Growth inhibition assay | 72 h | GI50 = 0.001 μM | 26778612 | ||
| DU145 | Antiproliferative activity assay | 48 h | IC50 = 0.0038 μM | 26785306 | ||
| PC3 | Antiproliferative activity assay | 48 h | IC50 = 0.02 μM | 26785306 | ||
| A549 | Antiproliferative activity assay | 3 days | IC50 = 0.00003 μM | 26865176 | ||
| KB | Antiproliferative activity assay | 3 days | IC50 = 0.00004 μM | 26865176 | ||
| MCF7 | Antiproliferative activity assay | 3 days | IC50 = 0.0039 μM | 26865176 | ||
| MDA-MB-231 | Antiproliferative activity assay | 3 days | IC50 = 0.018 μM | 26865176 | ||
| KBVIN | Antiproliferative activity assay | 3 days | IC50 = 2.6 μM | 26865176 | ||
| PC3 | Cytotoxicity assay | 72 h | IC50 = 0.002 μM | 26904921 | ||
| SKOV3 | Cytotoxicity assay | 72 h | IC50 = 0.0047 μM | 26974508 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.0132 μM | 26985296 | ||
| SKMES1 | Cytotoxicity assay | 48 h | IC50 = 0.0135 μM | 26985296 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.0189 μM | 26985296 | ||
| WPMY-1 | Cytotoxicity assay | 48 h | GI50 = 0.01 μM | 26994690 | ||
| A549 | Antiproliferative activity assay | 48 h | GI50 = 0.01 μM | 26994690 | ||
| MDA-MB-231 | Antiproliferative activity assay | 48 h | GI50 = 0.01 μM | 26994690 | ||
| HeLa | Antiproliferative activity assay | 48 h | GI50 = 0.023 μM | 26994690 | ||
| HepG2 | Antiproliferative activity assay | 48 h | IC50 = 0.02171 μM | 27017265 | ||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 0.02581 μM | 27017265 | ||
| HCT116 | Antiproliferative activity assay | 48 h | IC50 = 0.06727 μM | 27017265 | ||
| A2780 | Cytotoxicity assay | 48 h | IC50 = 0.005 μM | 27149641 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.009 μM | 27149641 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.012 μM | 27149641 | ||
| HCT8 | Cytotoxicity assay | 48 h | IC50 = 0.019 μM | 27149641 | ||
| A549/CDDP | Cytotoxicity assay | 48 h | IC50 = 0.023 μM | 27149641 | ||
| HCT8/VCT | Cytotoxicity assay | 48 h | IC50 = 0.125 μM | 27149641 | ||
| MCF7/DX | Cytotoxicity assay | 48 h | IC50 = 0.135 μM | 27149641 | ||
| A2780/TAX | Cytotoxicity assay | 48 h | IC50 = 5.68 μM | 27149641 | ||
| HeLa | Antiproliferative activity assay | 48 h | GI50 = 0.025 μM | 27209232 | ||
| MiaPaCa | Antiproliferative activity assay | 48 h | GI50 = 0.056 μM | 27209232 | ||
| IMR32 | Antiproliferative activity assay | 48 h | GI50 = 0.075 μM | 27209232 | ||
| MDA-MB-231 | Antiproliferative activity assay | 48 h | GI50 = 0.091 μM | 27209232 | ||
| PC3 | Antiproliferative activity assay | 72 h | IC50 = 0.002 μM | 27214307 | ||
| NCI-H1993 | Antiproliferative activity assay | 48 to 96 h | GI50 = 0.004 μM | 27218860 | ||
| MES-SA | Antiproliferative activity assay | 48 to 96 h | GI50 = 0.007 μM | 27218860 | ||
| NCI-H2073 | Antiproliferative activity assay | 48 to 96 h | GI50 = 2.4 μM | 27218860 | ||
| KBVIN | Antiproliferative activity assay | 48 h | GI50 = 2.6 μM | 27238842 | ||
| A549 | Antiproliferative activity assay | 48 h | GI50 = 2.6 μM | 27238842 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.00125 μM | 27311893 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.01262 μM | 27311893 | ||
| MDA-MB-231 | Anticancer assay | 72 h | IC50 = 0.003388 μM | 27317645 | ||
| HeLa | Anticancer assay | 72 h | IC50 = 0.01987 μM | 27317645 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.02 μM | 27329938 | ||
| PC3 | Cytotoxicity assay | 72 h | IC50 = 0.03 μM | 27329938 | ||
| HL-7702 | Cytotoxicity assay | 72 h | IC50 = 0.06 μM | 27329938 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.08 μM | 27329938 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 0.2 μM | 27329938 | ||
| MCF7 | Cytotoxicity assay | 96 h | IC50 = 0.0002 μM | 27434426 | ||
| HeLa | Cytotoxicity assay | 96 h | IC50 = 0.0064 μM | 27434426 | ||
| MCF7 | Cytotoxicity assay | IC50 = 0.0006 μM | 27441892 | |||
| HCT116 | Cytotoxicity assay | IC50 = 0.0009 μM | 27441892 | |||
| BGC823 | Cytotoxicity assay | IC50 = 0.0033 μM | 27441892 | |||
| HepG2 | Cytotoxicity assay | IC50 = 0.012 μM | 27441892 | |||
| Capan2 | Cytotoxicity assay | IC50 = 0.017 μM | 27441892 | |||
| A375 | Cytotoxicity assay | IC50 = 0.022 μM | 27441892 | |||
| A549 | Cytotoxicity assay | IC50 = 0.023 μM | 27441892 | |||
| A2780 | Cytotoxicity assay | IC50 = 0.038 μM | 27441892 | |||
| NCI-H1650 | Cytotoxicity assay | IC50 = 0.068 μM | 27441892 | |||
| NCI60 | Cytotoxicity assay | 48 h | GI50 = 0.0315 μM | 27448924 | ||
| HepG2 | Cytotoxicity assay | 48 h | IC50 = 0.006 μM | 27627130 | ||
