CAS No. 182410-00-0
| CAS Number | 182410-00-0 | |
|---|---|---|
| Molecular Formula |
C42H70-nO35.nNa.n(C4H8O3S) |
|
| SMILES | [Na+].[Na+].OCC1OC2OC3C(O)C(O)C(OC3CO)OC4C(O)C(O)C(OC4CO)OC5C(O)C(OCCCC[S]([O-])(=O)=O)C(OC5COCCCC[S]([O-])(=O)=O)OC6=C(CO)OC(OC7C(O)C(O)C(OC7CO)OC8C(O)C(O)C(OC8CO)OC1C(O)C2O)C(O)C6O |
SBE-β-CD (Sulfobutylether-β-cyclodextrin) is a polyanionic, chemically modified cyclodextrin derivative that functions as a pharmaceutical solubilizing agent and drug delivery carrier. By forming non-covalent inclusion complexes with lipophilic compounds, SBE-β-CD significantly enhances the aqueous solubility, stability, and bioavailability of poorly soluble active molecules. In cellular and formulation studies, this hydrophilic excipient improves drug dissolution and physical stability without destabilizing lipid membranes at physiological concentrations.
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.