CAS No. 530-78-9
| IUPAC Name | 2-[3-(trifluoromethyl)anilino]benzoic acid | |
|---|---|---|
| CAS Number | 530-78-9 | |
| Molecular Formula |
C14H10F3NO2 |
|
| Molecular Weight (MW) | 281.23 | |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC(=C2)C(F)(F)F | |
| InChIKey | LPEPZBJOKDYZAD-UHFFFAOYSA-N |
Flufenamic acid is a non-steroidal anti-inflammatory agent and broad-spectrum ion channel modulator. It targets multiple ion channel families, including transient receptor potential (TRP) channels, calcium-activated chloride channels, and potassium channels. By regulating transmembrane ion fluxes and downregulating pro-inflammatory signaling pathways, flufenamic acid modulates cellular excitability, inflammatory responses, and membrane potential dynamics in various cell types. [1]
|
Concentration
Volume
Mass
|
|---|
| Solvent | Solubility & Note |
|---|---|
| DMSO |
56 mg/mL
(199.12 mM)
(Moisture-contaminated DMSO may reduce solubility. Use fresh, anhydrous DMSO. The recommended stock concentration is 10 mM in DMSO.) |
| Ethanol | 56 mg/mL |
| Water | Insoluble |
- Preheat media/saline to 37°C.
- Mix rapidly (pipette/vortex) upon addition.
- For complex mixes, always add the aqueous phase last.
- Re-dissolve minor precipitates with a 37°C water bath and sonication (≤30 min).
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.