CAS No. 378-44-9
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | |
|---|---|---|
| CAS Number | 378-44-9 | |
| Molecular Formula |
C22H29FO5 |
|
| Molecular Weight (MW) | 392.46 | |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C | |
| InChIKey | UREBDLICKHMUKA-DVTGEIKXSA-N |
Betamethasone is a potent glucocorticoid receptor agonist with anti-inflammatory and immunosuppressive properties. Upon binding to the glucocorticoid receptor, it promotes receptor translocation into the nucleus, where it modulates gene transcription by repressing pro-inflammatory transcription factors such as NF-kB and AP-1. Consequently, betamethasone suppresses the production of pro-inflammatory cytokines and inflammatory mediators, leading to reduced immune cell activation and tissue inflammation. [1]
|
Concentration
Volume
Mass
|
|---|
| Solvent | Solubility & Note |
|---|---|
| DMSO |
79 mg/mL
(201.29 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Ethanol | 10 mg/mL |
| Water | Insoluble |
| DMSO |
79 mg/mL
(201.29 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Ethanol | 10 mg/mL |
| Water | Insoluble |
| DMSO |
78 mg/mL
(198.74 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Ethanol | 25 mg/mL |
| Water | Insoluble |
- Preheat media/saline to 37°C.
- Mix rapidly (pipette/vortex) upon addition.
- For complex mixes, always add the aqueous phase last.
- Re-dissolve minor precipitates with a 37°C water bath and sonication (≤30 min).
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.