CAS No. 845273-93-0
| CAS Number | 845273-93-0 | |
|---|---|---|
| Molecular Formula |
(C3H7N.C3H5ClO)x.xCH2O3 |
|
| SMILES | C=CCN.C1C(O1)CCl.C(=O)(O)O |
Sevelamer carbonate is a non-absorbed phosphate-binding crosslinked polymer designed to bind phosphate in the gastrointestinal tract. By selectively binding dietary phosphate through ion exchange, it inhibits systemic phosphate absorption and reduces serum phosphorus accumulation. Beyond phosphate management, sevelamer carbonate interacts with intestinal bile acids, promoting their excretion and leading to downstream reductions in circulating total and low-density lipoprotein cholesterol levels.
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.