CAS No. 548-62-9
| IUPAC Name | [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium chloride | |
|---|---|---|
| CAS Number | 548-62-9 | |
| Molecular Formula |
C25H30ClN3 |
|
| Molecular Weight (MW) | 407.98 | |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] | |
| InChIKey | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
Crystal violet is a triarylmethane dye that exhibits potent antibacterial, antifungal, and anthelmintic activities. It dissociates into positive ions that interact with cell wall components of microorganisms, disrupting cellular membranes and inhibiting protein synthesis. Beyond its traditional use as a histological stain and topical antiseptic, crystal violet generates reactive oxygen species, leading to oxidative stress and induction of apoptosis in susceptible cell types.
|
Concentration
Volume
Mass
|
|---|
Pre-aliquoted for Longevity: Solid-state aliquots offer significantly longer shelf life compared to stock solutions, ensuring maximum stability for every use.
Looking for a specific aliquot size? Reach out to your local sales representative or contact us at orders@selleckchem.com.