CAS No. 635-65-4
Chemical Structure
Check the
Bilibubin
product page for in-depth specifications, including solubility, stock solutions, MOA, and working concentrations.
| CAS Number | 635-65-4 | |
|---|---|---|
| Molecular Formula |
C33H36N4O6 |
|
| Molecular Weight (MW) | 584.66 | |
| SMILES | CC1=C(NC(=C1CCC(=O)O)CC2=C(C(=C(N2)C=C3C(=C(C(=O)N3)C)C=C)C)CCC(=O)O)C=C4C(=C(C(=O)N4)C=C)C |
Bilirubin is a tetrapyrrole metabolite produced during heme catabolism that acts as a physiological, chain-breaking antioxidant. It effectively scavenges peroxyl radicals and suppresses lipid peroxidation, thereby protecting cellular membranes and biomolecules from oxidative damage. By mitigating reactive oxygen species accumulation, bilirubin modulates cellular oxidative stress pathways and exerts cytoprotective effects to maintain cellular homeostasis. [1]
|
Concentration
Volume
Mass
|
|---|
Note: Technical data last updated: Sep 1, 2026.