Molecular Weight: 1301.56 g/mol
Chemical Structure
Check the
Polymyxin B sulphate
product page for in-depth specifications, including solubility, stock solutions, MOA, and working concentrations.
|
Concentration
Volume
Mass
|
|---|
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.
| CAS Number | 1405-20-5 | |
|---|---|---|
| Molecular Formula |
C56H98N16O13.H2SO4 |
|
| Molecular Weight (MW) | 1301.56 | |
| SMILES | CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC2=CC=CC=C2)CC(C)C)CCN)CCN)C(C)O.OS(=O)(=O)O |
- Polymyxin B sulphate Clinical Trials
- Polymyxin B sulphate Solubility in DMSO
- Polymyxin B sulphate Stock Solution
- Polymyxin B sulphate Storage
- Polymyxin B sulphate Stability
- Polymyxin B sulphate SMILES
- Polymyxin B sulphate CAS Number
- Polymyxin B sulphate Chemical Structure (2D and 3D)
- Polymyxin B sulphate SDS｜MSDS
Note: Technical data last updated: Sep 1, 2026.