| Hep3B | Cytotoxicity assay | 48 h | IC50 = 0.02 μM | 27627130 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.03 μM | 27627130 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.06 μM | 27627130 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 27704807 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 27704807 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 27704807 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 27704807 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 27704807 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 27704807 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.02 μM | 27704822 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 27704822 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 1.7 μM | 27748595 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 2.7 μM | 27748595 | ||
| HCT116 | Cytotoxicity assay | 72 h | IC50 = 3.3 μM | 27748595 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 5.5 μM | 27748595 | ||
| HepG2 | Cytotoxicity assay | 72 h | IC50 = 6.7 μM | 27748595 | ||
| HELF | Cytotoxicity assay | 24 h | IC50 = 7.14 μM | 27769031 | ||
| BGC823 | Cytotoxicity assay | 24 h | IC50 = 9.26 μM | 27769031 | ||
| KB | Cytotoxicity assay | 48 h | IC50 = 0.0008 μM | 27797192 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.00099 μM | 27797192 | ||
| MDA-MB-231 | Cytotoxicity assay | 48 h | IC50 = 0.00305 μM | 27797192 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.02275 μM | 27797192 | ||
| KBVIN | Cytotoxicity assay | 48 h | IC50 = 1.896 μM | 27797192 | ||
| HCT116 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 27887843 | ||
| Bel7402 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 27887843 | ||
| OVCAR8 | Growth inhibition assay | 96 h | IC50 = 5 μM | 27894589 | ||
| HeLa | Growth inhibition assay | 96 h | IC50 = 5.3 μM | 27894589 | ||
| HeLa | Growth inhibition assay | 48 h | GI50 = 0.0389 μM | 27964883 | ||
| MiaPaCa | Growth inhibition assay | 48 h | GI50 = 0.06 μM | 27964883 | ||
| IMR32 | Growth inhibition assay | 48 h | GI50 = 0.086 μM | 27964883 | ||
| MDA-MB-231 | Growth inhibition assay | 48 h | GI50 = 0.092 μM | 27964883 | ||
| DU145 | Antiproliferative activity assay | 48 h | IC50 = 0.011 μM | 27979593 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.036 μM | 27979593 | ||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 0.63 μM | 27979593 | ||
| ECA109 | Antiproliferative activity assay | 48 h | IC50 = 0.94 μM | 27979593 | ||
| MDA-MB-435 | Cytotoxicity assay | 72 h | IC50 = 0.0002 μM | 27983842 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.0008 μM | 27983842 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0027 μM | 27983842 | ||
| OVCAR3 | Cytotoxicity assay | 72 h | IC50 = 0.0033 μM | 27983842 | ||
| H1299 | Cytotoxicity assay | 24 h | IC50 = 1.5 μM | 27983842 | ||
| HEK-Blue | Function assay | 3 h | IC50 = 7.94328 μM | 28075581 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0062 μM | 28099003 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 0.00627 μM | 28099003 | ||
| MDA-MB-231 | Antiproliferative activity assay | 72 h | IC50 = 0.00882 μM | 28099003 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.0104 μM | 28099003 | ||
| KBVIN | Antiproliferative activity assay | 72 h | IC50 = 1.926 μM | 28099003 | ||
| MDA-MB-435 | Antiproliferative activity assay | GI50 = 0.001 μM | 28112516 | |||
| A549 | Cytotoxicity assay | 48 h | IC50 = 6.195 μM | 28237662 | ||
| KB | Cytotoxicity assay | 48 h | IC50 = 6.587 μM | 28237662 | ||
| MDA-MB-231 | Cytotoxicity assay | 48 h | IC50 = 9.384 μM | 28237662 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.0014 μM | 28240909 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0026 μM | 28252962 | ||
| MDA-MB-435 | Cytotoxicity assay | 72 h | IC50 = 0.0031 μM | 28252962 | ||
| OVCAR3 | Cytotoxicity assay | 72 h | IC50 = 0.0075 μM | 28252962 | ||
| MDA-MB-231 | Cytotoxicity assay | 48 h | IC50 = 0.08 μM | 28262526 | ||
| HepG2 | Cytotoxicity assay | IC50 = 0.3 μM | 28262527 | |||
| Hep3B | Cytotoxicity assay | IC50 = 0.73 μM | 28262527 | |||
| MRC5 | Cytotoxicity assay | 72 h | IC50 = 0.00052 μM | 28282127 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0062 μM | 28290698 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 0.0063 μM | 28290698 | ||
| MDA-MB-231 | Antiproliferative activity assay | 72 h | IC50 = 0.0088 μM | 28290698 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.0104 μM | 28290698 | ||
| KBVIN | Antiproliferative activity assay | 72 h | IC50 = 1.926 μM | 28290698 | ||
| PC3 | Antiproliferative activity assay | 72 h | IC50 = 0.004 μM | 28335606 | ||
| UACC62 | Antiproliferative activity assay | 72 h | IC50 = 0.006 μM | 28335606 | ||
| M14 | Antiproliferative activity assay | 72 h | IC50 = 0.007 μM | 28335606 | ||
| SK-MEL-2 | Antiproliferative activity assay | 72 h | IC50 = 0.009 μM | 28335606 | ||
| NCI-H460 | Antiproliferative activity assay | 72 h | IC50 = 0.01 μM | 28335606 | ||
