CAS No. 212844-54-7
Batch:
Purity:98.22
Chemical Structure
Check the
Purvalanol B
product page for in-depth specifications, including solubility, stock solutions, MOA, and working concentrations.
| IUPAC Name | 2-chloro-4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]benzoic acid | |
|---|---|---|
| CAS Number | 212844-54-7 | |
| Molecular Formula |
C20H25ClN6O3 |
|
| Molecular Weight (MW) | 432.90 | |
| SMILES | CC(C)C(CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NC3=CC(=C(C=C3)C(=O)O)Cl | |
| InChIKey | ZKDXRFMOHZVXSG-HNNXBMFYSA-N |
Purvalanol B is a potent, selective cyclin-dependent kinase inhibitor targeting cdc2-cyclin B (IC50 = 6 nM), CDK2-cyclin A (IC50 = 6 nM), CDK2-cyclin E (IC50 = 9 nM), and CDK5-p35 (IC50 = 6 nM). By inhibiting cyclin-dependent kinase complexes, it disrupts cell cycle progression at the G1/S and G2/M transitions, leading to cell cycle arrest and induction of apoptosis in mammalian cells. [1]
|
Concentration
Volume
Mass
|
|---|
Batch:
All in vitro solubility values are batch-tested experimental data (non-literature values).
| Solvent | Solubility & Note |
|---|---|
| DMSO |
87 mg/mL
(200.97 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Water | Insoluble |
| Ethanol | Insoluble |
| DMSO |
86 mg/mL
(198.66 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Water | ˂1 mg/mL |
| Ethanol | ˂1 mg/mL |
Q: Why does a DMSO stock precipitate in media/saline?
A: It is caused by unheated aqueous media (supersaturation), local solvent shock, or incorrect mixing sequence.
How to fix it?
- Preheat media/saline to 37°C.
- Mix rapidly (pipette/vortex) upon addition.
- For complex mixes, always add the aqueous phase last.
- Re-dissolve minor precipitates with a 37°C water bath and sonication (≤30 min).
Note: Technical data last updated: Sep 1, 2026.