CAS No. 532-03-6
| IUPAC Name | [2-hydroxy-3-(2-methoxyphenoxy)propyl] carbamate | |
|---|---|---|
| CAS Number | 532-03-6 | |
| Molecular Formula |
C11H15NO5 |
|
| Molecular Weight (MW) | 241.24 | |
| SMILES | COC1=CC=CC=C1OCC(COC(=O)N)O | |
| InChIKey | GNXFOGHNGIVQEH-UHFFFAOYSA-N |
Methocarbamol is a central muscle relaxant and carbonic anhydrase inhibitor used to suppress skeletal muscle spasms. As a carbamate derivative of guaifenesin, it acts primarily on the central nervous system to attenuate polysynaptic spinal reflexes without directly impairing skeletal muscle contractility. Furthermore, its inhibition of carbonic anhydrase isoforms modulates cellular acid-base equilibrium and neuronal excitability, contributing to reduced muscle hyperactivity.
|
Concentration
Volume
Mass
|
|---|
| Solvent | Solubility & Note |
|---|---|
| DMSO |
48 mg/mL
(198.97 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Ethanol | 48 mg/mL |
| Water | 2 mg/mL |
- Preheat media/saline to 37°C.
- Mix rapidly (pipette/vortex) upon addition.
- For complex mixes, always add the aqueous phase last.
- Re-dissolve minor precipitates with a 37°C water bath and sonication (≤30 min).
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.