| A375 | Antiproliferative activity assay | 72 h | IC50 = 0.01 μM | 28335606 | ||
| SF295 | Antiproliferative activity assay | 72 h | IC50 = 0.056 μM | 28335606 | ||
| ACHN | Antiproliferative activity assay | 72 h | IC50 = 0.066 μM | 28335606 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.00821 μM | 28340411 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.00952 μM | 28340411 | ||
| A549/TR | Cytotoxicity assay | 48 h | IC50 = 1.51 μM | 28340411 | ||
| HeLa/TR | Cytotoxicity assay | 48 h | IC50 = 1.53 μM | 28340411 | ||
| LO2 | Cytotoxicity assay | 72 h | IC50 = 0.002 μM | 28395199 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.023 μM | 28395199 | ||
| HT-29 | Antiproliferative activity assay | 72 h | IC50 = 0.025 μM | 28395199 | ||
| NCI-H596 | Antiproliferative activity assay | 72 h | IC50 = 0.035 μM | 28395199 | ||
| HT-29 | Cytotoxicity assay | 3 days | IC50 = 0.0014 μM | 28409637 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0015 μM | 28433513 | ||
| MDA-MB-435 | Antiproliferative activity assay | 48 h | IC50 = 0.002 μM | 28433513 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.003 μM | 28433513 | ||
| SKOV3-MDR1-M6/6 | Antiproliferative activity assay | 48 h | IC50 = 2.33 μM | 28433513 | ||
| KB | Antiproliferative activity assay | IC50 = 0.0059 μM | 28457756 | |||
| A549 | Antiproliferative activity assay | IC50 = 0.00685 μM | 28457756 | |||
| MDA-MB-231 | Antiproliferative activity assay | IC50 = 0.00963 μM | 28457756 | |||
| MCF7 | Antiproliferative activity assay | IC50 = 0.01146 μM | 28457756 | |||
| KBVIN | Antiproliferative activity assay | IC50 = 2.035 μM | 28457756 | |||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.028 μM | 28463001 | ||
| BGC823 | Cytotoxicity assay | 96 h | IC50 = 0.0008 μM | 28530828 | ||
| NCI-H460 | Cytotoxicity assay | 96 h | IC50 = 0.001 μM | 28530828 | ||
| HepG2 | Cytotoxicity assay | 96 h | IC50 = 0.0063 μM | 28530828 | ||
| OVPF008 | Antiproliferative activity assay | 6 days | IC50 = 1.1 μM | 28548825 | ||
| OVPF038 | Antiproliferative activity assay | 6 days | IC50 = 1.4 μM | 28548825 | ||
| KB | Cytotoxicity assay | 72 h | IC50 = 0.0036 μM | 28590124 | ||
| KBv200 | Cytotoxicity assay | 72 h | IC50 = 2.117 μM | 28590124 | ||
| MDA-MB-435 | Cytotoxicity assay | 72 h | IC50 = 0.0005 μM | 28594169 | ||
| OVCAR3 | Cytotoxicity assay | 72 h | IC50 = 0.002 μM | 28594169 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.009 μM | 28594169 | ||
| U937 | Cytotoxicity assay | 72 h | IC50 = 0.0017 μM | 28598633 | ||
| HL60 | Cytotoxicity assay | 72 h | IC50 = 0.002 μM | 28598633 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.0021 μM | 28598633 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 0.0023 μM | 28598633 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 28598633 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.003 μM | 28598633 | ||
| K562 | Cytotoxicity assay | 72 h | IC50 = 0.0072 μM | 28598633 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0073 μM | 28598633 | ||
| A2780 | Cytotoxicity assay | 48 h | IC50 = 0.00107 μM | 28624703 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.0011 μM | 28624703 | ||
| KB | Cytotoxicity assay | 48 h | IC50 = 0.0019 μM | 28624703 | ||
| Hela-beta3 | Cytotoxicity assay | 48 h | IC50 = 0.009 μM | 28624703 | ||
| A2780AD | Cytotoxicity assay | 48 h | IC50 = 1.282 μM | 28624703 | ||
| KBV1 | Cytotoxicity assay | 48 h | IC50 = 9.8 μM | 28624703 | ||
| BGC823 | Growth inhibition assay | 3 days | IC50 = 0.001 μM | 28625363 | ||
| HepG2 | Growth inhibition assay | 3 days | IC50 = 0.02 μM | 28625363 | ||
| HCT116 | Growth inhibition assay | 3 days | IC50 = 0.03 μM | 28625363 | ||
| A2780 | Growth inhibition assay | 3 days | IC50 = 0.03 μM | 28625363 | ||
| NCI-H1650 | Growth inhibition assay | 3 days | IC50 = 0.07 μM | 28625363 | ||
| A2780 | Antiproliferative activity assay | 2 days | IC50 = 0.0137 μM | 28648491 | ||
| KB | Cytotoxicity assay | 48 h | GI50 = 0.00512 μM | 28653846 | ||
| A549 | Cytotoxicity assay | 48 h | GI50 = 0.00703 μM | 28653846 | ||
| MDA-MB-231 | Cytotoxicity assay | 48 h | GI50 = 0.01 μM | 28653846 | ||
| MCF7 | Cytotoxicity assay | 48 h | GI50 = 0.0119 μM | 28653846 | ||
| KBVIN | Cytotoxicity assay | 48 h | GI50 = 2.716 μM | 28653846 | ||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 0.008 μM | 28654256 | ||
| HL60 | Antiproliferative activity assay | 48 h | IC50 = 0.008 μM | 28654256 | ||
| SMMC7721 | Antiproliferative activity assay | 48 h | IC50 = 0.008 μM | 28654256 | ||
| A549 | Antiproliferative activity assay | 48 h | IC50 = 0.008 μM | 28654256 | ||
| SW480 | Antiproliferative activity assay | 48 h | IC50 = 0.008 μM | 28654256 | ||
| A375 | Antiproliferative activity assay | 48 h | IC50 = 0.7 μM | 28667872 | ||
