CAS No. 5086-74-8
| IUPAC Name | 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride | |
|---|---|---|
| CAS Number | 5086-74-8 | |
| Molecular Formula |
C11H12N2S.HCl |
|
| Molecular Weight (MW) | 240.75 | |
| SMILES | C1CSC2=NC(CN21)C3=CC=CC=C3.Cl | |
| InChIKey | LAZPBGZRMVRFKY-UHFFFAOYSA-N |
Tetramisole HCl is a racemic mixture and anthelmintic agent that targets nematode nicotinic acetylcholine receptors and inhibits alkaline phosphatase activity. By activating somatic nicotinic receptors, it causes persistent muscle depolarization, leading to spastic paralysis of susceptible parasites. Additionally, its inhibition of alkaline phosphatase modulates phosphate metabolism and cellular signaling pathways, contributing to its broad antiparasitic effects and utility in biochemical research. [1]
|
Concentration
Volume
Mass
|
|---|
| Solvent | Solubility & Note |
|---|---|
| Water | 41 mg/mL |
| DMSO |
Insoluble
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO.) |
| Ethanol | Insoluble |
- Preheat media/saline to 37°C.
- Mix rapidly (pipette/vortex) upon addition.
- For complex mixes, always add the aqueous phase last.
- Re-dissolve minor precipitates with a 37°C water bath and sonication (≤30 min).
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.