CAS No. 125697-91-8
Batch:
Purity:99.29
Chemical Structure
Check the
Lavendustin B
product page for in-depth specifications, including solubility, stock solutions, MOA, and working concentrations.
| IUPAC Name | 5-[bis[(2-hydroxyphenyl)methyl]amino]-2-hydroxybenzoic acid | |
|---|---|---|
| CAS Number | 125697-91-8 | |
| Molecular Formula |
C21H19NO5 |
|
| Molecular Weight (MW) | 365.38 | |
| SMILES | C1=CC=C(C(=C1)CN(CC2=CC=CC=C2O)C3=CC(=C(C=C3)O)C(=O)O)O | |
| InChIKey | RTYOLBQXFXYMKY-UHFFFAOYSA-N |
Lavendustin B is a small-molecule inhibitor of protein tyrosine kinases, glucose transporter 1 (GLUT1), and the interaction between HIV-1 integrase and its cellular cofactor lens epithelium-derived growth factor (LEDGF/p75). By disrupting the assembly of the HIV-1 integrase-LEDGF/p75 complex, it impairs viral integration and replication mechanisms. Additionally, inhibition of GLUT1 disrupts cellular glucose uptake, modulating metabolic and signaling pathways essential for cell growth.
|
Concentration
Volume
Mass
|
|---|
Batch:
All in vitro solubility values are batch-tested experimental data (non-literature values).
| Solvent | Solubility & Note |
|---|---|
| DMSO |
73 mg/mL
(199.79 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Ethanol | 73 mg/mL |
| Water | Insoluble |
Q: Why does a DMSO stock precipitate in media/saline?
A: It is caused by unheated aqueous media (supersaturation), local solvent shock, or incorrect mixing sequence.
How to fix it?
- Preheat media/saline to 37°C.
- Mix rapidly (pipette/vortex) upon addition.
- For complex mixes, always add the aqueous phase last.
- Re-dissolve minor precipitates with a 37°C water bath and sonication (≤30 min).
Note: Technical data last updated: Sep 1, 2026.