| MIAPaCa2 | Antiproliferative activity assay | 48 h | IC50 = 2.5 μM | 28667872 | ||
| HEY | Cytotoxicity assay | 48 h | IC50 = 0.1041 μM | 28719204 | ||
| A2780 | Cytotoxicity assay | 48 h | IC50 = 0.1642 μM | 28719204 | ||
| HCT116 | Growth inhibition assay | 96 h | IC50 = 0.0002 μM | 28737396 | ||
| BGC823 | Growth inhibition assay | 96 h | IC50 = 0.0006 μM | 28737396 | ||
| HepG2 | Growth inhibition assay | 96 h | IC50 = 0.0076 μM | 28737396 | ||
| A2780 | Growth inhibition assay | 96 h | IC50 = 0.0204 μM | 28737396 | ||
| A549 | Growth inhibition assay | 4 days | GI50 = 0.0037 μM | 28740601 | ||
| PC3 | Growth inhibition assay | 4 days | GI50 = 0.0058 μM | 28740601 | ||
| NCI-H460 | Cytotoxicity assay | 72 h | IC50 = 0.006 μM | 28740613 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.014 μM | 28740613 | ||
| A2780S | Antiproliferative activity assay | 48 h | IC50 = 0.0123 μM | 28763646 | ||
| HCT8 | Antiproliferative activity assay | 48 h | IC50 = 0.0174 μM | 28763646 | ||
| HCT8/T | Antiproliferative activity assay | 48 h | IC50 = 9.885 μM | 28763646 | ||
| A549 | Cytotoxicity assay | 24 h | IC50 = 0.0041 μM | 28835794 | ||
| 1A9 | Cytotoxicity assay | IC50 = 0.00371 μM | 28850227 | |||
| LNCAP | Antiproliferative activity assay | 72 h | IC50 = 0.0019 μM | 28857558 | ||
| PA1 | Antiproliferative activity assay | 72 h | IC50 = 0.003 μM | 28857558 | ||
| HCT116 | Antiproliferative activity assay | 72 h | IC50 = 0.0041 μM | 28857558 | ||
| MDA-MB-468 | Antiproliferative activity assay | 72 h | IC50 = 0.0054 μM | 28857558 | ||
| HCT116/VP35 | Antiproliferative activity assay | 72 h | IC50 = 0.0063 μM | 28857558 | ||
| NCI-H520 | Antiproliferative activity assay | 72 h | IC50 = 0.0082 μM | 28857558 | ||
| LS174T | Antiproliferative activity assay | 72 h | IC50 = 0.0095 μM | 28857558 | ||
| MCF10A | Cytotoxicity assay | 72 h | IC50 = 0.0058 μM | 28926237 | ||
| MDA-MB-468 | Cytotoxicity assay | 72 h | IC50 = 0.0061 μM | 28926237 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0088 μM | 28926237 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.059 μM | 28926237 | ||
| HeLa | Cytotoxicity assay | 72 h | IC50 = 0.001 μM | 29043798 | ||
| A2780 | Cytotoxicity assay | 2 days | IC50 = 0.013 μM | 29048892 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.0062 μM | 29131631 | ||
| KB | Cytotoxicity assay | 72 h | IC50 = 0.0066 μM | 29131631 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0094 μM | 29131631 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0114 μM | 29131631 | ||
| KBVIN | Cytotoxicity assay | 72 h | IC50 = 1.86 μM | 29131631 | ||
| A2780 | Function assay | 48 h | GI50 = 0.00753 μM | 29138028 | ||
| OVCAR5 | Function assay | 48 h | GI50 = 0.021 μM | 29138028 | ||
| HCT116 | Antiproliferative activity assay | 48 h | IC50 = 1.37 μM | 29172082 | ||
| PC3 | Antiproliferative activity assay | 48 h | IC50 = 4.57 μM | 29172082 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 6.42 μM | 29172082 | ||
| H1299 | Antiproliferative activity assay | 48 h | IC50 = 7.83 μM | 29172082 | ||
| HCT116 | Antiproliferative activity assay | 48 h | IC50 = 0.014 μM | 29223717 | ||
| MCF7 | Antiproliferative activity assay | 48 h | IC50 = 1.428 μM | 29223717 | ||
| 143B | Antiproliferative activity assay | 48 h | IC50 = 5.56 μM | 29223717 | ||
| MES-SA/Dx5 | Growth inhibition assay | 72 h | IC50 = 0.21 μM | 29251920 | ||
| MDA435/LCC6 | Growth inhibition assay | 72 h | IC50 = 0.346 μM | 29251920 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29286250 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29286250 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29286250 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29286250 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29286250 | ||
| A2780 | Antiproliferative activity assay | 48 h | IC50 = 0.001 μM | 29306206 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.002 μM | 29306206 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.003 μM | 29306206 | ||
| MDA-MB-231 | Antiproliferative activity assay | 48 h | IC50 = 0.003 μM | 29306206 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 0.0036 μM | 29319316 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0045 μM | 29319316 | ||
| MDA-MB-231 | Antiproliferative activity assay | 72 h | IC50 = 0.007 μM | 29319316 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.0088 μM | 29319316 | ||
| KBVIN | Antiproliferative activity assay | 72 h | IC50 = 2.36 μM | 29319316 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338226 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338226 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338226 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338226 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338226 | ||
| SMMC7721 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338260 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338260 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338260 | ||
| SW480 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338260 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.008 μM | 29338260 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.0008 μM | 29350920 | ||
| HeLa | Cytotoxicity assay | 48 h | IC50 = 0.0046 μM | 29359935 | ||
| A2780 | Cytotoxicity assay | 48 h | IC50 = 0.0134 μM | 29359935 | ||
| Hela-beta3 | Cytotoxicity assay | 48 h | IC50 = 0.041 μM | 29359935 | ||
| HL60 | Cytotoxicity assay | 48 h | IC50 = 0.002 μM | 29373791 | ||
| LS180 | Cytotoxicity assay | 48 h | IC50 = 0.0028 μM | 29373791 | ||
| MDA-MB-231 | Cytotoxicity assay | 48 h | IC50 = 0.003 μM | 29373791 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.0068 μM | 29373791 | ||
| HCT116 | Cytotoxicity assay | 24 h | IC50 = 0.02 μM | 29395979 | ||
| SW480 | Cytotoxicity assay | 24 h | IC50 = 0.19 μM | 29395979 | ||
| T98G | Cytotoxicity assay | 24 h | IC50 = 0.74 μM | 29395979 | ||
| U87 | Cytotoxicity assay | 24 h | IC50 = 4.67 μM | 29395979 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 0.0011 μM | 29406710 | ||
| PC3 | Cytotoxicity assay | 72 h | IC50 = 0.0037 μM | 29406710 | ||
| PC3-TxR | Cytotoxicity assay | 72 h | IC50 = 0.1107 μM | 29406710 | ||
| ViBo | Antiproliferative activity assay | 24 h | IC50 = 1.59 μM | 29407986 | ||
| CaSki | Antiproliferative activity assay | 24 h | IC50 = 2.9 μM | 29407986 | ||
| A549 | Growth inhibition assay | 48 h | IC50 = 0.008 μM | 29412669 | ||
| HL60 | Growth inhibition assay | 48 h | IC50 = 0.008 μM | 29412669 | ||
| MCF7 | Growth inhibition assay | 48 h | IC50 = 0.008 μM | 29412669 | ||
| SMMC7721 | Growth inhibition assay | 48 h | IC50 = 0.008 μM | 29412669 | ||
| SW480 | Growth inhibition assay | 48 h | IC50 = 0.008 μM | 29412669 | ||
| HCT116 | Growth inhibition assay | 72 h | IC50 = 0.0041 μM | 29439899 | ||
| A549 | Growth inhibition assay | IC50 = 0.0071 μM | 29439899 | |||
| A549-T24 | Growth inhibition assay | IC50 = 0.07 μM | 29439899 | |||
| HCT116 | Cytotoxicity assay | IC50 = 0.0338 μM | 29468872 | |||
| paclitaxel-resistant MCF7 | Cytotoxicity assay | 72 h | IC50 = 2.29087 μM | 29468872 | ||
| HL60 | Antiproliferative activity assay | 48 h | IC50 = 0.0026 μM | 29475587 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.023 μM | 29475587 | ||
| 293T | Cytotoxicity assay | 4 days | IC50 = 0.0023 μM | 29486949 | ||
| HAC | Cytotoxicity assay | 4 days | IC50 = 0.0121 μM | 29486949 | ||
| KB-3-1 | Cytotoxicity assay | 72 h | IC50 = 0.0005 μM | 29501942 | ||
| SW620 | Cytotoxicity assay | 72 h | IC50 = 0.03 μM | 29501942 | ||
| KB-C2 | Cytotoxicity assay | 72 h | IC50 = 0.25 μM | 29501942 | ||
| SW620/AD300 | Cytotoxicity assay | 72 h | IC50 = 1.97 μM | 29501942 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.007 μM | 29501947 | ||
| A549/TR | Antiproliferative activity assay | 72 h | IC50 = 3.112 μM | 29501947 | ||
| SKOV3 | Cytotoxicity assay | 72 to 120 h | IC50 = 0.00239 μM | 29517223 | ||
| HEY | Cytotoxicity assay | 72 to 120 h | IC50 = 2.7 μM | 29517223 | ||
| SKVLB1 | Function assay | 72 to 120 h | IC50 = 3.733 μM | 29517223 | ||
| A2780cis | Growth inhibition assay | 72 h | IC50 = 0.003 μM | 29519737 | ||
| A2780 | Growth inhibition assay | 72 h | IC50 = 0.009 μM | 29519737 | ||
| OVCAR8 | Growth inhibition assay | 72 h | IC50 = 0.01 μM | 29519737 | ||
| ovarian epithelial | Growth inhibition assay | 48 h | IC50 = 0.03 μM | 29519737 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0024 μM | 29648818 | ||
| PC9 | Cytotoxicity assay | 72 h | IC50 = 0.0027 μM | 29648818 | ||
| A549 | Cytotoxicity assay | 72 h | IC50 = 0.0032 μM | 29648818 | ||
| HCC2998 | Growth inhibition assay | 48 h | GI50 = 0.001 μM | 29655610 | ||
| HeLa | Antiproliferative activity assay | IC50 = 0.0016 μM | 29655610 | |||
| SKOV3 | Antiproliferative activity assay | IC50 = 0.003 μM | 29655610 | |||
| NCI-H226 | Growth inhibition assay | 48 h | GI50 = 0.0039 μM | 29655610 | ||
| SW620 | Growth inhibition assay | 48 h | GI50 = 0.004 μM | 29655610 | ||
| OVCAR3 | Growth inhibition assay | 48 h | GI50 = 0.004 μM | 29655610 | ||
| MCF7 | Growth inhibition assay | 48 h | GI50 = 0.004 μM | 29655610 | ||
| HL-60(TB) | Growth inhibition assay | 48 h | GI50 = 0.004 μM | 29655610 | ||
| HCT116 | Growth inhibition assay | 48 h | GI50 = 0.004 μM | 29655610 | ||
| MDA-MB-435 | Growth inhibition assay | 48 h | GI50 = 0.004 μM | 29655610 | ||
| BT549 | Growth inhibition assay | 48 h | GI50 = 0.004 μM | 29655610 | ||
| SF539 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| KM12 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| UACC62 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| LOXIMVI | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| M14 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| SF268 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| MOLT4 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| HT-29 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| Hs578T | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| SK-MEL-5 | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| CCRF-CEM | Growth inhibition assay | 48 h | GI50 = 0.005 μM | 29655610 | ||
| NCI-H23 | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| U251 | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| SN12C | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| IGROV1 | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| A549/ATCC | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| PC3 | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| DU145 | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| NCI-H460 | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| K562 | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| SR | Growth inhibition assay | 48 h | GI50 = 0.0063 μM | 29655610 | ||
| SNB75 | Growth inhibition assay | 48 h | GI50 = 0.0079 μM | 29655610 | ||
| A498 | Growth inhibition assay | 48 h | GI50 = 0.0079 μM | 29655610 | ||
| COLO205 | Growth inhibition assay | 48 h | GI50 = 0.0079 μM | 29655610 | ||
| OVCAR5 | Growth inhibition assay | 48 h | GI50 = 0.0079 μM | 29655610 | ||
| OVCAR8 | Growth inhibition assay | 48 h | GI50 = 0.0079 μM | 29655610 | ||
| SNB19 | Growth inhibition assay | 48 h | GI50 = 0.01 μM | 29655610 | ||
| NCI-H322M | Growth inhibition assay | 48 h | GI50 = 0.0125 μM | 29655610 | ||
| MDA-MB-468 | Growth inhibition assay | 48 h | GI50 = 0.0125 μM | 29655610 | ||
| MDA-MB-231 | Growth inhibition assay | 48 h | GI50 = 0.0125 μM | 29655610 | ||
| RXF393 | Growth inhibition assay | 48 h | GI50 = 0.0158 μM | 29655610 | ||
| NCI-H522 | Growth inhibition assay | 48 h | GI50 = 0.0158 μM | 29655610 | ||
| HOP62 | Growth inhibition assay | 48 h | GI50 = 0.019 μM | 29655610 | ||
| TK10 | Growth inhibition assay | 48 h | GI50 = 0.0199 μM | 29655610 | ||
| RPMI8226 | Growth inhibition assay | 48 h | GI50 = 0.0199 μM | 29655610 | ||
| HOP92 | Growth inhibition assay | 48 h | GI50 = 0.025 μM | 29655610 | ||
| SF295 | Growth inhibition assay | 48 h | GI50 = 0.025 μM | 29655610 | ||
| 786-0 | Growth inhibition assay | 48 h | GI50 = 0.039 μM | 29655610 | ||
| MALME-3M | Growth inhibition assay | 48 h | GI50 = 0.05 μM | 29655610 | ||
| EKVX | Growth inhibition assay | 48 h | GI50 = 0.079 μM | 29655610 | ||
| UO31 | Growth inhibition assay | 48 h | GI50 = 0.125 μM | 29655610 | ||
| HCT15 | Growth inhibition assay | 48 h | GI50 = 0.125 μM | 29655610 | ||
| ACHN | Growth inhibition assay | 48 h | GI50 = 0.158 μM | 29655610 | ||
| Caki1 | Growth inhibition assay | 48 h | GI50 = 0.158 μM | 29655610 | ||
| SK-MEL-28 | Growth inhibition assay | 48 h | GI50 = 0.4 μM | 29655610 | ||
| SK-MEL-2 | Growth inhibition assay | 48 h | GI50 = 0.4 μM | 29655610 | ||
| NCI/ADR-RES | Growth inhibition assay | 48 h | GI50 = 0.63 μM | 29655610 | ||
| OVCAR4 | Growth inhibition assay | 48 h | GI50 = 0.63 μM | 29655610 | ||
| SKOV3-MDR1-M6/6 | Antiproliferative activity assay | IC50 = 2.6 μM | 29655610 | |||
| SKHEP1 | Growth inhibition assay | 48 h | GI50 = 0.011 μM | 29655982 | ||
| PC3 | Growth inhibition assay | 48 h | GI50 = 0.013 μM | 29655982 | ||
| HT-29 | Cytotoxicity assay | 24 to 72 h | IC50 = 0.011 μM | 29656990 | ||
| OVCAR3 | Cytotoxicity assay | 24 to 72 h | IC50 = 0.011 μM | 29656990 | ||
| OVCAR8 | Growth inhibition assay | 96 h | IC50 = 0.004 μM | 29730191 | ||
| MCF7 | Growth inhibition assay | 96 h | IC50 = 0.0055 μM | 29730191 | ||
| HepG2 | Growth inhibition assay | 48 h | IC50 = 2.66 μM | 29730191 | ||
| NCI/ADR-RES | Growth inhibition assay | 96 h | IC50 = 3.1 μM | 29730191 | ||
| A2780 | Cytotoxicity assay | 2 days | IC50 = 0.013 μM | 29738243 | ||
| A2780S | Antiproliferative activity assay | 48 to 72 h | IC50 = 0.01894 μM | 29754076 | ||
| A549 | Antiproliferative activity assay | 48 to 72 h | IC50 = 0.02318 μM | 29754076 | ||
| A549/TR | Antiproliferative activity assay | 48 to 72 h | IC50 = 0.75939 μM | 29754076 | ||
| MCF7 | Cytotoxicity assay | 48 h | IC50 = 0.005 μM | 29759727 | ||
| MIAPaCa2 | Cytotoxicity assay | 48 h | IC50 = 0.006 μM | 29759727 | ||
| PC3 | Cytotoxicity assay | 48 h | IC50 = 0.007 μM | 29759727 | ||
| HeLaS3 | Antiproliferative activity assay | 72 h | IC50 = 0.013 μM | 29803003 | ||
| KBVIN | Antiproliferative activity assay | 72 h | IC50 = 1.01 μM | 29803003 | ||
| MCF7 | Cytotoxicity assay | 4 days | IC50 = 0.008 μM | 29884535 | ||
| HL60 | Cytotoxicity assay | 4 days | IC50 = 0.008 μM | 29884535 | ||
| SMMC7721 | Cytotoxicity assay | 4 days | IC50 = 0.008 μM | 29884535 | ||
| A549 | Cytotoxicity assay | 4 days | IC50 = 0.008 μM | 29884535 | ||
| SW480 | Cytotoxicity assay | 4 days | IC50 = 0.008 μM | 29884535 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.0063 μM | 30010341 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 0.0068 μM | 30010341 | ||
| MDA-MB-231 | Antiproliferative activity assay | 72 h | IC50 = 0.0081 μM | 30010341 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.0112 μM | 30010341 | ||
| KBVIN | Antiproliferative activity assay | 72 h | IC50 = 2.786 μM | 30010341 | ||
| MCF7 | Cytotoxicity assay | 72 h | IC50 = 0.0096 μM | 30036834 | ||
| KB | Cytotoxicity assay | 72 h | IC50 = 0.0103 μM | 30036834 | ||
| KB/VCR | Cytotoxicity assay | 72 h | IC50 = 4 μM | 30036834 | ||
| HT-29 | Cytotoxicity assay | 72 h | IC50 = 0.009 μM | 30057155 | ||
| MDA-MB-435 | Cytotoxicity assay | 72 h | IC50 = 0.013 μM | 30057155 | ||
| OVCAR3 | Cytotoxicity assay | 72 h | IC50 = 0.013 μM | 30057155 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.017 μM | 30057155 | ||
| HeLa | Antiproliferative activity assay | 72 h | IC50 = 0.0028 μM | 30098869 | ||
| MDA-MB-435 | Antiproliferative activity assay | 72 h | IC50 = 0.0045 μM | 30098869 | ||
| SKOV3 | Antiproliferative activity assay | 72 h | IC50 = 0.005 μM | 30098869 | ||
| wild-type Hela-beta3 | Antiproliferative activity assay | 72 h | IC50 = 0.024 μM | 30098869 | ||
| SKOV3-MDR1-M6/6 | Antiproliferative activity assay | 72 h | IC50 = 1.2 μM | 30098869 | ||
| A375 | Antiproliferative activity assay | 72 h | IC50 = 0.0478 μM | 30099258 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 0.00571 μM | 30106296 | ||
| MCF7 | Antiproliferative activity assay | 72 h | IC50 = 0.00752 μM | 30106296 | ||
| MDA-MB-231 | Antiproliferative activity assay | 72 h | IC50 = 0.00851 μM | 30106296 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.00876 μM | 30106296 | ||
| KBVIN | Antiproliferative activity assay | 72 h | IC50 = 2.383 μM | 30106296 | ||
| PC3 | Cytotoxicity assay | 72 h | IC50 = 0.0011 μM | 30122035 | ||
| DU145 | Cytotoxicity assay | 72 h | IC50 = 0.0015 μM | 30122035 | ||
| PC3-TxR | Cytotoxicity assay | 72 h | IC50 = 0.1139 μM | 30122035 | ||
| KB | Antiproliferative activity assay | 72 h | IC50 = 5.9 μM | 30189396 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 6.8 μM | 30189396 | ||
| MDA-MB-231 | Antiproliferative activity assay | 72 h | IC50 = 9.6 μM | 30189396 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 h | IC50 = 0.0026 μM | 30192537 | ||
| MDA-MB-435 | Cytotoxicity assay | 72 h | IC50 = 0.0031 μM | 30192537 | ||
| OVCAR3 | Cytotoxicity assay | 72 h | IC50 = 0.0075 μM | 30192537 | ||
| MV411 | Antiproliferative activity assay | 72 h | IC50 = 0.017 μM | 30212198 | ||
| HGC27 | Antiproliferative activity assay | 72 h | IC50 = 0.028 μM | 30212198 | ||
| HeLa | Antiproliferative activity assay | 72 h | IC50 = 0.046 μM | 30212198 | ||
| A549 | Antiproliferative activity assay | 72 h | IC50 = 0.051 μM | 30212198 | ||
| HeLa | Antiproliferative activity assay | 48 h | IC50 = 0.0028 μM | 30297118 | ||
| SKOV3 | Antiproliferative activity assay | 48 h | IC50 = 0.005 μM | 30297118 | ||
| SKOV3-MDR1-M6/6 | Antiproliferative activity assay | 48 h | IC50 = 1.2 μM | 30297118 | ||
| HCC1806 | Antiproliferative activity assay | 24 h | IC50 = 0.001 μM | 30392953 | ||
| BEAS2B | Antiproliferative activity assay | 24 h | IC50 = 0.007 μM | 30392953 | ||
| HT-29 | Antiproliferative activity assay | 24 h | IC50 = 0.008 μM | 30392953 | ||
| HepG2 | Antiproliferative activity assay | 24 h | IC50 = 0.009 μM | 30392953 | ||
| PANC1 | Antiproliferative activity assay | 24 h | IC50 = 0.04 μM | 30392953 | ||
| MDA-MB-231 | Cytotoxicity assay | 48 h | IC50 = 0.004 μM | 30433783 | ||
| A549 | Cytotoxicity assay | 48 h | IC50 = 0.004 μM | 30433783 | ||
| PANC1 | Cytotoxicity assay | 48 h | IC50 = 0.06 μM | 30433783 | ||
| 4T1 | Cytotoxicity assay | 48 h | IC50 = 0.094 μM | 30433783 | ||
| A375 | Cytotoxicity assay | 48 h | IC50 = 0.1 μM | 30433783 | ||
| LLC | Cytotoxicity assay | 48 h | IC50 = 0.189 μM | 30433783 | ||
| B16F10 | Cytotoxicity assay | 48 h | IC50 = 0.53 μM | 30433783 | ||
| B16F10 spheroid | Cytotoxicity assay | 48 h | IC50 = 8.01 μM | 30433783 | ||
| Click to View More Cell Line Experimental Data | ||||||
|
In vitro |
DMSO
: 100 mg/mL
(117.1 mM)
Ethanol : 23 mg/mL Water : Insoluble |
|
In vivo |
|||||
Step 1: Enter information below (Recommended: An additional animal making an allowance for loss during the experiment)
Step 2: Enter the in vivo formulation (This is only the calculator, not formulation. Please contact us first if there is no in vivo formulation at the solubility Section.)
Calculation results:
Working concentration: mg/ml;
Method for preparing DMSO master liquid: mg drug pre-dissolved in μL DMSO ( Master liquid concentration mg/mL, Please contact us first if the concentration exceeds the DMSO solubility of the batch of drug. )
Method for preparing in vivo formulation: Take μL DMSO master liquid, next addμL PEG300, mix and clarify, next addμL Tween 80, mix and clarify, next add μL ddH2O, mix and clarify.
Method for preparing in vivo formulation: Take μL DMSO master liquid, next add μL Corn oil, mix and clarify.
Note: 1. Please make sure the liquid is clear before adding the next solvent.
2. Be sure to add the solvent(s) in order. You must ensure that the solution obtained, in the previous addition, is a clear solution before proceeding to add the next solvent. Physical methods such
as vortex, ultrasound or hot water bath can be used to aid dissolving.
| Molecular Weight | 853.91 | Formula | C47H51NO14 |
Storage (From the date of receipt) | |
|---|---|---|---|---|---|
| CAS No. | 33069-62-4 | Download SDF | Storage of Stock Solutions |
|
|
| Synonyms | NSC 125973,PTX | Smiles | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C | ||
| Targets/IC50/Ki |
Microtubule (human endothelial cells)
0.1 pM
|
|---|---|
| In vitro |
Paclitaxel inhibits non-endothelial type human cells at 104 - to 105 -fold higher concentrations, with IC50 of 1 nM-10 nM. The selectivity of this compound inhibition of cell proliferation is also species specific, as mouse ECs are not sensitive to this chemical at ultra low concentrations. Inhibition of human ECs by this compound at ultra low concentrations does not affect the cellular microtubule structure, and the treated cells do not show G2/M cell cycle arrest and apoptosis, suggesting a novel but as yet unidentified mechanism of action. In an in vitro angiogenesis assay, this chemical at ultra low concentrations blocks human ECs from forming sprouts and tubes in the three-dimensional fibrin matrix. In the presence of SMF, the efficient concentration of this compound on K562 cells is decreased from 50 to 10 ng/mL. The cell cycle arrest effect of this chemical with or without SMF on K562 cells is correlated with DNA damage. This compound alone causes a time-dependent inhibition of CDK1 in four cell lines including A549 cells, H358, H1395 cells and H1666 cells. |
| In vivo |
The inhibition rations of Paclitaxel alone on BC-V and BC-ER tumors are 49.78% and 51.23%, respectively. Treatment of six cycles of 20 mg/kg this compound significantly reduces the percentages of Ki-67-positive cells to 20.4% in BC-V tumors and 25.1% in BC-ER tumors, respectively. |
References |
|
| Methods | Biomarkers | Images | PMID |
|---|---|---|---|
| Western blot | p-ERK / ERK MARCKS (pSer159/163) Src (pTyr416) p-JAK2 / p-STAT3 / p-AKT / p-MAPK / Bcl-xl / MCL-1 Id1 MARCKS |
|
20068074 |
| Growth inhibition assay | Cell viability |
|
28823711 |
| Immunofluorescence | α-tubulin Rab11a/BV9 |
|
22904633 |
(data from https://clinicaltrials.gov, updated on 2024-05-22)
| NCT Number | Recruitment | Conditions | Sponsor/Collaborators | Start Date | Phases |
|---|---|---|---|---|---|
| NCT05312372 | Withdrawn | Esophageal Squamous Cell Carcinoma |
Institut de Recherches Internationales Servier|ADIR a Servier Group company|Servier |
May 2025 | Phase 1|Phase 2 |
| NCT04715542 | Not yet recruiting | Chemotherapy Induced Peripheral Neuropathy (CIPN) |
University of Bern|Insel Gruppe AG University Hospital Bern|Hospital of Thun|Tumor- und Brustzentrum ZeTuP St.Gallen|Gesundheitszentrum Fricktal AG|Kantonsspital Winterthur KSW|Kantonsspital Graubünden|Kantonsspital Aarau |
August 2024 | Phase 3 |
| NCT06387901 | Not yet recruiting | Breast Cancer|Paclitaxel Adverse Reaction|Chemotherapeutic Toxicity|Chemotherapeutic Agent Toxicity|Body Weight|Physical Inactivity |
Universitair Ziekenhuis Brussel|Vrije Universiteit Brussel|University Ghent |
May 6 2024 | -- |
| NCT05826015 | Not yet recruiting | Recurrent High Grade Uterine Cancer |
Washington University School of Medicine|National Cancer Institute (NCI)|Aravive Inc. |
May 31 2024 | Phase 1 |
| NCT05695313 | Recruiting | Breast Cancer |
Centre Georges Francois Leclerc |
April 12 2024 | Phase 2 |
Tel: +1-832-582-8158 Ext:3
If you have any other enquiries, please leave a message.
Question 1:
I am interested in the product S1150 for in vivo studies, could you please give some suggestions for the formulation of it?
Answer:
S1150 in 1% DMSO+30% polyethylene glycol+1% Tween 80 at 30mg/ml is a suspension. If you want to inject it, there is another vehicle, 5% DMSO+5% Tween 80+ddH2O. It can dissolve in it at 2.5mg/ml as a clear solution. This is a common formulation we used, but is not cited from reference.
Question 2:
It was dissolved into 1ml DMSO and diluted with 1x PBS or water (500ul + 9.5 ml PBS or water). I found the white precipitation goes out. How to figure it out?
Answer:
It has very low solubility in water based solution and that's why it precipitated out once you dilute the stock with water. The vehicle we suggest is: 1% DMSO+30% polyethylene glycol+1% Tween 80.